Compound Description
| ID: C0627 | Common name: Matrine |
| IUPAC: (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one | CAS: CAS:519-02-8 |
| Chembl ID: CHEMBL204860 | Pubchem ID: CID:91466 |
| Formula: C15H24N2O | TCM-ID: TCMC3311 |
| Smiles: O=C1CCC[C@H]2N1C[C@@H]1CCC[NH+]3[C@@H]1[C@@H]2CCC3 | |
| Alias:
Matridin-15-one;
Matrine; (7aS,13aR,13bR,13cS)-Dodecahydro-1H,5H,10H-dipyrido[2,1-f |
Structure:
|
Related Targets (Total: 24)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T25M2J | Anoctamin-1 | ANO1 |
Q5XXA6 |
A | 2 Reference(s) |
| T53KY7 | Cystic fibrosis transmembrane conductance regulator | CFTR |
P13569 |
A | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
A | 2 Reference(s) |
| T45X9Z | Hepatocyte growth factor | HGF |
P14210 |
A | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 2 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T43HES | Paired box protein Pax-2 | PAX2 |
Q02962 |
C | 2 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T87FX7 | Receptor-interacting serine/threonine-protein kinase 3 | RIPK3 |
Q9Y572 |
C | 1 Reference(s) |
| T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
C | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
C | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
C | 1 Reference(s) |
| T15JRW | Interferon alpha-inducible protein 27, mitochondrial | IFI27 |
P40305 |
C | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
| T33JGV | Tumor suppressor ARF;Cyclin-dependent kinase inhibitor 2A | CDKN2A |
Q8N726;P42771 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| T21EGX | Multidrug resistance-associated protein 1 | ABCC1 |
P33527 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
C | 1 Reference(s) |
| T57HGP | Tumor necrosis factor receptor superfamily member 6 | FAS |
P25445 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target