Compound Description
| ID: C0100 | Common name: Gefitinib |
| IUPAC: N-(3-chloro-4-fluorophenyl)-7-methoxy-6-(3-morpholin-4-ylpropoxy)quinazolin-4-amine | CAS: NA |
| Chembl ID: CHEMBL939 | Pubchem ID: CID:123631 |
| Formula: C22H24ClFN4O3 | TCM-ID: TCMC1235 |
| Smiles: COc1cc2ncnc(c2cc1OCCCN1CCOCC1)Nc1ccc(c(c1)Cl)F | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 27)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
A | 20 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
A | 3 Reference(s) |
| T52CKD | Pro-epidermal growth factor | EGF |
P01133 |
A | 4 Reference(s) |
| T56A9T | Tyrosine-protein kinase TXK | TXK |
P42681 |
A | 3 Reference(s) |
| T02AK2 | Receptor-interacting serine/threonine-protein kinase 2 | RIPK2 |
O43353 |
A | 4 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
A | 1 Reference(s) |
| T89Z7O | NA | FCGR1CP |
NA |
A | 1 Reference(s) |
| T14JZK | Receptor tyrosine-protein kinase erbB-3 | ERBB3 |
P21860 |
A | 1 Reference(s) |
| T84FSA | Forkhead box protein O3 | FOXO3 |
O43524 |
A | 1 Reference(s) |
| T38O11 | Cyclin-G-associated kinase | GAK |
O14976 |
B | 2 Reference(s) |
| T83P5X | Inhibitor of nuclear factor kappa-B kinase subunit beta | IKBKB |
O14920 |
B | 1 Reference(s) |
| T84C2C | Protein Tob1 | TOB1 |
P50616 |
B | 1 Reference(s) |
| T08OIA | Microtubule-associated proteins 1A/1B light chain 3A | MAP1LC3A |
Q9H492 |
C | 2 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
C | 1 Reference(s) |
| T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
C | 1 Reference(s) |
| T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
C | 1 Reference(s) |
| T46K2X | Heat shock 70 kDa protein 4 | HSPA4 |
P34932 |
C | 1 Reference(s) |
| T51DHZ | Protein C-ets-1 | ETS1 |
P14921 |
C | 1 Reference(s) |
| T34N64 | NA | MIR29B1 |
NA |
C | 1 Reference(s) |
| T72TF8 | Methylcytosine dioxygenase TET1 | TET1 |
Q8NFU7 |
C | 1 Reference(s) |
| T68O49 | Prostaglandin E2 receptor EP4 subtype | PTGER4 |
P35408 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| T32PI2 | Programmed cell death 1 ligand 1 | CD274 |
Q9NZQ7 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0629 | Xi Xin | 细辛 | Siebold wildginger | Asarum sieboldii |
Ckey description of the interaction between compound and target