Compound Description
| ID: C0913 | Common name: Ap |
| IUPAC: (2S)-1-[(2S)-2-azaniumylpropanoyl]pyrrolidine-2-carboxylate | CAS: NA |
| Chembl ID: CHEMBL414828 | Pubchem ID: CID:11892823 |
| Formula: C8H14N2O3 | TCM-ID: TCMC708 |
| Smiles: OC(=O)[C@@H]1CCCN1C(=O)[C@@H](N)C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 21)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T45C0Q | Gonadotropin-releasing hormone receptor | GNRHR |
P30968 |
B | 1 Reference(s) |
| T51RUY | Cell division cycle 7-related protein kinase | CDC7 |
O00311 |
B | 1 Reference(s) |
| T60YNF | Y-box-binding protein 1 | YBX1 |
P67809 |
B | 1 Reference(s) |
| T94HJF | Replication protein A 70 kDa DNA-binding subunit | RPA1 |
P27694 |
B | 1 Reference(s) |
| T73LPO | Poly [ADP-ribose] polymerase 1 | PARP1 |
P09874 |
B | 1 Reference(s) |
| T78C6N | Cathepsin K | CTSK |
P43235 |
C | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T69NG6 | Interleukin-10 | IL10 |
P22301 |
C | 1 Reference(s) |
| T18B9T | Tubulinyl-Tyr carboxypeptidase 1 | VASH1 |
Q7L8A9 |
C | 1 Reference(s) |
| T58XLK | Tyrosine-protein phosphatase non-receptor type 1 | PTPN1 |
P18031 |
C | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T82D5L | Fibroblast growth factor 21 | FGF21 |
Q9NSA1 |
C | 1 Reference(s) |
| T27JG7 | 3-mercaptopyruvate sulfurtransferase | MPST |
P25325 |
C | 1 Reference(s) |
| T26SKO | Antithrombin-III | SERPINC1 |
P01008 |
C | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
C | 1 Reference(s) |
| T51U51 | Neurogenic locus notch homolog protein 2 | NOTCH2 |
Q04721 |
C | 1 Reference(s) |
| T29B10 | Interleukin-17A | IL17A |
Q16552 |
C | 1 Reference(s) |
| T03G09 | Tumor necrosis factor ligand superfamily member 11 | TNFSF11 |
O14788 |
C | 1 Reference(s) |
| T16K98 | Protein jagged-1 | JAG1 |
P78504 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target