ID: C0865 | Common name: Aicar |
IUPAC: [(2R,3S,4R,5R)-5-(5-amino-4-carbamoylimidazol-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate | CAS: CAS:3031-94-5 |
Chembl ID: CHEMBL483849 | Pubchem ID: CID:65110 |
Formula: C9H15N4O8P | TCM-ID: TCMC643 |
Smiles: O[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc(c1N)C(=N)O)COP(=O)(O)O | |
Alias:
Imidazole-4-carboxamide, 5-amino-1-β-D-ribofuranosyl-, 5'-(dihydrogen phosphate);
Imidazole-4-carboxamide, 5-amino-1-β-D-ribofuranosyl-, 5'-phosphate; 5-Amino-1-(5-O-phosphono-β-D-ribofuranosyl)-1H-imidazole-4-carboxamide; (2R,3 S,4R,5R)-5-(4-Carbam0yl-5-aminoimidazol-1-yl)-3,4-dihydroxyoxolan-2-yljmethyl dihydrogen phosphate; 5-Amino-1-(5'-phosphofuranoribosyl)-4-imidazolecarboxamide; 5-Amino-1β-D-ribofuranosylimidazole-4-carboxamide 5'-phosphate; 5-Amino-4-imidazolecarboxamide ribonucleoside 5'-monophosphate; 5-Amino-4-imidazolecarboxamide ribonucleotide; 5-Amino-4-imidazolecarboxamide riboside 5'-monophosphate; 5-Amino-4-imidazolecarboxamide ribotide; 5-Aminoimidazole-4-carboxamide ribonucleotide; 5-Aminoimidazole-4-carboxamide-1-beta-D-ribofuranosyl 5'-monophosphate; 5'-Phospho-β-D-ribosyl-5-amino-4-imidazolecarboxamide; 5'-Phosphoribosyl-5-amino-4-imidazolecarboxamide; AICA Ribotide; AICA-Ribonucleotide; AICAR; AICAR (5-Aminoimidazole-4-carboxamide-1-β-D-ribofuranosyl 5'-monophosphate); Acadesine 5'-monophosphate; Aminoimidazolecarboxamide ribonucleotide; NSC 283955; NSC 292227; ZMP; ZMP (alarmone) |
Structure: |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
A | 29 Reference(s) |
T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
T43SM9 | Peroxisome proliferator-activated receptor gamma coactivator 1-alpha | PPARGC1A |
Q9UBK2 |
A | 2 Reference(s) |
T71PTC | Protein kinase C iota type | PRKCI |
P41743 |
A | 1 Reference(s) |
T85H5E | N-glycosylase/DNA lyase [Includes: 8-oxoguanine DNA glycosylase | OGG1 |
O15527 |
A | 1 Reference(s) |
T67LL5 | Regulatory-associated protein of mTOR | RPTOR |
Q8N122 |
B | 1 Reference(s) |
T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
C | 1 Reference(s) |
T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
T38ILG | Zinc finger protein PLAGL1 | PLAGL1 |
Q9UM63 |
C | 1 Reference(s) |
T11FH6 | Phosphatidylinositol 3-kinase regulatory subunit alpha | PIK3R1 |
P27986 |
C | 1 Reference(s) |
T37VPC | Homeobox protein NANOG | NANOG |
Q9H9S0 |
C | 1 Reference(s) |
T79RG1 | Myosin-2 | MYH2 |
Q9UKX2 |
C | 1 Reference(s) |
T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
C | 1 Reference(s) |
T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
T51WGR | Pancreas/duodenum homeobox protein 1 | PDX1 |
P52945 |
C | 1 Reference(s) |
T39FBA | Thioredoxin-interacting protein | TXNIP |
Q9H3M7 |
C | 1 Reference(s) |
T32IXS | Integrin alpha-M | ITGAM |
P11215 |
C | 1 Reference(s) |
T16A8U | ELAV-like protein 1 | ELAVL1 |
Q15717 |
C | 1 Reference(s) |
T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
T49ORJ | Peroxisome proliferator-activated receptor alpha | PPARA |
Q07869 |
C | 1 Reference(s) |
T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
C | 1 Reference(s) |
T17AMT | NA | MIR34A |
NA |
C | 1 Reference(s) |
T18USV | NA | MIR34B |
NA |
C | 1 Reference(s) |
T87GZ4 | NA | MIR34C |
NA |
C | 1 Reference(s) |