Compound Description
| ID: C1183 | Common name: Bicuculline |
| IUPAC: (6R)-6-[(5S)-6-methyl-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-5-yl]-6H-furo[3,4-g][1,3]benzodioxol-8-one | CAS: CAS:485-49-4 |
| Chembl ID: CHEMBL417990 | Pubchem ID: CID:10237 |
| Formula: C20H17NO6 | TCM-ID: TCMC807 |
| Smiles: CN1CCC2=CC3=C(C=C2C1C4C5=C(C6=C(C=C5)OCO6)C(=O)O4)OCO3 | |
| Alias:
Bicuculline;
Furo[3,4-e]-1,3-benzodioxol-8(6H)-one, 6-(5,6,7,8-tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl)-, [R-(R*,S*)]-; (6R)-6-[(5S)-5,6,7,8-Tetrahydro-6-methyl-1,3-dioxolo[4,5-g]isoquinolin-5-yl]furo[3,4-e]-1,3-benzodioxol-8(6H)-one; 1,3-Dioxolo[4,5-g]isoquinoline, furo[3,4-e]-1,3-benzodioxol-8(6H)-one deriv.; (+)-Bicuculline; Bicucullin; Bucuculline; NSC 32192; d-Bicuculline |
Structure:
|
Related Targets (Total: 14)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T67JME | Gamma-aminobutyric acid receptor subunit rho-3 | GABRR3 |
A8MPY1 |
A | 1 Reference(s) |
| T40MJF | Gamma-aminobutyric acid receptor subunit gamma-1 | GABRG1 |
Q8N1C3 |
A | 4 Reference(s) |
| T41Z1X | Gamma-aminobutyric acid receptor-associated protein | GABARAP |
O95166 |
A | 4 Reference(s) |
| T37CD6 | Gamma-aminobutyric acid receptor subunit gamma-2 | GABRG2 |
P18507 |
A | 4 Reference(s) |
| T56MO9 | Gamma-aminobutyric acid receptor subunit alpha-3 | GABRA3 |
P34903 |
A | 1 Reference(s) |
| T87UF3 | Gamma-aminobutyric acid receptor subunit beta-3 | GABRB3 |
P28472 |
A | 1 Reference(s) |
| T02U6A | Metabotropic glutamate receptor 1 | GRM1 |
Q13255 |
B | 1 Reference(s) |
| T64P00 | Metabotropic glutamate receptor 5 | GRM5 |
P41594 |
B | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 3 Reference(s) |
| T95GWW | cAMP-specific 3',5'-cyclic phosphodiesterase 4A | PDE4A |
P27815 |
B | 1 Reference(s) |
| T76B0A | Gap junction alpha-1 protein | GJA1 |
P17302 |
B | 1 Reference(s) |
| T31XSX | Gap junction beta-1 protein | GJB1 |
P08034 |
B | 1 Reference(s) |
| T92XYL | Glutamate receptor ionotropic, NMDA 2D | GRIN2D |
O15399 |
C | 1 Reference(s) |
| T45C0Q | Gonadotropin-releasing hormone receptor | GNRHR |
P30968 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target