Compound Description
| ID: C1106 | Common name: shikonin |
| IUPAC: 5,8-dihydroxy-2-(1-hydroxy-4-methylpent-3-enyl)naphthalene-1,4-dione | CAS: CAS:517-89-5 |
| Chembl ID: CHEMBL29285 | Pubchem ID: CID:5208 |
| Formula: C16H16O5 | TCM-ID: TCMC7542 |
| Smiles: CC(=CCC(C1=CC(=O)C2=C(C=CC(=C2C1=O)O)O)O)C | |
| Alias:
1,4-Naphthalenedione, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, (R)-;
1,4-Naphthalenedione, 5,8-dihydroxy-2-[(1R)-1-hydroxy-4-methyl-3-pentenyl]- (9CI); 1,4-Naphthoquinone, 5,8-dihydroxy-2-(1-hydroxy-4-methyl-3-pentenyl)-, (+)- (8CI); Shikonin (6CI); (+)-Shikonin; CI 75535; Isoarnebin 4; NSC 252844; Shikonin S; Shikonine; Tokyo Violet |
Structure:
|
Related Targets (Total: 24)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T06Q1R | Amine oxidase [flavin-containing] B | MAOB |
P27338 |
A | 1 Reference(s) |
| T21DZX | Amine oxidase [flavin-containing] A | MAOA |
P21397 |
A | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 1 Reference(s) |
| T85NRC | Pyruvate kinase PKM | PKM |
P14618 |
A | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 1 Reference(s) |
| T69NG6 | Interleukin-10 | IL10 |
P22301 |
B | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
B | 1 Reference(s) |
| T51UV4 | Trans-acting T-cell-specific transcription factor GATA-3 | GATA3 |
P23771 |
B | 1 Reference(s) |
| T04MBA | Vascular endothelial growth factor receptor 2 | KDR |
P35968 |
B | 1 Reference(s) |
| T87DGB | Angiopoietin-1 receptor | TEK |
Q02763 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T54CIF | Interleukin-8 | CXCL8 |
P10145 |
B | 1 Reference(s) |
| T09KQF | Proliferating cell nuclear antigen | PCNA |
P12004 |
B | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T18SKL | C-C motif chemokine 5 | CCL5 |
P13501 |
B | 1 Reference(s) |
| T92WFW | C-C motif chemokine 3 | CCL3 |
P10147 |
B | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T33OSQ | Sterol regulatory element-binding protein 1 | SREBF1 |
P36956 |
C | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
C | 1 Reference(s) |
| T96G89 | Fatty acid-binding protein, adipocyte | FABP4 |
P15090 |
C | 1 Reference(s) |
| T99EYH | Lipoprotein lipase | LPL |
P06858 |
C | 1 Reference(s) |
| T90ORW | Bcl2-associated agonist of cell death | BAD |
Q92934 |
C | 1 Reference(s) |
| T05CWL | Arylamine N-acetyltransferase 1 | NAT1 |
P18440 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target