Compound Description
| ID: C0937 | Common name: rottlerin |
| IUPAC: (E)-1-[6-[(3-acetyl-2,4,6-trihydroxy-5-methylphenyl)methyl]-5,7-dihydroxy-2,2-dimethylchromen-8-yl]-3-phenylprop-2-en-1-one | CAS: CAS:82-08-6 |
| Chembl ID: CHEMBL34241 | Pubchem ID: CID:5281847 |
| Formula: C30H28O8 | TCM-ID: TCMC7381 |
| Smiles: CC1=C(C(=C(C(=C1O)C(=O)C)O)CC2=C(C(=C3C(=C2O)C=CC(O3)(C)C)C(=O)C=CC4=CC=CC=C4)O)O | |
| Alias:
2-Propen-1-one, 1-[6-[(3-acetyl-2,4,6-trihydroxy-5-methylphenyl)methyl]-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-8-yl]-3-phenyl-, (E)-;
Acetophenone, 3'-[(8-cinnamoyl-5,7-dihydroxy-2,2-dimethyl-2H-1-benzopyran-6-yl)methyl]-2',4',6'-trihydroxy-5'-methyl- (7CI,8CI); Rottlerin (6CI); Mallotoxin; NSC 56346; NSC 94525 |
Structure:
|
Related Targets (Total: 32)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T54G8J | Protein kinase C delta type | PRKCD |
Q05655 |
A | 3 Reference(s) |
| T95QJ9 | G1/S-specific cyclin-D3 | CCND3 |
P30281 |
B | 1 Reference(s) |
| T16UPB | STE20/SPS1-related proline-alanine-rich protein kinase | STK39 |
Q9UEW8 |
B | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 3 Reference(s) |
| T41CZ3 | Phospholipid scramblase 1 | PLSCR1 |
O15162 |
B | 1 Reference(s) |
| T32IXS | Integrin alpha-M | ITGAM |
P11215 |
B | 1 Reference(s) |
| T47MPW | T-lymphocyte activation antigen CD86 | CD86 |
P42081 |
B | 1 Reference(s) |
| T70YKV | Baculoviral IAP repeat-containing protein 3 | BIRC3 |
Q13489 |
B | 1 Reference(s) |
| T78O6C | Mothers against decapentaplegic homolog 3 | SMAD3 |
P84022 |
B | 1 Reference(s) |
| T21MT2 | Nuclear factor of activated T-cells 5 | NFAT5 |
O94916 |
B | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
| T67X1L | Eukaryotic translation initiation factor 2 subunit 1 | EIF2S1 |
P05198 |
B | 1 Reference(s) |
| T43LYL | X-box-binding protein 1 | XBP1 |
P17861 |
B | 1 Reference(s) |
| T54SZZ | Endoplasmic reticulum chaperone BiP | HSPA5 |
P11021 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
C | 1 Reference(s) |
| T36I66 | Metallothionein-2 | MT2A |
P02795 |
C | 1 Reference(s) |
| T77YFO | Voltage-dependent L-type calcium channel subunit alpha-1C | CACNA1C |
Q13936 |
C | 1 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
C | 1 Reference(s) |
| T58D39 | Osteocalcin | BGLAP |
P02818 |
C | 1 Reference(s) |
| T98GAQ | Bone sialoprotein 2 | IBSP |
P21815 |
C | 1 Reference(s) |
| T88MR0 | Solute carrier family 26 member 6 | SLC26A6 |
Q9BXS9 |
C | 1 Reference(s) |
| T71B0A | Cytosolic phospholipase A2 | PLA2G4A |
P47712 |
C | 1 Reference(s) |
| T02WMA | Ornithine decarboxylase | ODC1 |
P11926 |
C | 1 Reference(s) |
| T26FBV | Protein-glutamine gamma-glutamyltransferase 2 | TGM2 |
P21980 |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
C | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
C | 1 Reference(s) |
| T32ECR | Collagen alpha-2(I) chain | COL1A2 |
P08123 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target