| ID: C0406 | Common name: Simvastatin | 
| IUPAC: [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate | CAS: CAS:79902-63-9 | 
| Chembl ID: CHEMBL1064 | Pubchem ID: CID:54454 | 
| Formula: C25H38O5 | TCM-ID: TCMC2082 | 
| Smiles: CCC(C(=O)O[C@H]1C[C@@H](C)C=C2[C@H]1[C@@H](CC[C@@H]1C[C@@H](O)CC(=O)O1)[C@H](C=C2)C)(C)C | |
| Alias: 
                        
                        Butanoic acid, 2,2-dimethyl-, 1,2,3,7,8,8a-hexahydro-3,7-dimethyl-8-[2-(tetrahydro-4-hydroxy-6-oxo-2H-pyran-2-yl)ethyl]-1-naphthalenyl ester, [1S-[1α,3α,7β,8β(2S*,4S*),8aβ]]-; (+)-Simvastatin; Apo-Simva; Apo-Simvastatin; Bestatin 20; Cholestat; Co-Simvastatin; Denan; Egilipid; Eucor; Kolestevan; L 644128-000U; Lipex; Lipinorm; Liponorm; Lipovas; Lodales; Lycostatin; MK 733; Modutrol; Nor-Vastina; Novo-Simvastatin; Pms-simvastatin; Rechol; Simastin 20; Simcovas; Simgal; Simi 20; Simlip; Simlip 20; Simlo 20; Simlup 20; Simovil; Simratio; Simvacard; Simvachol; Simvacor; Simvahexal; Simvas; Simvastatin; Simvastatin lactone; Simvasterol; Simvastol; Simvofix; Simvotin; Sinvacor; Sinvascor; Sivastin; Starstat 20; Synvinolin; Valemia; Vasilip; Vastan; Vazilip; Velostatin; Ximve; Zocor; Zocor Forte; Zocord; Zorced; Zosta | Structure:   | 
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence | 
|---|---|---|---|---|---|
| T21Q0D | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | HMGCR | P04035 | A | 26 Reference(s) | 
| T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 | P07900 | A | 2 Reference(s) | 
| T05WU9 | Serine/threonine-protein phosphatase 2A activator | PTPA | Q15257 | A | 1 Reference(s) | 
| T51EKP | Apolipoprotein M | APOM | O95445 | A | 1 Reference(s) | 
| T91OUC | Mucin-5AC | MUC5AC | P98088 | A | 1 Reference(s) | 
| T33JS5 | CCN family member 2 | CCN2 | P29279 | A | 2 Reference(s) | 
| T65TD1 | NA | MIR192 | NA | A | 1 Reference(s) | 
| T75A0Y | Citrate synthase, mitochondrial | CS | O75390 | A | 1 Reference(s) | 
| T67NYW | Protein phosphatase 1A | PPM1A | P35813 | A | 1 Reference(s) | 
| T86CQC | Glutamate receptor ionotropic, NMDA 1 | GRIN1 | Q05586 | A | 1 Reference(s) | 
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 | P28482 | A | 3 Reference(s) | 
| T31SX8 | Bone morphogenetic protein 2 | BMP2 | P12643 | A | 1 Reference(s) | 
| T28PHS | Angiotensin-converting enzyme | ACE | P12821 | A | 1 Reference(s) | 
| T16A2X | Catalase | CAT | P04040 | A | 1 Reference(s) | 
| T53Z7Y | Transcriptional coactivator YAP1 | YAP1 | P46937 | A | 1 Reference(s) | 
| T25RHJ | Sodium-dependent serotonin transporter | SLC6A4 | P31645 | A | 1 Reference(s) | 
| T29BZ9 | Keratin, type II cytoskeletal 6A | KRT6A | P02538 | A | 1 Reference(s) | 
| T80SD7 | Sterol regulatory element-binding protein 2 | SREBF2 | Q12772 | A | 1 Reference(s) | 
| T11BI7 | Toll-like receptor 4 | TLR4 | O00206 | A | 3 Reference(s) | 
| T57R3V | Proliferation marker protein Ki-67 | MKI67 | P46013 | A | 1 Reference(s) | 
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 | Q96P20 | B | 2 Reference(s) | 
| T20E5P | Cytochrome b-245 heavy chain | CYBB | P04839 | B | 1 Reference(s) | 
| T35KD8 | C-C chemokine receptor type 3 | CCR3 | P51677 | B | 1 Reference(s) | 
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 | P31749 | B | 2 Reference(s) | 
| T24CXU | CCAAT/enhancer-binding protein delta | CEBPD | P49716 | B | 1 Reference(s) | 
| T93VFT | Endothelin-1 | EDN1 | P05305 | C | 1 Reference(s) | 
| T23VMI | Tumor necrosis factor | TNF | P01375 | C | 5 Reference(s) | 
