Compound Description
| ID: C1228 | Common name: Chenodiol |
| IUPAC: (4R)-4-[(3R,5S,7R,8R,9S,10S,13R,14S,17R)-3,7-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid | CAS: CAS:474-25-9 |
| Chembl ID: CHEMBL240597 | Pubchem ID: CID:10133 |
| Formula: C24H40O4 | TCM-ID: TCMC894 |
| Smiles: CC(CCC(=O)O)C1CCC2C1(CCC3C2C(CC4C3(CCC(C4)O)C)O)C | |
| Alias:
5β-Cholan-24-oic acid, 3α,7α-dihydroxy-;
5β-Cholanic acid, 3α,7α-dihydroxy-; (3α,5β,7α)-3,7-Dihydroxycholan-24-oic acid; (+)-Chenodeoxycholic acid; 17β-(1-Methyl-3-carboxypropyl)etiocholane-3α,7α-diol; 3α,7α-Dihydroxy-5β-cholan-24-oic acid; 3α,7α-Dihydroxy-5β-cholanic acid; 3α,7α-Dihydroxy-5β-cholanoic acid; 3α,7α-Dihydroxycholanic acid; 7α-Hydroxylithocholic acid; Anthropodeoxycholic acid; Anthropodesoxycholic acid; Anthropododesoxycholic acid; CDC; Chendol; Chenic acid; Chenix; Chenocedon; Chenocol; Chenodeoxycholic acid; Chenodesoxycholic acid; Chenodex; Chenodiol; Chenofalk; Chenossil; Cholanorm; Fluibil; Gallodesoxycholic acid; Hekbilin; Kebilis; Ulmenide |
Structure:
|
Related Targets (Total: 35)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T24C0P | Bile acid receptor | NR1H4 |
Q96RI1 |
A | 2 Reference(s) |
| T87C5Q | Polyunsaturated fatty acid lipoxygenase ALOX12 | ALOX12 |
P18054 |
A | 1 Reference(s) |
| T86D6K | Polyunsaturated fatty acid lipoxygenase ALOX15 | ALOX15 |
P16050 |
A | 1 Reference(s) |
| T45JVK | Nuclear receptor subfamily 5 group A member 2 | NR5A2 |
O00482 |
A | 1 Reference(s) |
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
A | 1 Reference(s) |
| T87N33 | Zinc finger homeobox protein 3 | ZFHX3 |
Q15911 |
B | 1 Reference(s) |
| T54QV9 | POU domain, class 2, transcription factor 1 | POU2F1 |
P14859 |
B | 1 Reference(s) |
| T33OSQ | Sterol regulatory element-binding protein 1 | SREBF1 |
P36956 |
B | 1 Reference(s) |
| T55IBP | Zinc finger protein SNAI1 | SNAI1 |
O95863 |
B | 1 Reference(s) |
| T68SE0 | Solute carrier family 2, facilitated glucose transporter member 4 | SLC2A4 |
P14672 |
B | 1 Reference(s) |
| T43MD5 | 5-aminolevulinate synthase, nonspecific, mitochondrial | ALAS1 |
P13196 |
B | 1 Reference(s) |
| T49USV | Nuclear receptor subfamily 0 group B member 2 | NR0B2 |
Q15466 |
B | 2 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
B | 2 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
B | 1 Reference(s) |
| T35HXI | Gastrotropin | FABP6 |
P51161 |
B | 2 Reference(s) |
| T70HC9 | Hepatocyte nuclear factor 1-alpha | HNF1A |
P20823 |
B | 2 Reference(s) |
| T94K7H | Cytochrome P450 7A1 | CYP7A1 |
P22680 |
B | 2 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 1 Reference(s) |
| T21Q0D | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | HMGCR |
P04035 |
B | 1 Reference(s) |
| T35WSN | 2'-5'-oligoadenylate synthase 3 | OAS3 |
Q9Y6K5 |
C | 1 Reference(s) |
| T51K6D | Tyrosine-protein phosphatase non-receptor type 11 | PTPN11 |
Q06124 |
C | 1 Reference(s) |
| T49ORJ | Peroxisome proliferator-activated receptor alpha | PPARA |
Q07869 |
C | 1 Reference(s) |
| T05TS9 | Cocaine esterase | CES2 |
O00748 |
C | 1 Reference(s) |
| T80ZO6 | 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase | CYP8B1 |
Q9UNU6 |
C | 1 Reference(s) |
| T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
| T49J7I | Hepatocyte nuclear factor 4-alpha | HNF4A |
P41235 |
C | 1 Reference(s) |
| T70FR8 | Ileal sodium/bile acid cotransporter | SLC10A2 |
Q12908 |
C | 1 Reference(s) |
| T35FQV | Microsomal triglyceride transfer protein large subunit | MTTP |
P55157 |
C | 1 Reference(s) |
| T73S71 | Apolipoprotein B-100 | APOB |
P04114 |
C | 1 Reference(s) |
| T49PL1 | Low-density lipoprotein receptor | LDLR |
P01130 |
C | 1 Reference(s) |
| T58IYE | Solute carrier organic anion transporter family member 1B3 | SLCO1B3 |
Q9NPD5 |
C | 1 Reference(s) |
| T08THQ | Phosphatidylcholine translocator ABCB4 | ABCB4 |
P21439 |
C | 1 Reference(s) |
| T23KDW | Cyclic AMP-dependent transcription factor ATF-4 | ATF4 |
P18848 |
C | 1 Reference(s) |
| T82D5L | Fibroblast growth factor 21 | FGF21 |
Q9NSA1 |
C | 1 Reference(s) |
| T05DC7 | Apolipoprotein F | APOF |
Q13790 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 2)
Ckey description of the interaction between compound and target