Compound Description
| ID: C1250 | Common name: Colchicine |
| IUPAC: N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[a]heptalen-7-yl]acetamide | CAS: CAS:64-86-8 |
| Chembl ID: CHEMBL107 | Pubchem ID: CID:6167 |
| Formula: C22H25NO6 | TCM-ID: TCMC931 |
| Smiles: CC(=O)NC1CCC2=CC(=C(C(=C2C3=CC=C(C(=O)C=C13)OC)OC)OC)OC | |
| Alias:
Acetamide, N-(5,6,7,9-tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl)-, (S)-;
Colchicine; Benzo[a]heptalene, acetamide deriv.; N-[(7S)-5,6,7,9-Tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl]acetamide; (-)-Colchicine; (S)-N-(1,2,3,10-Tetramethoxy-9-oxo-5,6,7,9-tetrahydrobenzo[a]heptalen-7-yl)acetamide; (S)-N-(5,6,7,9-Tetrahydro-1,2,3,10-tetramethoxy-9-oxobenzo[a]heptalen-7-yl)acetamide; Colchineos; Colchisol; Colcin; Colcrys; Colsaloid; Condylon; NSC 757 |
Structure:
|
Related Targets (Total: 36)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T19CUN | Prothrombin | F2 |
P00734 |
A | 1 Reference(s) |
| T54B00 | P2X purinoceptor 7 | P2RX7 |
Q99572 |
A | 1 Reference(s) |
| T34HYH | Interleukin-1 alpha | IL1A |
P01583 |
A | 1 Reference(s) |
| T07QEU | Secretin | SCT |
P09683 |
A | 1 Reference(s) |
| T94JI0 | Tubulin alpha-1A chain | TUBA1A |
Q71U36 |
B | 1 Reference(s) |
| T16A2X | Catalase | CAT |
P04040 |
B | 1 Reference(s) |
| T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
B | 1 Reference(s) |
| T26UPI | Collagen alpha-1(VII) chain | COL7A1 |
Q02388 |
B | 1 Reference(s) |
| T81OKW | Glutaminase liver isoform, mitochondrial | GLS2 |
Q9UI32 |
B | 1 Reference(s) |
| T24LWC | Sodium-dependent dopamine transporter | SLC6A3 |
Q01959 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
B | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
B | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 4 Reference(s) |
| T80OJF | Interstitial collagenase | MMP1 |
P03956 |
B | 1 Reference(s) |
| T31P1D | Metalloproteinase inhibitor 1 | TIMP1 |
P01033 |
B | 1 Reference(s) |
| T33JS5 | CCN family member 2 | CCN2 |
P29279 |
B | 1 Reference(s) |
| T50VJF | Osteopontin | SPP1 |
P10451 |
B | 1 Reference(s) |
| T40ENL | 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 | PLCB1 |
Q9NQ66 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
| T38OH4 | Caspase-1 | CASP1 |
P29466 |
B | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
C | 1 Reference(s) |
| T47G3X | Glucocorticoid receptor | NR3C1 |
P04150 |
C | 1 Reference(s) |
| T82F70 | Urokinase plasminogen activator surface receptor | PLAUR |
Q03405 |
C | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
C | 1 Reference(s) |
| T94S85 | Collagen alpha-1(I) chain | COL1A1 |
P02452 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T78KL2 | Collagen alpha-1(III) chain | COL3A1 |
P02461 |
C | 1 Reference(s) |
| T94HVU | Sodium-dependent phosphate transport protein 2A | SLC34A1 |
Q06495 |
C | 1 Reference(s) |
| T03CBM | Sodium/nucleoside cotransporter 2 | SLC28A2 |
O43868 |
C | 1 Reference(s) |
| T60F3V | Serum amyloid A protein | SAA2 |
P02735 |
C | 1 Reference(s) |
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
C | 1 Reference(s) |
| T84P70 | Urokinase-type plasminogen activator | PLAU |
P00749 |
C | 1 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T77B3G | Heat shock protein beta-8 | HSPB8 |
Q9UJY1 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target