| T92HNO | High mobility group protein B1 | HMGB1 | P09429 | C | 3 Reference(s) | 
| T51DHZ | Protein C-ets-1 | ETS1 | P14921 | C | 1 Reference(s) | 
| T05YJ9 | Krueppel-like factor 1 | KLF1 | Q13351 | C | 2 Reference(s) | 
| T42EAZ | Vascular endothelial growth factor A | VEGFA | P15692 | C | 3 Reference(s) | 
| T54BUS | B-cell lymphoma/leukemia 11A | BCL11A | Q9H165 | C | 1 Reference(s) | 
| T61J7T | Mothers against decapentaplegic homolog 2 | SMAD2 | Q15796 | C | 2 Reference(s) | 
| T78O6C | Mothers against decapentaplegic homolog 3 | SMAD3 | P84022 | C | 2 Reference(s) | 
| T92P67 | Vasodilator-stimulated phosphoprotein | VASP | P50552 | C | 1 Reference(s) | 
| T38WWN | Serum paraoxonase/arylesterase 1 | PON1 | P27169 | C | 1 Reference(s) | 
| T52VL6 | Signal transducer and activator of transcription 5A | STAT5A | P42229 | C | 1 Reference(s) | 
| T19K8W | Signal transducer and activator of transcription 5B | STAT5B | P51692 | C | 1 Reference(s) | 
| T70EB9 | Nephrin | NPHS1 | O60500 | C | 2 Reference(s) | 
| T95IYZ | Adiponectin | ADIPOQ | Q15848 | C | 1 Reference(s) | 
| T10ICM | Oxidized low-density lipoprotein receptor 1 | OLR1 | P78380 | C | 1 Reference(s) | 
| T01QLH | Estrogen receptor | ESR1 | P03372 | C | 2 Reference(s) | 
| T46J84 | Nicotinamide phosphoribosyltransferase | NAMPT | P43490 | C | 1 Reference(s) | 
| T94H37 | Cadherin-1 | CDH1 | P12830 | C | 1 Reference(s) | 
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 | P01137 | C | 1 Reference(s) | 
| T28IEO | Podocin | NPHS2 | Q9NP85 | C | 1 Reference(s) | 
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 | P19320 | C | 1 Reference(s) | 
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 | P05121 | C | 1 Reference(s) | 
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 | P27361 | C | 1 Reference(s) | 
| T40JZG | GPI-anchor transamidase | PIGK | Q92643 | C | 1 Reference(s) | 
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 | P29474 | C | 3 Reference(s) | 
| T22N8Q | Rho-related GTP-binding protein RhoB | RHOB | P62745 | C | 1 Reference(s) | 
| T86ROZ | Heme oxygenase 1 | HMOX1 | P09601 | C | 1 Reference(s) | 
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 | O75469 | C | 1 Reference(s) | 
| T21UJU | Troponin I, cardiac muscle | TNNI3 | P19429 | C | 1 Reference(s) | 
| T50FHQ | TGF-beta receptor type-2 | TGFBR2 | P37173 | C | 1 Reference(s) | 
| T38MJF | Endothelial cell-specific molecule 1 | ESM1 | Q9NQ30 | C | 1 Reference(s) | 
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 | Q16236 | C | 1 Reference(s) | 
| T65S3S | Tyrosine-protein kinase JAK2 | JAK2 | O60674 | C | 1 Reference(s) | 
| T29B10 | Interleukin-17A | IL17A | Q16552 | C | 2 Reference(s) | 
| T36THI | C-X-C motif chemokine 13 | CXCL13 | O43927 | C | 1 Reference(s) | 
| T82F70 | Urokinase plasminogen activator surface receptor | PLAUR | Q03405 | C | 1 Reference(s) | 
| T17UP9 | C-C motif chemokine 2 | CCL2 | P13500 | C | 2 Reference(s) | 
| T70VMI | Nitric oxide synthase, brain | NOS1 | P29475 | C | 1 Reference(s) | 
| T64BTV | Interleukin-1 beta | IL1B | P01584 | C | 1 Reference(s) | 
| T33OPP | Interleukin-6 | IL6 | P05231 | C | 1 Reference(s) | 
| T56Q6C | C-C motif chemokine 3-like 1 | CCL3L1; CCL3L3 | P16619 | C | 1 Reference(s) | 
| T49TDM | Matrix metalloproteinase-9 | MMP9 | P14780 | C | 1 Reference(s) | 
| T54CIF | Interleukin-8 | CXCL8 | P10145 | C | 1 Reference(s) | 
| T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 | Q13131 | C | 1 Reference(s) |