Compound Description
| ID: C1222 | Common name: Celastrol |
| IUPAC: (2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid | CAS: NA |
| Chembl ID: CHEMBL301982 | Pubchem ID: CID:122724 |
| Formula: C29H38O4 | TCM-ID: TCMC882 |
| Smiles: CC1=C(C(=O)C=C2C1=CC=C3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C(=O)O)C)C)C)C)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 51)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
A | 2 Reference(s) |
| T75PC7 | NA | MIR21 |
NA |
A | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
A | 4 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 6 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 2 Reference(s) |
| T36Y8O | Fanconi anemia group D2 protein | FANCD2 |
Q9BXW9 |
A | 1 Reference(s) |
| T02QBS | Cytochrome P450 1A2 | CYP1A2 |
P05177 |
A | 1 Reference(s) |
| T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
A | 5 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 1 Reference(s) |
| T28I32 | Nuclear receptor subfamily 2 group C member 2 | NR2C2 |
P49116 |
A | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 2 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
A | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 1 Reference(s) |
| T71BDH | Mitogen-activated protein kinase 14 | MAPK14 |
Q16539 |
A | 1 Reference(s) |
| T67JR8 | Heat shock factor protein 1 | HSF1 |
Q00613 |
A | 1 Reference(s) |
| T18CWB | Transcriptional activator Myb | MYB |
P10242 |
A | 2 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 1 Reference(s) |
| T43ZNV | Proteasome subunit beta type-1 | PSMB1 |
P20618 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 3 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 2 Reference(s) |
| T20JZ2 | Androgen receptor | AR |
P10275 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 1 Reference(s) |
| T94DIJ | Protein CIP2A | CIP2A |
Q8TCG1 |
B | 1 Reference(s) |
| T04H8Y | Beta-secretase 1 | BACE1 |
P56817 |
B | 1 Reference(s) |
| T54OSZ | Pleckstrin | PLEK |
P08567 |
B | 1 Reference(s) |
| T63FNY | NSFL1 cofactor p47 | NSFL1C |
Q9UNZ2 |
B | 1 Reference(s) |
| T25C2G | Nuclear receptor subfamily 4 group A member 1 | NR4A1 |
P22736 |
B | 1 Reference(s) |
| T04MBA | Vascular endothelial growth factor receptor 2 | KDR |
P35968 |
C | 1 Reference(s) |
| T84WE9 | Vascular endothelial growth factor receptor 1 | FLT1 |
P17948 |
C | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T01S8U | Metalloproteinase inhibitor 2 | TIMP2 |
P16035 |
C | 1 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
C | 1 Reference(s) |
| T15TWZ | Collagen alpha-4(IV) chain | COL4A4 |
P53420 |
C | 1 Reference(s) |
| T31P1D | Metalloproteinase inhibitor 1 | TIMP1 |
P01033 |
C | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
C | 1 Reference(s) |
| T80OJF | Interstitial collagenase | MMP1 |
P03956 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T14JSQ | Baculoviral IAP repeat-containing protein 2 | BIRC2 |
Q13490 |
C | 1 Reference(s) |
| T36B1Q | Baculoviral IAP repeat-containing protein 5 | BIRC5 |
O15392 |
C | 1 Reference(s) |
| T74D4Y | CASP8 and FADD-like apoptosis regulator | CFLAR |
O15519 |
C | 1 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T15JRW | Interferon alpha-inducible protein 27, mitochondrial | IFI27 |
P40305 |
C | 1 Reference(s) |
| T18KNE | NA | MIR146A |
NA |
C | 1 Reference(s) |
| T06DT5 | Phorbol-12-myristate-13-acetate-induced protein 1 | PMAIP1 |
Q13794 |
C | 1 Reference(s) |
| T06ADX | Tyrosine-protein kinase receptor UFO | AXL |
P30530 |
C | 2 Reference(s) |
| T27I35 | NA | MIR223 |
NA |
C | 1 Reference(s) |
| T77UWH | CCAAT/enhancer-binding protein beta | CEBPB |
P17676 |
C | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 1 Reference(s) |
| T02GAB | NA | MIR17HG |
NA |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 7)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0284 | Nan She Teng | 南蛇藤 | Oriental bittersweet | Celastrus orbiculatus |
| H0016 | Ji Xue Cao | 积雪草 | Asiatic pennywort | Centella asiatica |
| H0353 | Que Mei Teng Gen | 雀梅藤根 | Hedge sageretia | Sageretia thea |
| H0130 | Lei Gong Teng | 雷公藤 | Common threewingnut | Tripterygium wilfordii |
| H1244 | Huang Miao | 黄苗 | NA | Taraxacum mongolicum |
| H0314 | Pu Gong Ying | 蒲公英 | Mongolian dandelion | Taraxacum mongolicum |
| H0315 | Pu Gong Ying Jin Gao | 蒲公英浸膏 | Mongolian dandelion | Taraxacum mongolicum |
Ckey description of the interaction between compound and target