Compound Description
| ID: C0868 | Common name: Aldosterone |
| IUPAC: (8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10-methyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-13-carbaldehyde | CAS: CAS:6251-69-0 |
| Chembl ID: CHEMBL273453 | Pubchem ID: CID:5839 |
| Formula: C21H28O5 | TCM-ID: TCMC649 |
| Smiles: OCC(=O)[C@H]1CC[C@@H]2[C@]1(C=O)C[C@H](O)[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C | |
| Alias:
Pregn-4-ene-3,20-dione, 11β,18-epoxy-18,21-dihydroxy-;
(11β)-11,18-Epoxy-18,21-dihydroxypregn-4-ene-3,20-dione; Aldosterone |
Structure:
|
Related Targets (Total: 35)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T88ER9 | Serine/threonine-protein kinase D1 | PRKD1 |
Q15139 |
A | 1 Reference(s) |
| T64F54 | Mineralocorticoid receptor | NR3C2 |
P08235 |
A | 8 Reference(s) |
| T37WU9 | Sodium/hydrogen exchanger 10 | SLC9C1 |
Q4G0N8 |
A | 1 Reference(s) |
| T01KGS | Pendrin | SLC26A4 |
O43511 |
A | 2 Reference(s) |
| T37YKZ | Endothelin receptor type B | EDNRB |
P24530 |
A | 1 Reference(s) |
| T28PHS | Angiotensin-converting enzyme | ACE |
P12821 |
A | 1 Reference(s) |
| T69WIB | Solute carrier family 12 member 3 | SLC12A3 |
P55017 |
B | 1 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
B | 1 Reference(s) |
| T47YVM | Serine/threonine-protein kinase Sgk1 | SGK1 |
O00141 |
B | 1 Reference(s) |
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
C | 3 Reference(s) |
| T23RWU | Type-1 angiotensin II receptor | AGTR1 |
P30556 |
C | 2 Reference(s) |
| T02YDU | Amiloride-sensitive sodium channel subunit gamma | SCNN1G |
P51170 |
C | 1 Reference(s) |
| T50VJF | Osteopontin | SPP1 |
P10451 |
C | 1 Reference(s) |
| T37JN5 | Neutrophil gelatinase-associated lipocalin | LCN2 |
P80188 |
C | 1 Reference(s) |
| T08Q1T | Amiloride-sensitive sodium channel subunit alpha | SCNN1A |
P37088 |
C | 1 Reference(s) |
| T84XW5 | Placenta growth factor | PGF |
P49763 |
C | 2 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T96EYH | Prostasin | PRSS8 |
Q16651 |
C | 1 Reference(s) |
| T46J84 | Nicotinamide phosphoribosyltransferase | NAMPT |
P43490 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T18LPB | Cytochrome P450 11B2, mitochondrial | CYP11B2 |
P19099 |
C | 2 Reference(s) |
| T37V37 | Prostaglandin-H2 D-isomerase | PTGDS |
P41222 |
C | 1 Reference(s) |
| T28HOM | Leptin | LEP |
P41159 |
C | 1 Reference(s) |
| T80OPZ | NADPH oxidase 4 | NOX4 |
Q9NPH5 |
C | 1 Reference(s) |
| T82P0Z | Renin | REN |
P00797 |
C | 1 Reference(s) |
| T10WQX | Perilipin-1 | PLIN1 |
O60240 |
C | 1 Reference(s) |
| T63YAO | Caveolin-1 | CAV1 |
Q03135 |
C | 1 Reference(s) |
| T62C0X | Transcription factor MafA | MAFA |
Q8NHW3 |
C | 1 Reference(s) |
| T21S10 | Heterogeneous nuclear ribonucleoproteins A2/B1 | HNRNPA2B1 |
P22626 |
C | 1 Reference(s) |
| T43EQN | Matrix Gla protein | MGP |
P08493 |
C | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 1 Reference(s) |
| T90XYZ | C-reactive protein | CRP |
P02741 |
C | 1 Reference(s) |
| T85E55 | Serine/threonine-protein kinase Sgk2 | SGK2 |
Q9HBY8 |
C | 1 Reference(s) |
| T20TB8 | NADPH oxidase 1 | NOX1 |
Q9Y5S8 |
C | 1 Reference(s) |
| T42XY2 | Insulin-like growth factor 1 receptor | IGF1R |
P08069 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target