Compound Description
| ID: C0721 | Common name: Baicalin |
| IUPAC: (2R,3R,4R,5S,6R)-6-(5,6-dihydroxy-4-oxo-2-phenylchromen-7-yl)oxy-3,4,5-trihydroxyoxane-2-carboxylic acid | CAS: CAS:21967-41-9 |
| Chembl ID: NA | Pubchem ID: CID:1549028 |
| Formula: C21H18O11 | TCM-ID: TCMC4172 |
| Smiles: [O-]C(=O)[C@@H]1O[C@H](Oc2cc3oc(cc(=O)c3c(c2O)O)c2ccccc2)[C@H]([C@@H]([C@H]1O)O)O | |
| Alias:
Baicalin;
5,6-Dihydroxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl β-D-glucopyranosiduronic acid; Baicalein 7-O-glucuronide; Baicalein 7-O-β-D-glucuronide; Baicalein 7-glucuronide |
Structure:
|
Related Targets (Total: 30)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T60A9R | NA | CYP3A |
NA |
A | 2 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 2 Reference(s) |
| T43QZ3 | Sclerostin | SOST |
Q9BQB4 |
A | 1 Reference(s) |
| T56TXY | Polyunsaturated fatty acid 5-lipoxygenase | ALOX5 |
P09917 |
A | 1 Reference(s) |
| T32JN2 | Beta-glucuronidase | GUSB |
P08236 |
A | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 1 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
A | 1 Reference(s) |
| T13KGH | Tyrosinase | TYR |
P14679 |
A | 1 Reference(s) |
| T02QBS | Cytochrome P450 1A2 | CYP1A2 |
P05177 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
| T18DUA | Tight junction protein ZO-1 | TJP1 |
Q07157 |
C | 1 Reference(s) |
| T77M4W | Adenosine receptor A2a | ADORA2A |
P29274 |
C | 1 Reference(s) |
| T65JUB | Nucleotide-binding oligomerization domain-containing protein 2 | NOD2 |
Q9HC29 |
C | 2 Reference(s) |
| T25SMR | Proto-oncogene Wnt-1 | WNT1 |
P04628 |
C | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T99ARN | Forkhead box protein P3 | FOXP3 |
Q9BZS1 |
C | 1 Reference(s) |
| T29B10 | Interleukin-17A | IL17A |
Q16552 |
C | 1 Reference(s) |
| T47G3X | Glucocorticoid receptor | NR3C1 |
P04150 |
C | 1 Reference(s) |
| T19XSL | Fatty acid-binding protein, liver | FABP1 |
P07148 |
C | 1 Reference(s) |
| T12PV0 | NA | MEG3 |
NA |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 1 Reference(s) |
| T93YV8 | Tumor necrosis factor receptor superfamily member 11B | TNFRSF11B |
O00300 |
C | 1 Reference(s) |
| T65S3S | Tyrosine-protein kinase JAK2 | JAK2 |
O60674 |
C | 1 Reference(s) |
| T08Q1T | Amiloride-sensitive sodium channel subunit alpha | SCNN1A |
P37088 |
C | 1 Reference(s) |
| T10MFU | DCC-interacting protein 13-beta | APPL2 |
Q8NEU8 |
C | 1 Reference(s) |
| T22NX4 | Toll-like receptor 2 | TLR2 |
O60603 |
C | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
C | 1 Reference(s) |
| T61J7T | Mothers against decapentaplegic homolog 2 | SMAD2 |
Q15796 |
C | 1 Reference(s) |
| T78O6C | Mothers against decapentaplegic homolog 3 | SMAD3 |
P84022 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0155 | Ban Xia | 半夏 | Ternate pinellia | Pinellia ternata |
Ckey description of the interaction between compound and target