Compound Description
| ID: C1211 | Common name: Cannabidiol |
| IUPAC: 2-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol | CAS: CAS:13956-29-1 |
| Chembl ID: CHEMBL190461 | Pubchem ID: CID:644019 |
| Formula: C21H30O2 | TCM-ID: TCMC861 |
| Smiles: CCCCCC1=CC(=C(C(=C1)O)C2C=C(CCC2C(=C)C)C)O | |
| Alias:
1,3-Benzenediol, 2-[3-methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-5-pentyl-, (1R-trans)-;
Cannabidiol; Resorcinol, 2-p-mentha-1,8-dien-3-yl-5-pentyl-, trans-(-)-; 2-[(1R,6R)-3-Methyl-6-(1-methylethenyl)-2-cyclohexen-1-yl]-5-pentyl-1,3-benzenediol; (-)-CBD; (-)-Cannabidiol; (-)-trans-Cannabidiol; CBD; Epidiolex; GWP 42003P; Δ1(2)-trans-Cannabidiol |
Structure:
|
Related Targets (Total: 29)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T19MG5 | N-arachidonyl glycine receptor | GPR18 |
Q14330 |
A | 1 Reference(s) |
| T58CPZ | G-protein coupled receptor 55 | GPR55 |
Q9Y2T6 |
A | 1 Reference(s) |
| T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
A | 1 Reference(s) |
| T78B5R | G-protein coupled receptor 6 | GPR6 |
P46095 |
A | 3 Reference(s) |
| T31U13 | Cytochrome P450 2C19 | CYP2C19 |
P33261 |
A | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
A | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 1 Reference(s) |
| T15P3B | Transient receptor potential cation channel subfamily V member 2 | TRPV2 |
Q9Y5S1 |
A | 2 Reference(s) |
| T26V6G | G-protein coupled receptor 3 | GPR3 |
P46089 |
A | 2 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
A | 1 Reference(s) |
| T31QEZ | 5-hydroxytryptamine receptor 1A | HTR1A |
P08908 |
A | 1 Reference(s) |
| T11ZYR | Cytochrome P450 2D6 | CYP2D6 |
P10635 |
A | 1 Reference(s) |
| T02ZAK | G-protein coupled receptor 12 | GPR12 |
P47775 |
A | 2 Reference(s) |
| T90ADC | BH3-interacting domain death agonist | BID |
P55957 |
B | 1 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T80OPZ | NADPH oxidase 4 | NOX4 |
Q9NPH5 |
B | 1 Reference(s) |
| T83QQX | Cytochrome b-245 light chain | CYBA |
P13498 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T17E49 | Cannabinoid receptor 1 | CNR1 |
P21554 |
B | 2 Reference(s) |
| T86CQC | Glutamate receptor ionotropic, NMDA 1 | GRIN1 |
Q05586 |
C | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
| T52VL6 | Signal transducer and activator of transcription 5A | STAT5A |
P42229 |
C | 1 Reference(s) |
| T19K8W | Signal transducer and activator of transcription 5B | STAT5B |
P51692 |
C | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| T95LIF | Cannabinoid receptor 2 | CNR2 |
P34972 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target