Compound Description
| ID: C0705 | Common name: Paeoniflorin |
| IUPAC: [(1R,2S,3R,5R,6R,8S)-6-hydroxy-8-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9,10-dioxatetracyclo[4.3.1.02,5.03,8]decan-2-yl]methyl benzoate | CAS: CAS:23180-57-6 |
| Chembl ID: CHEMBL4303209 | Pubchem ID: CID:442534 |
| Formula: C23H28O11 | TCM-ID: TCMC3904 |
| Smiles: CC12CC3(C4CC1(C4(C(O2)O3)COC(=O)C5=CC=CC=C5)OC6C(C(C(C(O6)CO)O)O)O)O | |
| Alias:
Peoniflorin;
β-D-Glucopyranoside, 5b-[(benzoyloxy)methyl]tetrahydro-5-hydroxy-2-methyl-2,5-methano-1H-3,4-dioxacyclobuta[cd]pentalen-1a(2H)-yl, [1aR-(1aα,2β,3aα,5α,5aα,5bα)]-; (1aR,2S,3aR,5R,5aR,5bS)-5b-[(Benzoyloxy)methyl]tetrahydro-5-hydroxy-2-methyl-2,5-methano-1H-3,4-dioxacyclobuta[cd]pentalen-1a(2H)-yl β-D-glucopyranoside; 2,5-Methano-1H-3,4-dioxacyclobuta[cd]pentalene, β-D-glucopyranoside deriv.; NSC 178886; Paeoniflorin |
Structure:
|
Related Targets (Total: 20)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T80R6A | Insulin-like growth factor I | IGF1 |
P05019 |
A | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
A | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
B | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T34AW3 | Lipopolysaccharide-binding protein | LBP |
P18428 |
C | 1 Reference(s) |
| T08OEP | Monocyte differentiation antigen CD14 | CD14 |
P08571 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T20E5P | Cytochrome b-245 heavy chain | CYBB |
P04839 |
C | 1 Reference(s) |
| T80OPZ | NADPH oxidase 4 | NOX4 |
Q9NPH5 |
C | 1 Reference(s) |
| T58D39 | Osteocalcin | BGLAP |
P02818 |
C | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T34N64 | NA | MIR29B1 |
NA |
C | 1 Reference(s) |
| T01E8J | Amyloid-beta precursor protein | APP |
P05067 |
C | 1 Reference(s) |
| T27F5B | Interleukin-1 receptor-associated kinase 1 | IRAK1 |
P51617 |
C | 1 Reference(s) |
| T58CAO | Alpha-synuclein | SNCA |
P37840 |
C | 1 Reference(s) |
| T52ARL | Suppressor of cytokine signaling 3 | SOCS3 |
O14543 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0804 | Zhi Ke | 枳壳 | Seville ora nge unripe fruit | Citrus aurantium |
Ckey description of the interaction between compound and target