| ID: C0281 | Common name: Paclitaxel | 
| IUPAC: NA | CAS: CAS:33069-62-4 | 
| Chembl ID: CHEMBL428647 | Pubchem ID: CID:36314 | 
| Formula: C47H51NO14 | TCM-ID: TCMC1824 | 
| Smiles: CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C | |
| Alias: 
                        
                        Benzenepropanoic acid, β-(benzoylamino)-α-hydroxy-, 6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester, [2aR-[2aα,4β,4aβ,6β,9α(αR*,βS*),11α,12α,12aα,12bα]]-; Tax-11-en-9-one, 5β,20-epoxy-1,2α,4,7β,10β,13α-hexahydroxy-, 4,10-diacetate 2-benzoate 13-ester with (2R,3S)-N-benzoyl-3-phenylisoserine; 7,11-Methano-1H-cyclodeca[3,4]benz[1,2-b]oxete, benzenepropanoic acid deriv.; (-)-Paclitaxel; 5β,20-Epoxy-1,2a,4,7β,10β,13α-hexahydroxy-tax-11-en-9-one 4,10-diacetate 2-benzoate 13-ester with (2R,3S)-N-benzoyl-3-phenylisoserine; ABI 007; Abraxane; Anzatax; BMS 181339-01; Capxol; Coroflex Please; Cremophor-free paclitaxel; Cyclopax; Cynviloq; Cypher select; DHP 107; Ebetaxel; EmPAC; EndoTAG 1; Genaxol; Genetaxyl; Genexol; Genexol-PM; IG 001; IG 002; Infinnium; Intaxel; LEP-ETU; Liposome-entrapped paclitaxel easy-to-use; MBT 0206; Mitotax; NK 105; NSC 125973; Nab-paclitaxel; Nanotax; Nanoxel; OncoGel; Onxal; Oraxol; PTX; Pacitaxel; Pacliex; Paclitaxel; Padexol; Paxene; Plaxicel; QW 8184; Sindaxel; TAXUS Express; TAXUS stent; TaxAlbin; Taxol; Taxol A; Taxus; Taxus Liberte; Tocosol Paclitaxel; Yewtaxan; Zisu | Structure:   | 
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence | 
|---|---|---|---|---|---|
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR | P42345 | A | 1 Reference(s) | 
| T69NWB | Selenoprotein S | SELENOS | Q9BQE4 | A | 1 Reference(s) | 
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 | P19838 | A | 1 Reference(s) | 
| T20MBF | Serotransferrin | TF | P02787 | A | 1 Reference(s) | 
| T27F5B | Interleukin-1 receptor-associated kinase 1 | IRAK1 | P51617 | A | 1 Reference(s) | 
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 | P01137 | A | 1 Reference(s) | 
| T10R1D | Copper-transporting ATPase 1 | ATP7A | Q04656 | A | 1 Reference(s) | 
| T84EOF | NA | MIR197 | NA | A | 1 Reference(s) | 
| T50HKY | cAMP-dependent protein kinase type I-alpha regulatory subunit | PRKAR1A | P10644 | A | 1 Reference(s) | 
| T77A47 | Eukaryotic translation initiation factor 4E | EIF4E | P06730 | B | 1 Reference(s) | 
| T72QH0 | Eukaryotic translation initiation factor 4E-binding protein 1 | EIF4EBP1 | Q13541 | B | 1 Reference(s) | 
| T11BI7 | Toll-like receptor 4 | TLR4 | O00206 | B | 1 Reference(s) | 
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 | P10415 | B | 1 Reference(s) | 
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 | O75469 | B | 1 Reference(s) | 
| T85AXP | Cytochrome P450 3A4 | CYP3A4 | P08684 | B | 1 Reference(s) | 
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 | P29474 | B | 1 Reference(s) | 
| T42FMQ | Mitogen-activated protein kinase kinase kinase 1 | MAP3K1 | Q13233 | B | 1 Reference(s) | 
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 | P45983 | B | 1 Reference(s) | 
