Compound Description
| ID: C1046 | Common name: vinblastine |
| IUPAC: NA | CAS: CAS:865-21-4 |
| Chembl ID: CHEMBL159 | Pubchem ID: CID:13342 |
| Formula: C48H58N4O9 | TCM-ID: TCMC7485 |
| Smiles: CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O | |
| Alias:
Vinblastine (7CI);
1H-Indolizino[8,1-cd]carbazole, vincaleukoblastine deriv.; 2H-3,7-Methanoazacycloundecino[5,4-b]indole, vincaleukoblastine deriv.; (+)-Vinblastine; 1H-Indolizino[8,1-cd]carbazole-5-carboxylic acid, 4-(acetyloxy)-3a-ethyl-9-[5-ethyl-1,4,5,6,7,8,9,10-octahydro-5-hydroxy-9-(methoxycarbonyl)-2H-3,7-methanoazacycloundecino[5,4-b]indol-9-yl]-3a,4,5,5a,6,11,12,13a-octahydro-5-hydroxy-8-methoxy-6-methyl-, methyl ester, [3aR-[3aalpha,4beta,5beta,5abeta,9(3R*,5S*,7R*,9S*),10bR*,13aalpha]]-; Rozevin; VLB; Valban; Vinblastin; Vincaleucoblastin; Vincaleucoblastine; [3aR-[3aalpha,4beta,5beta,5abeta,9(3R*,5S*,7R*,9S*),10bR*,13aalpha]]-Methyl 4-(acetyloxy)-3a-ethyl-9-[5-ethyl-1,4,5,6,7,8,9,10-octahydro-5-hydroxy-9-(methoxycarbonyl)-2H-3,7-methanoazacycloundecino[5,4-b]indol-9-yl]-3a,4,5,5a,6,11,12,13a-octahydro-5-hydroxy-8-methoxy-6-methyl-1H-indolizino[8,1-cd]carbazole-5-carboxylate |
Structure:
|
Related Targets (Total: 18)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T05TS9 | Cocaine esterase | CES2 |
O00748 |
A | 1 Reference(s) |
| T21DUA | Arylacetamide deacetylase | AADAC |
P22760 |
A | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 1 Reference(s) |
| T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
B | 1 Reference(s) |
| T26KIE | Transcription factor AP-1 | JUN |
P05412 |
B | 1 Reference(s) |
| T88BCB | Glycerol-3-phosphate phosphatase | PGP |
A6NDG6 |
B | 2 Reference(s) |
| T63M1G | Integrin alpha-2 | ITGA2 |
P17301 |
B | 1 Reference(s) |
| T13HKH | Integrin alpha-5 | ITGA5 |
P08648 |
B | 1 Reference(s) |
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
C | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
| T12XP7 | Phospholipid-transporting ATPase ABCA3 | ABCA3 |
Q99758 |
C | 1 Reference(s) |
| T26FJI | ATP-binding cassette sub-family A member 2 | ABCA2 |
Q9BZC7 |
C | 1 Reference(s) |
| T99XQ3 | DNA topoisomerase 1 | TOP1 |
P11387 |
C | 1 Reference(s) |
| T36B1Q | Baculoviral IAP repeat-containing protein 5 | BIRC5 |
O15392 |
C | 1 Reference(s) |
| T04MBA | Vascular endothelial growth factor receptor 2 | KDR |
P35968 |
C | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target