Compound Description
| ID: C0080 | Common name: Fluoxetine |
| IUPAC: N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine | CAS: CAS:54910-89-3 |
| Chembl ID: CHEMBL41 | Pubchem ID: CID:3386 |
| Formula: C17H18F3NO | TCM-ID: TCMC1183 |
| Smiles: CNCCC(c1ccccc1)Oc1ccc(cc1)C(F)(F)F | |
| Alias:
Benzenepropanamine, N-methyl-γ-[4-(trifluoromethyl)phenoxy]-, (±)-;
N-Methyl-γ-[4-(trifluoromethyl)phenoxy]benzenepropanamine; (±)-Fluoxetine; (±)-N-Methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propylamine; 3-(p-Trifluoromethylphenoxy)-N-methyl-3-phenylpropylamine; Daforin; Deprex; Fluoxetin Ratiopharm; Fluoxetine; Fluoxin; Fluval; N-Methyl-3-(p-trifluoromethylphenoxy)-3-phenylpropylamine; N-Methyl-3-[4-(trifluoromethyl)phenoxy]-3-phenylpropanamine; NSC 283480; Nikomed; Seronil; Symbiax; dl-3-(p-Trifluoromethylphenoxy)-N-methyl-3-phenylpropylamine |
Structure:
|
Related Targets (Total: 19)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T25RHJ | Sodium-dependent serotonin transporter | SLC6A4 |
P31645 |
A | 11 Reference(s) |
| T11ZYR | Cytochrome P450 2D6 | CYP2D6 |
P10635 |
A | 5 Reference(s) |
| T25Y64 | Cholinesterase | BCHE |
P06276 |
A | 2 Reference(s) |
| T90LA2 | Sphingomyelin phosphodiesterase | SMPD1 |
P17405 |
A | 1 Reference(s) |
| T31QEZ | 5-hydroxytryptamine receptor 1A | HTR1A |
P08908 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
| T97ZTQ | 5-hydroxytryptamine receptor 1B | HTR1B |
P28222 |
A | 1 Reference(s) |
| T24LWC | Sodium-dependent dopamine transporter | SLC6A3 |
Q01959 |
A | 1 Reference(s) |
| T34ZZ0 | Potassium channel subfamily K member 2 | KCNK2 |
O95069 |
A | 1 Reference(s) |
| T63IUV | 5-hydroxytryptamine receptor 7 | HTR7 |
P34969 |
B | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 1 Reference(s) |
| T91KTQ | Methyl-CpG-binding protein 2 | MECP2 |
P51608 |
C | 1 Reference(s) |
| T78BSU | 5-hydroxytryptamine receptor 2B | HTR2B |
P41595 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
C | 1 Reference(s) |
| T88QQE | Fibroblast growth factor 2 | FGF2 |
P09038 |
C | 1 Reference(s) |
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
C | 1 Reference(s) |
| T75HMM | Induced myeloid leukemia cell differentiation protein Mcl-1 | MCL1 |
Q07820 |
C | 1 Reference(s) |
| T02DYS | Protein fosB | FOSB |
P53539 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 3)
Ckey description of the interaction between compound and target