| T35E0A | Tubulin alpha-1B chain | TUBA1B | P68363 | B | 1 Reference(s) | 
| T73HTV | Thrombomodulin | THBD | P07204 | B | 1 Reference(s) | 
| T09INZ | Transient receptor potential cation channel subfamily A member 1 | TRPA1 | O75762 | B | 1 Reference(s) | 
| T34HD8 | Steroidogenic factor 1 | NR5A1 | Q13285 | B | 1 Reference(s) | 
| T38T1U | Caspase-8 | CASP8 | Q14790 | B | 1 Reference(s) | 
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A | Q16665 | C | 3 Reference(s) | 
| T53OZE | Cytidine deaminase | CDA | P32320 | C | 1 Reference(s) | 
| T61KGI | NA | MIR143 | NA | C | 1 Reference(s) | 
| T55LCD | POU domain, class 5, transcription factor 1 | POU5F1 | Q01860 | C | 2 Reference(s) | 
| T93WZG | G1/S-specific cyclin-D1 | CCND1 | P24385 | C | 1 Reference(s) | 
| T13E59 | Centromere-associated protein E | CENPE | Q02224 | C | 1 Reference(s) | 
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 | P40763 | C | 4 Reference(s) | 
| T43N2D | Epidermal growth factor receptor | EGFR | P00533 | C | 1 Reference(s) | 
| T83F53 | Forkhead box protein M1 | FOXM1 | Q08050 | C | 1 Reference(s) | 
| T92P67 | Vasodilator-stimulated phosphoprotein | VASP | P50552 | C | 1 Reference(s) | 
| T62HEE | H(+)/Cl(-) exchange transporter 3 | CLCN3 | P51790 | C | 1 Reference(s) | 
| T96T89 | Serine/arginine-rich splicing factor 3 | SRSF3 | P84103 | C | 1 Reference(s) | 
| T69NG6 | Interleukin-10 | IL10 | P22301 | C | 1 Reference(s) | 
| T07TMB | Cyclin-dependent kinase 1 | CDK1 | P06493 | C | 1 Reference(s) | 
| T32PI2 | Programmed cell death 1 ligand 1 | CD274 | Q9NZQ7 | C | 1 Reference(s) | 
| T38OH4 | Caspase-1 | CASP1 | P29466 | C | 1 Reference(s) | 
| T55K84 | Thioredoxin domain-containing protein 17 | TXNDC17 | Q9BRA2 | C | 1 Reference(s) | 
| T23P74 | Caspase-9 | CASP9 | P55211 | C | 1 Reference(s) | 
| T54KVP | Protein regulator of cytokinesis 1 | PRC1 | O43663 | C | 1 Reference(s) | 
| T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN | P60484 | C | 1 Reference(s) | 
| T39M65 | NA | MIR216B | NA | C | 1 Reference(s) | 
| T84XYQ | Polycystin-2 | PKD2 | Q13563 | C | 1 Reference(s) | 
| T26QPN | Maternal embryonic leucine zipper kinase | MELK | Q14680 | C | 1 Reference(s) | 
| T74RBE | Inositol 1,4,5-trisphosphate receptor type 1 | ITPR1 | Q14643 | C | 1 Reference(s) | 
| T23VMI | Tumor necrosis factor | TNF | P01375 | C | 1 Reference(s) | 
| T47RAK | NA | MIR145 | NA | C | 1 Reference(s) | 
| T42GML | NA | MIR183 | NA | C | 1 Reference(s) | 
| T72CRD | NA | MIR96 | NA | C | 1 Reference(s) | 
| T20W8R | NA | MIR182 | NA | C | 1 Reference(s) | 
| T42EAZ | Vascular endothelial growth factor A | VEGFA | P15692 | C | 1 Reference(s) | 
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name | 
|---|---|---|---|---|
| H0515 | Suan Shi Liu | 酸石榴 | Pomegranate | Punica granatum | 
| H0462 | Shi Liu | 石榴 | Pomegranate fruit | Punica granatum | 
| H0360 | Ren Zhong Bai | 人中白 | Human urine sediment | Homo sapiens | 
| H0847 | Zi He Che | 紫河车 | Human placenta | Homo sapiens | 
| H0463 | Shi Liu Pi | 石榴皮 | Pomegranate peel | Punica granatum | 
| H0464 | Shi Liu Zi | 石榴子 | NA | Punica granatum |