Compound Description
| ID: C1184 | Common name: Bile Acid |
| IUPAC: (2S,4R)-4-[(3R,5S,6R,7R,8S,9S,10S,13R,14S,17R)-6-ethyl-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylpentanoic acid | CAS: NA |
| Chembl ID: CHEMBL1258080 | Pubchem ID: CID:17755104 |
| Formula: C27H46O4 | TCM-ID: TCMC808 |
| Smiles: CC[C@H]1[C@@H](O)[C@H]2[C@@H]3CC[C@@H]([C@@]3(C)CC[C@@H]2[C@@]2([C@H]1C[C@H](O)CC2)C)[C@@H](C[C@@H](C(=O)O)C)C | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 25)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
A | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T74P7I | G-protein coupled bile acid receptor 1 | GPBAR1 |
Q8TDU6 |
A | 3 Reference(s) |
| T99EYH | Lipoprotein lipase | LPL |
P06858 |
A | 1 Reference(s) |
| T24C0P | Bile acid receptor | NR1H4 |
Q96RI1 |
A | 8 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
A | 1 Reference(s) |
| T23FEE | Hepatocyte nuclear factor 3-beta | FOXA2 |
Q9Y261 |
A | 1 Reference(s) |
| T01JZA | Spexin | SPX |
Q9BT56 |
A | 1 Reference(s) |
| T08Q1T | Amiloride-sensitive sodium channel subunit alpha | SCNN1A |
P37088 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
| T41INV | Nuclear receptor subfamily 1 group I member 3 | NR1I3 |
Q14994 |
B | 1 Reference(s) |
| T35W3S | Hemoglobin subunit gamma-1 | HBG1 |
P69891 |
B | 1 Reference(s) |
| T29B10 | Interleukin-17A | IL17A |
Q16552 |
B | 1 Reference(s) |
| T80ZO6 | 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase | CYP8B1 |
Q9UNU6 |
B | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T92E71 | Corticosteroid 11-beta-dehydrogenase isozyme 2 | HSD11B2 |
P80365 |
C | 1 Reference(s) |
| T53S43 | Homeobox protein CDX-2 | CDX2 |
Q99626 |
C | 2 Reference(s) |
| T73V21 | Transcription factor SOX-2 | SOX2 |
P48431 |
C | 1 Reference(s) |
| T40DIM | Corticosteroid 11-beta-dehydrogenase isozyme 1 | HSD11B1 |
P28845 |
C | 1 Reference(s) |
| T13DVU | Conserved oligomeric Golgi complex subunit 2 | COG2 |
Q14746 |
C | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
C | 1 Reference(s) |
| T43VRB | Fibroblast growth factor 19 | FGF19 |
O95750 |
C | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
| T49USV | Nuclear receptor subfamily 0 group B member 2 | NR0B2 |
Q15466 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0431 | She Dan Zhi | 蛇胆汁 | Snake bile | Fel serpentis liquidum |
Ckey description of the interaction between compound and target