Compound Description
| ID: C1254 | Common name: Corticosterone |
| IUPAC: (8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one | CAS: CAS:50-22-6 |
| Chembl ID: CHEMBL110739 | Pubchem ID: CID:5753 |
| Formula: C21H30O4 | TCM-ID: TCMC944 |
| Smiles: OCC(=O)[C@H]1CC[C@@H]2[C@]1(C)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C | |
| Alias:
Corticosterone;
(11β)-11,21-Dihydroxypregn-4-ene-3,20-dione; 11,21-Dihydroxyprogesterone; 11-Hydroxycorticoaldosterone; 11β,21-Dihydroxypregn-4-ene-3,20-dione; 11β,21-Dihydroxyprogesterone; 17-Deoxycortisol; 4-Pregnene-11β,21-diol-3,20-dione; Corticosteron; Kendall's compound B; NSC 9705; Reichstein's substance H |
Structure:
|
Related Targets (Total: 15)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T83ENN | Solute carrier family 22 member 3 | SLC22A3 |
O75751 |
A | 4 Reference(s) |
| T76SUY | Solute carrier family 22 member 2 | SLC22A2 |
O15244 |
A | 1 Reference(s) |
| T45P3N | Plexin-A2 | PLXNA2 |
O75051 |
A | 1 Reference(s) |
| T05WWN | Corticoliberin | CRH |
P06850 |
A | 2 Reference(s) |
| T64F54 | Mineralocorticoid receptor | NR3C2 |
P08235 |
B | 2 Reference(s) |
| T47G3X | Glucocorticoid receptor | NR3C1 |
P04150 |
B | 1 Reference(s) |
| T18KNG | Calretinin | CALB2 |
P22676 |
B | 1 Reference(s) |
| T17CNB | Thioredoxin | TXN |
P10599 |
B | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
B | 1 Reference(s) |
| T17E49 | Cannabinoid receptor 1 | CNR1 |
P21554 |
C | 1 Reference(s) |
| T80R6A | Insulin-like growth factor I | IGF1 |
P05019 |
C | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
C | 1 Reference(s) |
| T39T57 | Tryptophan 5-hydroxylase 1 | TPH1 |
P17752 |
C | 1 Reference(s) |
| T85YW8 | ERBB receptor feedback inhibitor 1 | ERRFI1 |
Q9UJM3 |
C | 1 Reference(s) |
| T63VZZ | Metastasis-suppressor KiSS-1 | KISS1 |
Q15726 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target