Compound Description
| ID: C0917 | Common name: Arachidonic Acid |
| IUPAC: (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoic acid | CAS: NA |
| Chembl ID: CHEMBL15594 | Pubchem ID: CID:444899 |
| Formula: C20H32O2 | TCM-ID: TCMC715 |
| Smiles: CCCCCC=CCC=CCC=CCC=CCCCC(=O)O | |
| Alias:
NA
|
Structure:
|
Related Targets (Total: 55)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T97VA2 | Transient receptor potential cation channel subfamily V member 4 | TRPV4 |
Q9HBA0 |
A | 1 Reference(s) |
| T71B0A | Cytosolic phospholipase A2 | PLA2G4A |
P47712 |
A | 2 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
A | 6 Reference(s) |
| T60XJI | Transient receptor potential cation channel subfamily M member 8 | TRPM8 |
Q7Z2W7 |
A | 1 Reference(s) |
| T59DDI | Liver carboxylesterase 1 | CES1 |
P23141 |
A | 1 Reference(s) |
| T41WA8 | Ephrin type-A receptor 2 | EPHA2 |
P29317 |
A | 1 Reference(s) |
| T87DEX | Xanthine dehydrogenase/oxidase [Includes: Xanthine dehydrogenase | XDH |
P47989 |
A | 1 Reference(s) |
| T08Q1T | Amiloride-sensitive sodium channel subunit alpha | SCNN1A |
P37088 |
A | 1 Reference(s) |
| T80GST | Acid-sensing ion channel 3 | ASIC3 |
Q9UHC3 |
A | 1 Reference(s) |
| T40EUL | Transient receptor potential cation channel subfamily V member 4 | TRPV4 |
Q9HBA0 |
A | 1 Reference(s) |
| T19JEU | Beta-galactosidase | GLB1 |
P16278 |
B | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T32OC4 | Aldehyde dehydrogenase, mitochondrial | ALDH2 |
P05091 |
B | 1 Reference(s) |
| T25H22 | Protein kinase C beta type | PRKCB |
P05771 |
B | 1 Reference(s) |
| T34ZZ0 | Potassium channel subfamily K member 2 | KCNK2 |
O95069 |
B | 1 Reference(s) |
| T58TOI | Apolipoprotein D | APOD |
P05090 |
B | 1 Reference(s) |
| T14AV3 | Potassium channel subfamily K member 10 | KCNK10 |
P57789 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 1 Reference(s) |
| T07NML | P-selectin | SELP |
P16109 |
B | 1 Reference(s) |
| T16KVU | Tumor necrosis factor receptor superfamily member 1A | TNFRSF1A |
P19438 |
B | 1 Reference(s) |
| T05ZBL | Tumor necrosis factor receptor superfamily member 1B | TNFRSF1B |
P20333 |
B | 1 Reference(s) |
| T47HTN | Prostaglandin E synthase | PTGES |
O14684 |
B | 1 Reference(s) |
| T44OPR | Aldehyde dehydrogenase, dimeric NADP-preferring | ALDH3A1 |
P30838 |
B | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
B | 1 Reference(s) |
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
B | 1 Reference(s) |
| T32P8F | Serine/threonine-protein phosphatase 5 | PPP5C |
P53041 |
B | 1 Reference(s) |
| T72BXP | Platelet endothelial cell adhesion molecule | PECAM1 |
P16284 |
B | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
| T69XVX | Cytochrome P450 1B1 | CYP1B1 |
Q16678 |
B | 1 Reference(s) |
| T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
B | 1 Reference(s) |
| T84AR4 | Smoothened homolog | SMO |
Q99835 |
B | 1 Reference(s) |
| T56OUM | 14-3-3 protein zeta/delta | YWHAZ |
P63104 |
B | 1 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
B | 1 Reference(s) |
| T30TYH | Phospholipase A2 | PLA2G1B |
P04054 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 1 Reference(s) |
| T68XO1 | Indoleamine 2,3-dioxygenase 1 | IDO1 |
P14902 |
B | 1 Reference(s) |
| T10OBQ | Endophilin-A1 | SH3GL2 |
Q99962 |
B | 1 Reference(s) |
| T48UT8 | Cholesteryl ester transfer protein | CETP |
P11597 |
C | 1 Reference(s) |
| T61DYZ | Phospholipid-transporting ATPase ABCA1 | ABCA1 |
O95477 |
C | 1 Reference(s) |
| T56TXY | Polyunsaturated fatty acid 5-lipoxygenase | ALOX5 |
P09917 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T69VYP | ATP-binding cassette sub-family G member 1 | ABCG1 |
P45844 |
C | 1 Reference(s) |
| T87UKX | Glucose-6-phosphate 1-dehydrogenase | G6PD |
P11413 |
C | 1 Reference(s) |
| T21EGX | Multidrug resistance-associated protein 1 | ABCC1 |
P33527 |
C | 1 Reference(s) |
| T75H3W | Cyclin-dependent kinase 2 | CDK2 |
P24941 |
C | 1 Reference(s) |
| T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
C | 1 Reference(s) |
| T29NEF | Resistin | RETN |
Q9HD89 |
C | 1 Reference(s) |
| T67RBZ | Mitochondrial uncoupling protein 2 | UCP2 |
P55851 |
C | 1 Reference(s) |
| T32ECR | Collagen alpha-2(I) chain | COL1A2 |
P08123 |
C | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 2 Reference(s) |
| T37ADS | Early growth response protein 1 | EGR1 |
P18146 |
C | 1 Reference(s) |
| T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
C | 1 Reference(s) |
| T00CXT | Prostaglandin G/H synthase 1 | PTGS1 |
P23219 |
C | 1 Reference(s) |
| T09KPZ | Vimentin | VIM |
P08670 |
C | 1 Reference(s) |
| T16DCZ | Twist-related protein 1 | TWIST1 |
Q15672 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 10)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0204 | Ma Ren | 麻仁 | NA | Cannabis sativa |
| H0919 | Cui Yun Cao | 翠云草 | Hooked spikemoss | Selaginella uncinata |
| H0484 | Shui Fei Ji | 水飞蓟 | St marys | Silybum marianum |
| H0003 | Huo Ma Ren | 火麻仁 | Hemp fimble seed | Cannabis sativa |
| H0195 | Ma Chi Xian | 马齿苋 | Purslane | Portulaca oleracea |
| H0461 | Shi Jun Zi Ren | 使君子仁 | NA | Combretum indicum |
| H0360 | Ren Zhong Bai | 人中白 | Human urine sediment | Homo sapiens |
| H0847 | Zi He Che | 紫河车 | Human placenta | Homo sapiens |
| H0895 | Chuan Yu Jin | 川郁金 | Turmeric | Curcuma longa |
| H0028 | Jiang Huang | 姜黄 | Common turmeric | Curcuma longa |
Ckey description of the interaction between compound and target