ID: C1017 | Common name: puerarin |
IUPAC: 7-hydroxy-3-(4-hydroxyphenyl)-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one | CAS: CAS:3681-99-0 |
Chembl ID: CHEMBL1319403 | Pubchem ID: CID:5385074 |
Formula: C21H20O9 | TCM-ID: TCMC7458 |
Smiles: C1=CC(=CC=C1C2=COC3=C(C2=O)C=CC(=C3C4C(C(C(C(O4)CO)O)O)O)O)O | |
Alias:
DAIDZEIN-8-C-GLUCOSIDE;
8-GLUCOSYLDAIDZEIN; 7-HYDROXY-3-[4-HYDROXYPHENYL]-1-BENZOPYRAN-4-ONE 8-[BETA-D-GLUCOPYRANOSIDE; 7,4'-DIHYDROXY-8-C-GLUCOSYLISOFLAVONE; 8-(beta-d-glucopyranosyl-7-hydroxy-3-(4-hydroxyphenyl)-4h-1-benzopyran-4-one; 4',7-DIHYDROXY-8-C-GLUCOSYLISOFLAVONE; PUERARIN; Purerarin |
Structure: |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T23VMI | Tumor necrosis factor | TNF |
P01375 |
A | 1 Reference(s) |
T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
A | 1 Reference(s) |
T46AQJ | Glutathione S-transferase P | GSTP1 |
P09211 |
B | 1 Reference(s) |
T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 4 Reference(s) |
T26KIE | Transcription factor AP-1 | JUN |
P05412 |
B | 1 Reference(s) |
T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
B | 2 Reference(s) |
T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 2 Reference(s) |
T88BCB | Glycerol-3-phosphate phosphatase | PGP |
A6NDG6 |
B | 1 Reference(s) |
T78ZF2 | Protein kinase C alpha type | PRKCA |
P17252 |
B | 1 Reference(s) |
T07NML | P-selectin | SELP |
P16109 |
B | 1 Reference(s) |
T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 1 Reference(s) |
T68NCI | Aldo-keto reductase family 1 member B1 | AKR1B1 |
P15121 |
B | 1 Reference(s) |
T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 1 Reference(s) |
T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 3 Reference(s) |
T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 3 Reference(s) |
T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
B | 1 Reference(s) |
T01S8U | Metalloproteinase inhibitor 2 | TIMP2 |
P16035 |
B | 1 Reference(s) |
T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
B | 1 Reference(s) |
T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
B | 1 Reference(s) |
T00EP2 | Tissue-type plasminogen activator | PLAT |
P00750 |
B | 1 Reference(s) |
T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
T36B1Q | Baculoviral IAP repeat-containing protein 5 | BIRC5 |
O15392 |
C | 1 Reference(s) |
T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
C | 1 Reference(s) |
T90ORW | Bcl2-associated agonist of cell death | BAD |
Q92934 |
C | 1 Reference(s) |
T19F7P | Proteinase-activated receptor 1 | F2R |
P25116 |
C | 1 Reference(s) |
T30KQB | Alanine aminotransferase 1 | GPT |
P24298 |
C | 1 Reference(s) |
T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
T38T1U | Caspase-8 | CASP8 |
Q14790 |
C | 1 Reference(s) |
T23P74 | Caspase-9 | CASP9 |
P55211 |
C | 1 Reference(s) |
T57HGP | Tumor necrosis factor receptor superfamily member 6 | FAS |
P25445 |
C | 1 Reference(s) |
T02IOG | Cyclin-dependent kinase inhibitor 1B | CDKN1B |
P46527 |
C | 1 Reference(s) |
T95K0K | Interferon alpha-1/13 | IFNA1; IFNA13 |
P01562 |
C | 1 Reference(s) |
T10I26 | Interferon beta | IFNB1 |
P01574 |
C | 1 Reference(s) |
T28EY5 | Serine/threonine-protein kinase Chk2 | CHEK2 |
O96017 |
C | 1 Reference(s) |
T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
C | 1 Reference(s) |
T73ZLU | Integrin beta-5 | ITGB5 |
P18084 |
C | 1 Reference(s) |
T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
T88EIE | Platelet-derived growth factor subunit A | PDGFA |
P04085 |
C | 1 Reference(s) |
T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
C | 1 Reference(s) |
T53FD0 | Leptin receptor | LEPR |
P48357 |
C | 1 Reference(s) |
T23RWU | Type-1 angiotensin II receptor | AGTR1 |
P30556 |
C | 1 Reference(s) |
T70B7U | Angiotensin-converting enzyme 2 | ACE2 |
Q9BYF1 |
C | 1 Reference(s) |
T67R5K | Perilipin-2 | PLIN2 |
Q99541 |
C | 1 Reference(s) |
Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
---|