| ID: C0281 | Common name: Paclitaxel |
| IUPAC: NA | CAS: CAS:33069-62-4 |
| Chembl ID: CHEMBL428647 | Pubchem ID: CID:36314 |
| Formula: C47H51NO14 | TCM-ID: TCMC1824 |
| Smiles: CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)C6=CC=CC=C6)O)O)OC(=O)C7=CC=CC=C7)(CO4)OC(=O)C)O)C)OC(=O)C | |
| Alias:
Benzenepropanoic acid, β-(benzoylamino)-α-hydroxy-, 6,12b-bis(acetyloxy)-12-(benzoyloxy)-2a,3,4,4a,5,6,9,10,11,12,12a,12b-dodecahydro-4,11-dihydroxy-4a,8,13,13-tetramethyl-5-oxo-7,11-methano-1H-cyclodeca[3,4]benz[1,2-b]oxet-9-yl ester, [2aR-[2aα,4β,4aβ,6β,9α(αR*,βS*),11α,12α,12aα,12bα]]-;
Tax-11-en-9-one, 5β,20-epoxy-1,2α,4,7β,10β,13α-hexahydroxy-, 4,10-diacetate 2-benzoate 13-ester with (2R,3S)-N-benzoyl-3-phenylisoserine; 7,11-Methano-1H-cyclodeca[3,4]benz[1,2-b]oxete, benzenepropanoic acid deriv.; (-)-Paclitaxel; 5β,20-Epoxy-1,2a,4,7β,10β,13α-hexahydroxy-tax-11-en-9-one 4,10-diacetate 2-benzoate 13-ester with (2R,3S)-N-benzoyl-3-phenylisoserine; ABI 007; Abraxane; Anzatax; BMS 181339-01; Capxol; Coroflex Please; Cremophor-free paclitaxel; Cyclopax; Cynviloq; Cypher select; DHP 107; Ebetaxel; EmPAC; EndoTAG 1; Genaxol; Genetaxyl; Genexol; Genexol-PM; IG 001; IG 002; Infinnium; Intaxel; LEP-ETU; Liposome-entrapped paclitaxel easy-to-use; MBT 0206; Mitotax; NK 105; NSC 125973; Nab-paclitaxel; Nanotax; Nanoxel; OncoGel; Onxal; Oraxol; PTX; Pacitaxel; Pacliex; Paclitaxel; Padexol; Paxene; Plaxicel; QW 8184; Sindaxel; TAXUS Express; TAXUS stent; TaxAlbin; Taxol; Taxol A; Taxus; Taxus Liberte; Tocosol Paclitaxel; Yewtaxan; Zisu |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
A | 1 Reference(s) |
| T69NWB | Selenoprotein S | SELENOS |
Q9BQE4 |
A | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T20MBF | Serotransferrin | TF |
P02787 |
A | 1 Reference(s) |
| T27F5B | Interleukin-1 receptor-associated kinase 1 | IRAK1 |
P51617 |
A | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
A | 1 Reference(s) |
| T10R1D | Copper-transporting ATPase 1 | ATP7A |
Q04656 |
A | 1 Reference(s) |
| T84EOF | NA | MIR197 |
NA |
A | 1 Reference(s) |
| T50HKY | cAMP-dependent protein kinase type I-alpha regulatory subunit | PRKAR1A |
P10644 |
A | 1 Reference(s) |
| T77A47 | Eukaryotic translation initiation factor 4E | EIF4E |
P06730 |
B | 1 Reference(s) |
| T72QH0 | Eukaryotic translation initiation factor 4E-binding protein 1 | EIF4EBP1 |
Q13541 |
B | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
B | 1 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
B | 1 Reference(s) |
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
B | 1 Reference(s) |
| T42FMQ | Mitogen-activated protein kinase kinase kinase 1 | MAP3K1 |
Q13233 |
B | 1 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
B | 1 Reference(s) |
| T35E0A | Tubulin alpha-1B chain | TUBA1B |
P68363 |
B | 1 Reference(s) |
| T73HTV | Thrombomodulin | THBD |
P07204 |
B | 1 Reference(s) |
| T09INZ | Transient receptor potential cation channel subfamily A member 1 | TRPA1 |
O75762 |
B | 1 Reference(s) |
| T34HD8 | Steroidogenic factor 1 | NR5A1 |
Q13285 |
B | 1 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
C | 3 Reference(s) |
| T53OZE | Cytidine deaminase | CDA |
P32320 |
C | 1 Reference(s) |
| T61KGI | NA | MIR143 |
NA |
C | 1 Reference(s) |
| T55LCD | POU domain, class 5, transcription factor 1 | POU5F1 |
Q01860 |
C | 2 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T13E59 | Centromere-associated protein E | CENPE |
Q02224 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 4 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 1 Reference(s) |
| T83F53 | Forkhead box protein M1 | FOXM1 |
Q08050 |
C | 1 Reference(s) |
| T92P67 | Vasodilator-stimulated phosphoprotein | VASP |
P50552 |
C | 1 Reference(s) |
| T62HEE | H(+)/Cl(-) exchange transporter 3 | CLCN3 |
P51790 |
C | 1 Reference(s) |
| T96T89 | Serine/arginine-rich splicing factor 3 | SRSF3 |
P84103 |
C | 1 Reference(s) |
| T69NG6 | Interleukin-10 | IL10 |
P22301 |
C | 1 Reference(s) |
| T07TMB | Cyclin-dependent kinase 1 | CDK1 |
P06493 |
C | 1 Reference(s) |
| T32PI2 | Programmed cell death 1 ligand 1 | CD274 |
Q9NZQ7 |
C | 1 Reference(s) |
| T38OH4 | Caspase-1 | CASP1 |
P29466 |
C | 1 Reference(s) |
| T55K84 | Thioredoxin domain-containing protein 17 | TXNDC17 |
Q9BRA2 |
C | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
C | 1 Reference(s) |
| T54KVP | Protein regulator of cytokinesis 1 | PRC1 |
O43663 |
C | 1 Reference(s) |
| T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
C | 1 Reference(s) |
| T39M65 | NA | MIR216B |
NA |
C | 1 Reference(s) |
| T84XYQ | Polycystin-2 | PKD2 |
Q13563 |
C | 1 Reference(s) |
| T26QPN | Maternal embryonic leucine zipper kinase | MELK |
Q14680 |
C | 1 Reference(s) |
| T74RBE | Inositol 1,4,5-trisphosphate receptor type 1 | ITPR1 |
Q14643 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T47RAK | NA | MIR145 |
NA |
C | 1 Reference(s) |
| T42GML | NA | MIR183 |
NA |
C | 1 Reference(s) |
| T72CRD | NA | MIR96 |
NA |
C | 1 Reference(s) |
| T20W8R | NA | MIR182 |
NA |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0463 | Shi Liu Pi | 石榴皮 | Pomegranate peel | Punica granatum |
| H0462 | Shi Liu | 石榴 | Pomegranate fruit | Punica granatum |
| H0515 | Suan Shi Liu | 酸石榴 | Pomegranate | Punica granatum |
| H0464 | Shi Liu Zi | 石榴子 | NA | Punica granatum |
| H0360 | Ren Zhong Bai | 人中白 | Human urine sediment | Homo sapiens |
| H0847 | Zi He Che | 紫河车 | Human placenta | Homo sapiens |