Compound Description
| ID: C1261 | Common name: Cpg |
| IUPAC: [(2R,3S,4R,5R)-5-(2-amino-6-oxo-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate | CAS: NA |
| Chembl ID: CHEMBL283807 | Pubchem ID: CID:6804 |
| Formula: C10H14N5O8P | TCM-ID: TCMC952 |
| Smiles: O[C@@H]1[C@H](O)[C@H](O[C@H]1n1cnc2c1[nH]c(=N)nc2O)COP(=O)(O)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 33)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T73ATB | Toll-like receptor 9 | TLR9 |
Q9NR96 |
A | 32 Reference(s) |
| T82W6S | Toll-like receptor 3 | TLR3 |
O15455 |
A | 1 Reference(s) |
| T96FWU | Tumor necrosis factor receptor superfamily member 13B | TNFRSF13B |
O14836 |
A | 1 Reference(s) |
| T71PEL | Excitatory amino acid transporter 2 | SLC1A2 |
P43004 |
A | 1 Reference(s) |
| T61TKW | Methyl-CpG-binding domain protein 2 | MBD2 |
Q9UBB5 |
B | 1 Reference(s) |
| T92HNO | High mobility group protein B1 | HMGB1 |
P09429 |
B | 1 Reference(s) |
| T99ARN | Forkhead box protein P3 | FOXP3 |
Q9BZS1 |
B | 1 Reference(s) |
| T33BF9 | DNA | DNMT3B |
Q9UBC3 |
B | 1 Reference(s) |
| T04PM9 | Transthyretin | TTR |
P02766 |
B | 1 Reference(s) |
| T32TBL | Short transient receptor potential channel 6 | TRPC6 |
Q9Y210 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T75F65 | Interleukin-2 receptor subunit alpha | IL2RA |
P01589 |
C | 1 Reference(s) |
| T98XTB | Sal-like protein 3 | SALL3 |
Q9BXA9 |
C | 1 Reference(s) |
| T58CAO | Alpha-synuclein | SNCA |
P37840 |
C | 1 Reference(s) |
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
C | 1 Reference(s) |
| T00VII | Protein odd-skipped-related 2 | OSR2 |
Q8N2R0 |
C | 1 Reference(s) |
| T74G3Z | Tumor necrosis factor receptor superfamily member 4 | TNFRSF4 |
P43489 |
C | 1 Reference(s) |
| T38K2W | Receptor tyrosine-protein kinase erbB-2 | ERBB2 |
P04626 |
C | 1 Reference(s) |
| T05UYW | Lithostathine-1-alpha | REG1A |
P05451 |
C | 1 Reference(s) |
| T16A2X | Catalase | CAT |
P04040 |
C | 1 Reference(s) |
| T11HSJ | NA | MIRLET7B |
NA |
C | 1 Reference(s) |
| T52HO1 | HLA class I histocompatibility antigen, alpha chain G | HLA-G |
P17693 |
C | 1 Reference(s) |
| T76GZS | Oxytocin receptor | OXTR |
P30559 |
C | 1 Reference(s) |
| T01QLH | Estrogen receptor | ESR1 |
P03372 |
C | 1 Reference(s) |
| T97ESI | Apolipoprotein E | APOE |
P02649 |
C | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 1 Reference(s) |
| T63Y3C | Carbonic anhydrase 1 | CA1 |
P00915 |
C | 1 Reference(s) |
| T70DWW | C-X-C chemokine receptor type 1 | CXCR1 |
P25024 |
C | 1 Reference(s) |
| T78E30 | C-X-C motif chemokine 14 | CXCL14 |
O95715 |
C | 1 Reference(s) |
| T64XAV | NA | MIR663A |
NA |
C | 1 Reference(s) |
| T05SDP | NA | MIR125B1 |
NA |
C | 1 Reference(s) |
| T52ARL | Suppressor of cytokine signaling 3 | SOCS3 |
O14543 |
C | 1 Reference(s) |
| T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target