Compound Description
| ID: C1138 | Common name: berberine |
| IUPAC: NA | CAS: CAS:2086-83-1 |
| Chembl ID: NA | Pubchem ID: CID:25201694 |
| Formula: C20H18NO4 | TCM-ID: TCMC7571 |
| Smiles: COC1=C(C2=CN3CCC4=CC5=C(C=C4[C]3C=C2C=C1)OCO5)OC | |
| Alias:
Berbinium, 7,8,13,13a-tetradehydro-9,10-dimethoxy-2,3-(methylenedioxy)- (8CI);
Umbellatine (6CI); 5,6-Dihydro-9,10-dimethoxybenzo[g]-1,3-benzodioxolo[5,6-a]quinolizinium; Berbericine; Berberin; Berberine; Majarine; Thalsine; Umbellatin |
Structure:
|
Related Targets (Total: 54)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
A | 1 Reference(s) |
| T50SJ8 | 5'-AMP-activated protein kinase catalytic subunit alpha-2 | PRKAA2 |
P54646 |
A | 1 Reference(s) |
| T16UZ4 | Dipeptidyl peptidase 4 | DPP4 |
P27487 |
A | 1 Reference(s) |
| T13NLM | Cell division control protein 42 homolog | CDC42 |
P60953 |
B | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
B | 1 Reference(s) |
| T75H3W | Cyclin-dependent kinase 2 | CDK2 |
P24941 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T54CIF | Interleukin-8 | CXCL8 |
P10145 |
B | 1 Reference(s) |
| T64T4I | Telomerase protein component 1 | TEP1 |
Q99973 |
B | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
B | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
B | 1 Reference(s) |
| T23TJV | Tyrosine 3-monooxygenase | TH |
P07101 |
B | 1 Reference(s) |
| T26KIE | Transcription factor AP-1 | JUN |
P05412 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 1 Reference(s) |
| T17UP9 | C-C motif chemokine 2 | CCL2 |
P13500 |
B | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 2 Reference(s) |
| T45KYV | Stromal cell-derived factor 1 | CXCL12 |
P48061 |
B | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
B | 1 Reference(s) |
| T49J7I | Hepatocyte nuclear factor 4-alpha | HNF4A |
P41235 |
B | 2 Reference(s) |
| T89L4V | Insulin | INS |
P01308 |
B | 2 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
B | 2 Reference(s) |
| T08VQQ | Proprotein convertase subtilisin/kexin type 9 | PCSK9 |
Q8NBP7 |
B | 1 Reference(s) |
| T90ADC | BH3-interacting domain death agonist | BID |
P55957 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 3 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
B | 2 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 7 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
| T63W0D | DNA damage-inducible transcript 3 protein | DDIT3 |
P35638 |
B | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
| T01E8J | Amyloid-beta precursor protein | APP |
P05067 |
B | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 2 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 1 Reference(s) |
| T17FIA | Angiotensinogen | AGT |
P01019 |
B | 1 Reference(s) |
| T37ADS | Early growth response protein 1 | EGR1 |
P18146 |
B | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
B | 2 Reference(s) |
| T88EIE | Platelet-derived growth factor subunit A | PDGFA |
P04085 |
B | 1 Reference(s) |
| T35QZO | Cytochrome c | CYCS |
P99999 |
B | 1 Reference(s) |
| T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
B | 1 Reference(s) |
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
B | 1 Reference(s) |
| T01SWU | Early activation antigen CD69 | CD69 |
Q07108 |
B | 1 Reference(s) |
| T75F65 | Interleukin-2 receptor subunit alpha | IL2RA |
P01589 |
B | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
B | 1 Reference(s) |
| T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
C | 1 Reference(s) |
| T07TMB | Cyclin-dependent kinase 1 | CDK1 |
P06493 |
C | 1 Reference(s) |
| T24LXT | G2/mitotic-specific cyclin-B1 | CCNB1 |
P14635 |
C | 1 Reference(s) |
| T37VTM | Wee1-like protein kinase | WEE1 |
P30291 |
C | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
| T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T42PUG | Solute carrier family 2, facilitated glucose transporter member 1 | SLC2A1 |
P11166 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target