ID: C0403 | Common name: Silibinin |
IUPAC: 3,5,7-trihydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-2,3-dihydrochromen-4-one | CAS: CAS:22888-70-6 |
Chembl ID: CHEMBL1401508 | Pubchem ID: CID:5213 |
Formula: C25H22O10 | TCM-ID: TCMC2079 |
Smiles: OCC1Oc2ccc(cc2OC1c1ccc(c(c1)OC)O)C1Oc2cc(O)cc(c2C(=O)C1O)O | |
Alias:
4-Chromanone, 3,5,7-trihydroxy-2-[3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxan-6-yl]-;
4H-1-Benzopyran-4-one, 2-[2,3-dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-, [2R-[2α,3β,6(2R*,3R*)]]-; Silybin; (2R,3R)-2-[(2R,3R)-2,3-Dihydro-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-1,4-benzodioxin-6-yl]-2,3-dihydro-3,5,7-trihydroxy-4H-1-benzopyran-4-one; 1,4-Benzodioxin, 4H-1-benzopyran-4-one deriv.; 7C3MT; Mepasil; Realsil; Silibinin; Silibinin A; Silliver; Silybin A; Silybin b1; Silybine; Silybum substance E6; Silymarin I; Silymarin MZ 80; Silymarine I |
Structure:
![]() |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 2 Reference(s) |
T05O6O | Estrogen receptor beta | ESR2 |
Q92731 |
A | 2 Reference(s) |
T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
A | 2 Reference(s) |
T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
A | 1 Reference(s) |
T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
A | 2 Reference(s) |
T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 1 Reference(s) |
T27LA6 | DNA | DNMT1 |
P26358 |
A | 1 Reference(s) |
T49ORJ | Peroxisome proliferator-activated receptor alpha | PPARA |
Q07869 |
C | 1 Reference(s) |
T43SM9 | Peroxisome proliferator-activated receptor gamma coactivator 1-alpha | PPARGC1A |
Q9UBK2 |
C | 1 Reference(s) |
T02Z3O | Low-density lipoprotein receptor-related protein 6 | LRP6 |
O75581 |
C | 1 Reference(s) |
T10H9X | UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit | OGT |
O15294 |
C | 1 Reference(s) |
T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 1 Reference(s) |
T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
T87F4H | Insulin-induced gene 1 protein | INSIG1 |
O15503 |
C | 1 Reference(s) |
T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
C | 1 Reference(s) |
T93SFQ | NAD-dependent protein deacetylase sirtuin-1 | SIRT1 |
Q96EB6 |
C | 1 Reference(s) |
T33OSQ | Sterol regulatory element-binding protein 1 | SREBF1 |
P36956 |
C | 1 Reference(s) |
T68M1D | Histone deacetylase 2 | HDAC2 |
Q92769 |
C | 1 Reference(s) |
T57HGP | Tumor necrosis factor receptor superfamily member 6 | FAS |
P25445 |
C | 1 Reference(s) |