Compound Description
| ID: C0987 | Common name: Atorvastatin |
| IUPAC: (3R,5R)-7-[2-(4-fluorophenyl)-3-phenyl-4-(phenylcarbamoyl)-5-propan-2-ylpyrrol-1-yl]-3,5-dihydroxyheptanoic acid | CAS: NA |
| Chembl ID: CHEMBL1487 | Pubchem ID: CID:60823 |
| Formula: C33H35FN2O5 | TCM-ID: TCMC743 |
| Smiles: O[C@@H](C[C@H](CC(=O)O)O)CCn1c(C(C)C)c(c(c1c1ccc(cc1)F)c1ccccc1)C(=Nc1ccccc1)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 51)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T21Q0D | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | HMGCR |
P04035 |
A | 21 Reference(s) |
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
A | 2 Reference(s) |
| T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
A | 2 Reference(s) |
| T79GMA | RNA-binding protein PNO1 | PNO1 |
Q9NRX1 |
A | 1 Reference(s) |
| T38WWN | Serum paraoxonase/arylesterase 1 | PON1 |
P27169 |
A | 1 Reference(s) |
| T95A04 | Solute carrier organic anion transporter family member 2B1 | SLCO2B1 |
O94956 |
A | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 3 Reference(s) |
| T60A9R | NA | CYP3A |
NA |
A | 1 Reference(s) |
| T28PHS | Angiotensin-converting enzyme | ACE |
P12821 |
A | 1 Reference(s) |
| T20E5P | Cytochrome b-245 heavy chain | CYBB |
P04839 |
B | 1 Reference(s) |
| T99EYH | Lipoprotein lipase | LPL |
P06858 |
B | 2 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
B | 1 Reference(s) |
| T45XTW | Retinoic acid receptor RXR-alpha | RXRA |
P19793 |
B | 1 Reference(s) |
| T00DCR | Guanidinoacetate N-methyltransferase | GAMT |
Q14353 |
C | 1 Reference(s) |
| T18WSE | L-selectin | SELL |
P14151 |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 2 Reference(s) |
| T64MZG | Tribbles homolog 3 | TRIB3 |
Q96RU7 |
C | 1 Reference(s) |
| T67JR8 | Heat shock factor protein 1 | HSF1 |
Q00613 |
C | 1 Reference(s) |
| T46K2X | Heat shock 70 kDa protein 4 | HSPA4 |
P34932 |
C | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T36TO2 | Endoglin | ENG |
P17813 |
C | 1 Reference(s) |
| T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
C | 1 Reference(s) |
| T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
C | 1 Reference(s) |
| T32IXS | Integrin alpha-M | ITGAM |
P11215 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 2 Reference(s) |
| T65S3S | Tyrosine-protein kinase JAK2 | JAK2 |
O60674 |
C | 1 Reference(s) |
| T33JGV | Tumor suppressor ARF;Cyclin-dependent kinase inhibitor 2A | CDKN2A |
Q8N726;P42771 |
C | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
C | 2 Reference(s) |
| T28K6X | Insulin receptor substrate 1 | IRS1 |
P35568 |
C | 1 Reference(s) |
| T49PL1 | Low-density lipoprotein receptor | LDLR |
P01130 |
C | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
C | 1 Reference(s) |
| T82F70 | Urokinase plasminogen activator surface receptor | PLAUR |
Q03405 |
C | 1 Reference(s) |
| T91OUC | Mucin-5AC | MUC5AC |
P98088 |
C | 1 Reference(s) |
| T25VH1 | Integrin beta-2 | ITGB2 |
P05107 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T63EMC | Interleukin-18 | IL18 |
Q14116 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| T57L0X | Oxysterols receptor LXR-alpha | NR1H3 |
Q13133 |
C | 2 Reference(s) |
| T61SU2 | Coxsackievirus and adenovirus receptor | CXADR |
P78310 |
C | 1 Reference(s) |
| T93SFQ | NAD-dependent protein deacetylase sirtuin-1 | SIRT1 |
Q96EB6 |
C | 1 Reference(s) |
| T89L4V | Insulin | INS |
P01308 |
C | 1 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
C | 1 Reference(s) |
| T92ZDN | GTPase KRas | KRAS |
P01116 |
C | 1 Reference(s) |
| T47F9W | Galectin-3 | LGALS3 |
P17931 |
C | 1 Reference(s) |
| T90XYZ | C-reactive protein | CRP |
P02741 |
C | 1 Reference(s) |
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
C | 1 Reference(s) |
| T40XWM | Proto-oncogene tyrosine-protein kinase ROS | ROS1 |
P08922 |
C | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target