Compound Description
| ID: C0461 | Common name: Triptolide |
| IUPAC: NA | CAS: CAS:38748-32-2 |
| Chembl ID: CHEMBL463763 | Pubchem ID: CID:107985 |
| Formula: C20H24O6 | TCM-ID: TCMC2192 |
| Smiles: CC(C)C12C(O1)C3C4(O3)C5(CCC6=C(C5CC7C4(C2O)O7)COC6=O)C | |
| Alias:
Triptolide;
(3bS,4aS,5aS,6R,6aR,7aS,7bS,8aS,8bS)-3b,4,4a,6,6a,7a,7b,8b,9,10-Decahydro-6-hydroxy-8b-methyl-6a-(1-methylethyl)trisoxireno[4b,5 |
Structure:
|
Related Targets (Total: 65)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T92FAW | Dual specificity protein phosphatase 1 | DUSP1 |
P28562 |
A | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
| T14LSK | E3 ubiquitin-protein ligase XIAP | XIAP |
P98170 |
A | 1 Reference(s) |
| T02QBS | Cytochrome P450 1A2 | CYP1A2 |
P05177 |
A | 2 Reference(s) |
| T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
A | 1 Reference(s) |
| T73LXA | Heat shock 70 kDa protein 1A;Heat shock 70 kDa protein 1B | HSPA1A;HSPA1B |
P0DMV8;P0DMV9 |
A | 1 Reference(s) |
| T46K2X | Heat shock 70 kDa protein 4 | HSPA4 |
P34932 |
A | 2 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 4 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 2 Reference(s) |
| T04OVZ | Cyclin-A1 | CCNA1 |
P78396 |
A | 1 Reference(s) |
| T39KTX | General transcription and DNA repair factor IIH helicase subunit XPB | ERCC3 |
P19447 |
A | 1 Reference(s) |
| T71BDH | Mitogen-activated protein kinase 14 | MAPK14 |
Q16539 |
A | 1 Reference(s) |
| T09BRP | NA | PKB_RS07820 |
NA |
A | 1 Reference(s) |
| T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
A | 1 Reference(s) |
| T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
A | 1 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
A | 2 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 2 Reference(s) |
| T00T9M | Thrombospondin-1 | THBS1 |
P07996 |
A | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
B | 2 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
B | 2 Reference(s) |
| T32PI2 | Programmed cell death 1 ligand 1 | CD274 |
Q9NZQ7 |
B | 2 Reference(s) |
| T54CIF | Interleukin-8 | CXCL8 |
P10145 |
B | 1 Reference(s) |
| T67HAF | Signal transducer and activator of transcription 1-alpha/beta | STAT1 |
P42224 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
B | 2 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 2 Reference(s) |
| T87Y6K | T-cell surface glycoprotein CD1a | CD1A |
P06126 |
B | 1 Reference(s) |
| T11R4S | Tumor necrosis factor receptor superfamily member 5 | CD40 |
P25942 |
B | 2 Reference(s) |
| T23OTN | T-lymphocyte activation antigen CD80 | CD80 |
P33681 |
B | 1 Reference(s) |
| T47MPW | T-lymphocyte activation antigen CD86 | CD86 |
P42081 |
B | 1 Reference(s) |
| T08OEP | Monocyte differentiation antigen CD14 | CD14 |
P08571 |
B | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
B | 2 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
B | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
C | 1 Reference(s) |
| T26KIE | Transcription factor AP-1 | JUN |
P05412 |
C | 1 Reference(s) |
| T34DZ7 | Interleukin-2 | IL2 |
P60568 |
C | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
C | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
C | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
C | 1 Reference(s) |
| T51AX1 | Interleukin-23 subunit alpha | IL23A |
Q9NPF7 |
C | 1 Reference(s) |
| T30A57 | C-C chemokine receptor type 7 | CCR7 |
P32248 |
C | 1 Reference(s) |
| T75HMM | Induced myeloid leukemia cell differentiation protein Mcl-1 | MCL1 |
Q07820 |
C | 1 Reference(s) |
| T19YQS | Complement C3 | C3 |
P01024 |
C | 1 Reference(s) |
| T56NC7 | Beta-defensin 4A | DEFB4A; DEFB4B |
O15263 |
C | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
| T13DHC | Disintegrin and metalloproteinase domain-containing protein 10 | ADAM10 |
O14672 |
C | 1 Reference(s) |
| T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
C | 1 Reference(s) |
| T84P70 | Urokinase-type plasminogen activator | PLAU |
P00749 |
C | 1 Reference(s) |
| T70YKV | Baculoviral IAP repeat-containing protein 3 | BIRC3 |
Q13489 |
C | 1 Reference(s) |
| T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
| T09KPZ | Vimentin | VIM |
P08670 |
C | 1 Reference(s) |
| T98RXH | Focal adhesion kinase 1 | PTK2 |
Q05397 |
C | 1 Reference(s) |
| T60DK9 | Rho-associated protein kinase 1 | ROCK1 |
Q13464 |
C | 1 Reference(s) |
| T11BL5 | Serine/threonine-protein kinase Chk1 | CHEK1 |
O14757 |
C | 1 Reference(s) |
| T29B10 | Interleukin-17A | IL17A |
Q16552 |
C | 1 Reference(s) |
| T78MPR | Synaptophysin | SYP |
P08247 |
C | 1 Reference(s) |
| T99ARN | Forkhead box protein P3 | FOXP3 |
Q9BZS1 |
C | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
C | 1 Reference(s) |
| T30L86 | Tumor necrosis factor receptor superfamily member 10B | TNFRSF10B |
O14763 |
C | 1 Reference(s) |
| T09KQF | Proliferating cell nuclear antigen | PCNA |
P12004 |
C | 1 Reference(s) |
| T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
C | 1 Reference(s) |
| T86VPJ | NA | MIR224 |
NA |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0118 | Kun Ming Shan Hai Tang | 昆明山海棠 | Glaucousback threewingnut | Tripterygium hypoglaucum |
Ckey description of the interaction between compound and target