Compound Description
| ID: C1225 | Common name: Cgmp |
| IUPAC: 9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]-2-amino-3H-purin-6-one | CAS: CAS:7665-99-8 |
| Chembl ID: CHEMBL395336 | Pubchem ID: CID:24316 |
| Formula: C10H12N5O7P | TCM-ID: TCMC888 |
| Smiles: O[C@@H]1[C@@H]2OP(=O)(O)OC[C@H]2O[C@H]1n1cnc2c1[nH]c(=N)nc2O | |
| Alias:
Guanosine 3',5'-phosphate (cyclic);
4H-Furo[3,2-d]-1,3,2-dioxaphosphorin, guanosine deriv.; 3',5'-Cyclic GMP; 3',5'-GMP; Cyclic 3',5'-GMP; Cyclic 3',5'-guanylic acid; Cyclic GMP; Cyclic guanosine 3',5'-monophosphate; Cyclic guanosine monophosphate; Guanosine 3',5'-monophosphate; Guanosine 3',5'-phosphate; Guanosine cyclic 3',5'-monophosphate; Guanosine cyclic 3',5'-phosphate; cGMP |
Structure:
|
Related Targets (Total: 20)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T99TRQ | cGMP-dependent 3',5'-cyclic phosphodiesterase | PDE2A |
O00408 |
A | 1 Reference(s) |
| T09HVO | Sodium/hydrogen exchanger 3 | SLC9A3 |
P48764 |
A | 2 Reference(s) |
| T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
A | 1 Reference(s) |
| T92P67 | Vasodilator-stimulated phosphoprotein | VASP |
P50552 |
B | 1 Reference(s) |
| T68EUG | Cyclic nucleotide-gated cation channel alpha-3 | CNGA3 |
Q16281 |
B | 1 Reference(s) |
| T91XPP | Beta-sarcoglycan | SGCB |
Q16585 |
B | 1 Reference(s) |
| T68CKY | Tyrosine-protein kinase Fyn | FYN |
P06241 |
B | 1 Reference(s) |
| T68IZC | Natriuretic peptides B | NPPB |
P16860 |
B | 1 Reference(s) |
| T75B9S | Cyclic AMP-responsive element-binding protein 1 | CREB1 |
P16220 |
B | 1 Reference(s) |
| T40Q3U | Retinal guanylyl cyclase 1 | GUCY2D |
Q02846 |
B | 1 Reference(s) |
| T10I26 | Interferon beta | IFNB1 |
P01574 |
B | 1 Reference(s) |
| T53MV1 | cGMP-dependent protein kinase 1 | PRKG1 |
Q13976 |
B | 1 Reference(s) |
| T85K8L | Forkhead box protein O1 | FOXO1 |
Q12778 |
B | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
B | 1 Reference(s) |
| T78F9O | Mucosal addressin cell adhesion molecule 1 | MADCAM1 |
Q13477 |
C | 1 Reference(s) |
| T54G8J | Protein kinase C delta type | PRKCD |
Q05655 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
| T64P00 | Metabotropic glutamate receptor 5 | GRM5 |
P41594 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target