Compound Description
| ID: C1227 | Common name: Chelerythrine |
| IUPAC: 1,2-dimethoxy-12-methyl-[1,3]benzodioxolo[5,6-c]phenanthridin-12-ium | CAS: CAS:34316-15-9 |
| Chembl ID: CHEMBL13045 | Pubchem ID: CID:2703 |
| Formula: C21H18NO4 | TCM-ID: TCMC892 |
| Smiles: C[N+]1=C2C(=C3C=CC(=C(C3=C1)OC)OC)C=CC4=CC5=C(C=C42)OCO5 | |
| Alias:
Chelerythrine;
1,2-Dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridinium; Broussonpapyrine; Cheleritrine; Toddalin; Toddaline |
Structure:
|
Related Targets (Total: 38)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T45NNT | Serine/threonine-protein kinase MRCK alpha | CDC42BPA |
Q5VT25 |
A | 1 Reference(s) |
| T85JAT | Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial | SDHB |
P21912 |
A | 1 Reference(s) |
| T17E95 | Protein kinase C gamma type | PRKCG |
P05129 |
A | 1 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
A | 1 Reference(s) |
| T78ZF2 | Protein kinase C alpha type | PRKCA |
P17252 |
A | 3 Reference(s) |
| T66GX9 | Proline-rich transmembrane protein 2 | PRRT2 |
Q7Z6L0 |
A | 8 Reference(s) |
| T21DZX | Amine oxidase [flavin-containing] A | MAOA |
P21397 |
A | 3 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
A | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 1 Reference(s) |
| T99GD2 | Hepatocyte growth factor-like protein | MST1 |
P26927 |
A | 2 Reference(s) |
| T25H22 | Protein kinase C beta type | PRKCB |
P05771 |
B | 1 Reference(s) |
| T87UKX | Glucose-6-phosphate 1-dehydrogenase | G6PD |
P11413 |
B | 1 Reference(s) |
| T17B47 | Excitatory amino acid transporter 4 | SLC1A6 |
P48664 |
B | 1 Reference(s) |
| T09HVO | Sodium/hydrogen exchanger 3 | SLC9A3 |
P48764 |
B | 1 Reference(s) |
| T23NFE | C-type natriuretic peptide | NPPC |
P23582 |
B | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
| T45B9P | ATP-sensitive inward rectifier potassium channel 11 | KCNJ11 |
Q14654 |
B | 1 Reference(s) |
| T84ONF | High affinity immunoglobulin alpha and immunoglobulin mu Fc receptor | FCAMR |
Q8WWV6 |
B | 1 Reference(s) |
| T88E8M | Carbonic anhydrase 9 | CA9 |
Q16790 |
B | 1 Reference(s) |
| T25L2V | Growth-regulated alpha protein | CXCL1 |
P09341 |
B | 1 Reference(s) |
| T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
B | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 2 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 2 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T76F14 | DNA mismatch repair protein Msh2 | MSH2 |
P43246 |
B | 1 Reference(s) |
| T01L5I | DNA mismatch repair protein Msh6 | MSH6 |
P52701 |
B | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
B | 1 Reference(s) |
| T17FIA | Angiotensinogen | AGT |
P01019 |
B | 1 Reference(s) |
| T93VFT | Endothelin-1 | EDN1 |
P05305 |
B | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
B | 1 Reference(s) |
| T33R9C | NA | TRNG |
NA |
B | 1 Reference(s) |
| T74SS7 | Glutamate receptor ionotropic, NMDA 2A | GRIN2A |
Q12879 |
C | 1 Reference(s) |
| T54G8J | Protein kinase C delta type | PRKCD |
Q05655 |
C | 1 Reference(s) |
| T68NCI | Aldo-keto reductase family 1 member B1 | AKR1B1 |
P15121 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
C | 1 Reference(s) |
| T32JN2 | Beta-glucuronidase | GUSB |
P08236 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 4)
Ckey description of the interaction between compound and target