| ID: C0406 | Common name: Simvastatin |
| IUPAC: [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate | CAS: CAS:79902-63-9 |
| Chembl ID: CHEMBL1064 | Pubchem ID: CID:54454 |
| Formula: C25H38O5 | TCM-ID: TCMC2082 |
| Smiles: CCC(C(=O)O[C@H]1C[C@@H](C)C=C2[C@H]1[C@@H](CC[C@@H]1C[C@@H](O)CC(=O)O1)[C@H](C=C2)C)(C)C | |
| Alias:
Butanoic acid, 2,2-dimethyl-, 1,2,3,7,8,8a-hexahydro-3,7-dimethyl-8-[2-(tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl]-1-naphthalenyl ester, [1S-[1α,3α,7β,8β(2S*,4S*),8aβ]]-;
(+)-Simvastatin; Apo-Simva; Apo-Simvastatin; Bestatin 20; Cholestat; Co-Simvastatin; Denan; Egilipid; Eucor; Kolestevan; L 644128-000U; Lipex; Lipinorm; Liponorm; Lipovas; Lodales; Lycostatin; MK 733; Modutrol; Nor-Vastina; Novo-Simvastatin; Pms-simvastatin; Rechol; Simastin 20; Simcovas; Simgal; Simi 20; Simlip; Simlip 20; Simlo 20; Simlup 20; Simovil; Simratio; Simvacard; Simvachol; Simvacor; Simvahexal; Simvas; Simvastatin; Simvastatin lactone; Simvasterol; Simvastol; Simvofix; Simvotin; Sinvacor; Sinvascor; Sivastin; Starstat 20; Synvinolin; Valemia; Vasilip; Vastan; Vazilip; Velostatin; Ximve; Zocor; Zocor Forte; Zocord; Zorced; Zosta |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T21Q0D | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | HMGCR |
P04035 |
A | 26 Reference(s) |
| T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
A | 2 Reference(s) |
| T05WU9 | Serine/threonine-protein phosphatase 2A activator | PTPA |
Q15257 |
A | 1 Reference(s) |
| T51EKP | Apolipoprotein M | APOM |
O95445 |
A | 1 Reference(s) |
| T91OUC | Mucin-5AC | MUC5AC |
P98088 |
A | 1 Reference(s) |
| T33JS5 | CCN family member 2 | CCN2 |
P29279 |
A | 2 Reference(s) |
| T65TD1 | NA | MIR192 |
NA |
A | 1 Reference(s) |
| T75A0Y | Citrate synthase, mitochondrial | CS |
O75390 |
A | 1 Reference(s) |
| T67NYW | Protein phosphatase 1A | PPM1A |
P35813 |
A | 1 Reference(s) |
| T86CQC | Glutamate receptor ionotropic, NMDA 1 | GRIN1 |
Q05586 |
A | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 3 Reference(s) |
| T31SX8 | Bone morphogenetic protein 2 | BMP2 |
P12643 |
A | 1 Reference(s) |
| T28PHS | Angiotensin-converting enzyme | ACE |
P12821 |
A | 1 Reference(s) |
| T16A2X | Catalase | CAT |
P04040 |
A | 1 Reference(s) |
| T53Z7Y | Transcriptional coactivator YAP1 | YAP1 |
P46937 |
A | 1 Reference(s) |
| T25RHJ | Sodium-dependent serotonin transporter | SLC6A4 |
P31645 |
A | 1 Reference(s) |
| T29BZ9 | Keratin, type II cytoskeletal 6A | KRT6A |
P02538 |
A | 1 Reference(s) |
| T80SD7 | Sterol regulatory element-binding protein 2 | SREBF2 |
Q12772 |
A | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 3 Reference(s) |
| T57R3V | Proliferation marker protein Ki-67 | MKI67 |
P46013 |
A | 1 Reference(s) |
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
B | 2 Reference(s) |
| T20E5P | Cytochrome b-245 heavy chain | CYBB |
P04839 |
B | 1 Reference(s) |
| T35KD8 | C-C chemokine receptor type 3 | CCR3 |
P51677 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 2 Reference(s) |
| T24CXU | CCAAT/enhancer-binding protein delta | CEBPD |
