Compound Description
| ID: C1272 | Common name: Cyclopamine |
| IUPAC: (3S,3'R,3'aS,6'S,6aS,6bS,7'aR,9R,11aS,11bR)-3',6',10,11b-tetramethylspiro[2,3,4,6,6a,6b,7,8,11,11a-decahydro-1H-benzo[a]fluorene-9,2'-3a,4,5,6,7,7a-hexahydro-3H-furo[3,2-b]pyridine]-3-ol | CAS: CAS:4449-51-8 |
| Chembl ID: CHEMBL254129 | Pubchem ID: CID:442972 |
| Formula: C27H41NO2 | TCM-ID: TCMC971 |
| Smiles: O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC2=C(C)[C@]4(CC[C@@H]32)O[C@H]2[C@H]([C@H]4C)NC[C@H](C2)C)C1)C | |
| Alias:
Cyclopamine;
Jervine, 11-deoxo-; Veratraman-3-ol, 17,23-epoxy-, (3β,23β)-; (2'R,3S,3'R,3'aS,6'S,6aS,6bS,7'aR,11aS,11bR)-1,2,3,3'a,4,4',5',6,6',6a,6b,7,7',7'a,8,11,11a,11b-Octadecahydro-3',6',10,11b-tetramethylspiro[9H-benzo[a]fluorene-9,2'(3'H)-furo[3,2-b]pyridin]-3-ol; (-)-Cyclopamine; 11-Deoxojervine; 11-Deoxyjervine |
Structure:
|
Related Targets (Total: 10)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T84AR4 | Smoothened homolog | SMO |
Q99835 |
A | 13 Reference(s) |
| T35OPL | Sonic hedgehog protein | SHH |
Q15465 |
A | 15 Reference(s) |
| T50OPC | Indian hedgehog protein | IHH |
Q14623 |
A | 2 Reference(s) |
| T32MXJ | 7-dehydrocholesterol reductase | DHCR7 |
Q9UBM7 |
A | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
A | 1 Reference(s) |
| T55IBP | Zinc finger protein SNAI1 | SNAI1 |
O95863 |
C | 1 Reference(s) |
| T12IEI | Cadherin-2 | CDH2 |
P19022 |
C | 1 Reference(s) |
| T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
| T37PX5 | Zinc finger protein GLI1 | GLI1 |
P08151 |
C | 2 Reference(s) |
| T37ADS | Early growth response protein 1 | EGR1 |
P18146 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0214 | Bei He Huan | 北合欢 | Albizia | Albizia julibrissin |
Ckey description of the interaction between compound and target