Compound Description
| ID: C0379 | Common name: S-Adenosyl Methionine |
| IUPAC: (2S)-2-amino-4-[[(2S,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylsulfonio]butanoate | CAS: CAS:29908-03-0 |
| Chembl ID: CHEMBL1088977 | Pubchem ID: CID:34755 |
| Formula: C15H22N6O5S | TCM-ID: TCMC2033 |
| Smiles: C[S+](C[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1ncnc2N)CC[C@@H](C(=O)[O-])N | |
| Alias:
Adenosine, 5'-[(3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, hydroxide, inner salt, (3S)-;
Adenosine, 5'-[(L-3-amino-3-carboxypropyl)methylsulfonio]-5'-deoxy-, hydroxide, inner salt; Methionine, S-adenosyl-; Active methionine; Ademetionine; Adenosyl-L-methionine; AdoMet; Donamet; L-Methionine, S-adenosyl-; L-S-Adenosylmethionine; S Amet; S-Adenosyl methionine; S-Adenosyl-L-methionine; S-Adenosylmethionine; SAH (S-Adenosylmethionine); SAM; SAMe; Transmetil |
Structure:
|
Related Targets (Total: 20)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T61HJT | Histone-lysine N-methyltransferase EZH2 | EZH2 |
Q15910 |
A | 1 Reference(s) |
| T44UJK | Cystathionine beta-synthase;Cystathionine beta-synthase-like protein | CBS;CBSL |
P35520;P0DN79 |
A | 2 Reference(s) |
| T27LA6 | DNA | DNMT1 |
P26358 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
| T66YJ0 | Mu-type opioid receptor | OPRM1 |
P35372 |
A | 1 Reference(s) |
| T03CZ8 | Catechol O-methyltransferase | COMT |
P21964 |
B | 1 Reference(s) |
| T53VIQ | Protein-S-isoprenylcysteine O-methyltransferase | ICMT |
O60725 |
B | 1 Reference(s) |
| T88LD4 | Histone-lysine N-methyltransferase NSD2 | NSD2 |
O96028 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 3 Reference(s) |
| T73XHW | Nicotinamide N-methyltransferase | NNMT |
P40261 |
B | 1 Reference(s) |
| T99AV6 | Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 | INPPL1 |
O15357 |
B | 1 Reference(s) |
| T63RJO | Growth arrest and DNA damage-inducible protein GADD45 beta | GADD45B |
O75293 |
B | 1 Reference(s) |
| T93W1J | Vascular endothelial growth factor C | VEGFC |
P49767 |
C | 1 Reference(s) |
| T69NG6 | Interleukin-10 | IL10 |
P22301 |
C | 2 Reference(s) |
| T98O63 | Histone-lysine N-methyltransferase, H3 lysine-79 specific | DOT1L |
Q8TEK3 |
C | 1 Reference(s) |
| T25S8M | Phosphatidylethanolamine N-methyltransferase | PEMT |
Q9UBM1 |
C | 1 Reference(s) |
| T72C2U | Thiopurine S-methyltransferase | TPMT |
P51580 |
C | 1 Reference(s) |
| T49PKX | S-adenosylmethionine synthase isoform type-2 | MAT2A |
P31153 |
C | 1 Reference(s) |
| T44ISH | Transcription factor MafG | MAFG |
O15525 |
C | 1 Reference(s) |
| T92FAW | Dual specificity protein phosphatase 1 | DUSP1 |
P28562 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target