P49716 |
B | 1 Reference(s) |
| T93VFT | Endothelin-1 | EDN1 |
P05305 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 5 Reference(s) |
| T92HNO | High mobility group protein B1 | HMGB1 |
P09429 |
C | 3 Reference(s) |
| T51DHZ | Protein C-ets-1 | ETS1 |
P14921 |
C | 1 Reference(s) |
| T05YJ9 | Krueppel-like factor 1 | KLF1 |
Q13351 |
C | 2 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 3 Reference(s) |
| T54BUS | B-cell lymphoma/leukemia 11A | BCL11A |
Q9H165 |
C | 1 Reference(s) |
| T61J7T | Mothers against decapentaplegic homolog 2 | SMAD2 |
Q15796 |
C | 2 Reference(s) |
| T78O6C | Mothers against decapentaplegic homolog 3 | SMAD3 |
P84022 |
C | 2 Reference(s) |
| T92P67 | Vasodilator-stimulated phosphoprotein | VASP |
P50552 |
C | 1 Reference(s) |
| T38WWN | Serum paraoxonase/arylesterase 1 | PON1 |
P27169 |
C | 1 Reference(s) |
| T52VL6 | Signal transducer and activator of transcription 5A | STAT5A |
P42229 |
C | 1 Reference(s) |
| T19K8W | Signal transducer and activator of transcription 5B | STAT5B |
P51692 |
C | 1 Reference(s) |
| T70EB9 | Nephrin | NPHS1 |
O60500 |
C | 2 Reference(s) |
| T95IYZ | Adiponectin | ADIPOQ |
Q15848 |
C | 1 Reference(s) |
| T10ICM | Oxidized low-density lipoprotein receptor 1 | OLR1 |
P78380 |
C | 1 Reference(s) |
| T01QLH | Estrogen receptor | ESR1 |
P03372 |
C | 2 Reference(s) |
| T46J84 | Nicotinamide phosphoribosyltransferase | NAMPT |
P43490 |
C | 1 Reference(s) |
| T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
| T28IEO | Podocin | NPHS2 |
Q9NP85 |
C | 1 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
C | 1 Reference(s) |
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
C | 1 Reference(s) |
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
C | 3 Reference(s) |
| T22N8Q | Rho-related GTP-binding protein RhoB | RHOB |
P62745 |
C | 1 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
C | 1 Reference(s) |
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
C | 1 Reference(s) |
| T21UJU | Troponin I, cardiac muscle | TNNI3 |
P19429 |
C | 1 Reference(s) |
| T50FHQ | TGF-beta receptor type-2 | TGFBR2 |
P37173 |
C | 1 Reference(s) |
| T38MJF | Endothelial cell-specific molecule 1 | ESM1 |
Q9NQ30 |
C | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
C | 1 Reference(s) |
| T65S3S | Tyrosine-protein kinase JAK2 | JAK2 |
O60674 |
C | 1 Reference(s) |
| T29B10 | Interleukin-17A | IL17A |
Q16552 |
C | 2 Reference(s) |
| T36THI | C-X-C motif chemokine 13 | CXCL13 |
O43927 |
C | 1 Reference(s) |
| T82F70 | Urokinase plasminogen activator surface receptor | PLAUR |
Q03405 |
C | 1 Reference(s) |
| T17UP9 | C-C motif chemokine 2 | CCL2 |
P13500 |
C | 2 Reference(s) |
| T70VMI | Nitric oxide synthase, brain | NOS1 |
P29475 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
| T56Q6C | C-C motif chemokine 3-like 1 | CCL3L1; CCL3L3 |
P16619 |
C | 1 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
| T54CIF | Interleukin-8 | CXCL8 |
P10145 |
C | 1 Reference(s) |
| T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
C | 1 Reference(s) |