Compound Description
| ID: C0322 | Common name: Prasterone |
| IUPAC: (3S,8R,9S,10R,13S,14S)-3-hydroxy-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-one | CAS: CAS:53-43-0 |
| Chembl ID: CHEMBL90593 | Pubchem ID: CID:5881 |
| Formula: C19H28O2 | TCM-ID: TCMC1930 |
| Smiles: O[C@H]1CC[C@]2(C(=CC[C@@H]3[C@@H]2CC[C@]2([C@H]3CCC2=O)C)C1)C | |
| Alias:
Androst-5-en-17-one, 3β-hydroxy-;
(3β)-3-Hydroxyandrost-5-en-17-one; 17-Chetovis; 17-Hormoforin; 3β-Hydroxy-Δ5-androsten-17-one; 3β-Hydroxyandrost-5-en-17-one; 3β-Hydroxyandrost-5-ene-17-one; 5,6-Dehydroisoandrosterone; 5,6-Didehydroisoandrosterone; 5-Androsten-3β-ol-17-one; 5-Dehydroepiandrosterone; Androst-5-ene-17-one-3β-ol; Androst-5-ene-3β-ol-17-one; Androstenolone; Astenile; DHA; DHEA; Deandros; Dehydro-epi-androsterone; Dehydroepiandrosterone; Dehydroisoandrosterone; Diandron; Diandrone; EM 760; GL 701; IM 28; Immunor; Intrarosa; NSC 9896; Prasterone; Psicosterone; Siscelar plus; trans-Dehydroandrosterone; Δ5-Androsten-3β-ol-17-one |
Structure:
|
Related Targets (Total: 50)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T70U24 | Sigma non-opioid intracellular receptor 1 | SIGMAR1 |
Q99720 |
A | 4 Reference(s) |
| T87UKX | Glucose-6-phosphate 1-dehydrogenase | G6PD |
P11413 |
A | 7 Reference(s) |
| T88MHO | Free fatty acid receptor 1 | FFAR1 |
O14842 |
A | 1 Reference(s) |
| T06DT5 | Phorbol-12-myristate-13-acetate-induced protein 1 | PMAIP1 |
Q13794 |
A | 1 Reference(s) |
| T63FF5 | Interferon regulatory factor 3 | IRF3 |
Q14653 |
A | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
A | 1 Reference(s) |
| T76MVQ | Free fatty acid receptor 4 | FFAR4 |
Q5NUL3 |
A | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T68EEP | Phospholipase D1 | PLD1 |
Q13393 |
A | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
A | 1 Reference(s) |
| T68OIU | CREB-regulated transcription coactivator 1 | CRTC1 |
Q6UUV9 |
A | 1 Reference(s) |
| T02K4F | C-X-C motif chemokine 16 | CXCL16 |
Q9H2A7 |
A | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 2 Reference(s) |
| T85NRC | Pyruvate kinase PKM | PKM |
P14618 |
A | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
A | 1 Reference(s) |
| T40DIM | Corticosteroid 11-beta-dehydrogenase isozyme 1 | HSD11B1 |
P28845 |
A | 1 Reference(s) |
| T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
B | 1 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
B | 1 Reference(s) |
| T04HSR | Fatty acid-binding protein, brain | FABP7 |
O15540 |
B | 1 Reference(s) |
| T88HX4 | Sulfotransferase 2A1 | SULT2A1 |
Q06520 |
B | 1 Reference(s) |
| T54WR0 | Fatty acid-binding protein 5 | FABP5 |
Q01469 |
C | 2 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 2 Reference(s) |
| T05AAL | Microphthalmia-associated transcription factor | MITF |
O75030 |
C | 1 Reference(s) |
| T67ZCS | NLR family CARD domain-containing protein 4 | NLRC4 |
Q9NPP4 |
C | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 2 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T62P0D | Collagenase 3 | MMP13 |
P45452 |
C | 1 Reference(s) |
| T24U57 | E-selectin | SELE |
P16581 |
C | 1 Reference(s) |
| T90GHM | A-kinase anchor protein 12 | AKAP12 |
Q02952 |
C | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
C | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
C | 1 Reference(s) |
| T09KQF | Proliferating cell nuclear antigen | PCNA |
P12004 |
C | 1 Reference(s) |
| T90XYZ | C-reactive protein | CRP |
P02741 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
C | 1 Reference(s) |
| T95IYZ | Adiponectin | ADIPOQ |
Q15848 |
C | 1 Reference(s) |
| T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
C | 1 Reference(s) |
| T17FIA | Angiotensinogen | AGT |
P01019 |
C | 1 Reference(s) |
| T05O6O | Estrogen receptor beta | ESR2 |
Q92731 |
C | 1 Reference(s) |
| T01SWU | Early activation antigen CD69 | CD69 |
Q07108 |
C | 1 Reference(s) |
| T64F54 | Mineralocorticoid receptor | NR3C2 |
P08235 |
C | 1 Reference(s) |
| T16OQ5 | Puromycin-sensitive aminopeptidase | NPEPPS |
P55786 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target