| ID: C1223 | Common name: Celecoxib |
| IUPAC: 4-[5-(4-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide | CAS: CAS:169590-42-5 |
| Chembl ID: CHEMBL118 | Pubchem ID: CID:2662 |
| Formula: C17H14F3N3O2S | TCM-ID: TCMC883 |
| Smiles: Cc1ccc(cc1)c1cc(nn1c1ccc(cc1)S(=O)(=O)N)C(F)(F)F | |
| Alias:
4-[5-(4-Methylphenyl)-3-(trifluoromethyl)-1H-pyrazol-1-yl]benzenesulfonamide;
Celebra; Celebrex; Celecox; Celecoxib; Celocoxib; Eurocox; Medicoxib; SC 58635; Xilebao; YM 177 |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
A | 174 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
A | 1 Reference(s) |
| T09Z3P | Neural cell adhesion molecule L1 | L1CAM |
P32004 |
A | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
| T71BDH | Mitogen-activated protein kinase 14 | MAPK14 |
Q16539 |
A | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
A | 3 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
A | 3 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
A | 3 Reference(s) |
| T85QFY | Somatostatin receptor type 2 | SSTR2 |
P30874 |
A | 1 Reference(s) |
| T99Z05 | Ceramide synthase 6 | CERS6 |
Q6ZMG9 |
A | 1 Reference(s) |
| T12PPL | Thyroid hormone receptor beta | THRB |
P10828 |
A | 1 Reference(s) |
| T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
A | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T40MAR | Cadherin-11 | CDH11 |
P55287 |
B | 2 Reference(s) |
| T57GP2 | ETS domain-containing protein Elk-1 | ELK1 |
P19419 |
B | 1 Reference(s) |
| T70KPE | Transient receptor potential cation channel subfamily V member 3 | TRPV3 |
Q8NET8 |
B | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
B | 1 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
B | 1 Reference(s) |
| T21TXM | Adapter molecule crk | CRK |
P46108 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T20FRX | Protein S100-A8 | S100A8 |
P05109 |
B | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 2 Reference(s) |
| T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
| T76PKX | Mast/stem cell growth factor receptor Kit | KIT |
P10721 |
C | 1 Reference(s) |
| T71B0A | Cytosolic phospholipase A2 | PLA2G4A |
P47712 |
C | 1 Reference(s) |
| T20MBF | Serotransferrin | TF |
P02787 |
C | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
C | 1 Reference(s) |
| T13JNR | E3 ubiquitin-protein ligase MYLIP | MYLIP |
Q8WY64 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T30L86 | Tumor necrosis factor receptor superfamily member 10B | TNFRSF10B |
O14763 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
| T79GMA | RNA-binding protein PNO1 | PNO1 |
Q9NRX1 |
C | 1 Reference(s) |
| T98PLL | Reversion-inducing cysteine-rich protein with Kazal motifs | RECK |
O95980 |
C | 1 Reference(s) |
| T04R1T | Major vault protein | MVP |
Q14764 |
C | 1 Reference(s) |
| T26SKO | Antithrombin-III | SERPINC1 |
P01008 |
C | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
| T23C50 | Tyrosine aminotransferase | TAT |
P17735 |
C | 1 Reference(s) |