Compound Description
| ID: C0948 | Common name: aldosterone |
| IUPAC: NA | CAS: CAS:6251-69-0 |
| Chembl ID: NA | Pubchem ID: CID:201562 |
| Formula: C21H28O5 | TCM-ID: TCMC7392 |
| Smiles: CC12CCC(=O)C=C1CCC3C2C4CC5(C3CCC5C(=O)CO)C(O4)O | |
| Alias:
Pregn-4-ene-3,20-dione, 11beta,18-epoxy-18,21-dihydroxy- (8CI);
Aldosterone |
Structure:
|
Related Targets (Total: 58)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
A | 5 Reference(s) |
| T64F54 | Mineralocorticoid receptor | NR3C2 |
P08235 |
A | 2 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 1 Reference(s) |
| T75RAR | Dual oxidase 2 | DUOX2 |
Q9NRD8 |
B | 1 Reference(s) |
| T02GD4 | Tumor necrosis factor ligand superfamily member 6 | FASLG |
P48023 |
B | 1 Reference(s) |
| T47YVM | Serine/threonine-protein kinase Sgk1 | SGK1 |
O00141 |
B | 7 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 5 Reference(s) |
| T94UNN | Large neutral amino acids transporter small subunit 2 | SLC7A8 |
Q9UHI5 |
B | 1 Reference(s) |
| T56RFU | 4F2 cell-surface antigen heavy chain | SLC3A2 |
P08195 |
B | 1 Reference(s) |
| T53ZJN | Neutral amino acid transporter B(0) | SLC1A5 |
Q15758 |
B | 1 Reference(s) |
| T10VEC | Calcitonin [Cleaved into: Calcitonin; Katacalcin | CALCA |
P01258 |
B | 1 Reference(s) |
| T75NEV | Aquaporin-1 | AQP1 |
P29972 |
B | 1 Reference(s) |
| T96XG5 | Melanophilin | MLPH |
Q9BV36 |
B | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
B | 3 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
B | 3 Reference(s) |
| T87UKX | Glucose-6-phosphate 1-dehydrogenase | G6PD |
P11413 |
B | 1 Reference(s) |
| T33JS5 | CCN family member 2 | CCN2 |
P29279 |
B | 2 Reference(s) |
| T17UP9 | C-C motif chemokine 2 | CCL2 |
P13500 |
B | 3 Reference(s) |
| T78O6C | Mothers against decapentaplegic homolog 3 | SMAD3 |
P84022 |
B | 1 Reference(s) |
| T30OIK | 14-3-3 protein beta/alpha | YWHAB |
P31946 |
B | 1 Reference(s) |
| T18KOP | TSC22 domain family protein 3 | TSC22D3 |
Q99576 |
B | 1 Reference(s) |
| T70B7U | Angiotensin-converting enzyme 2 | ACE2 |
Q9BYF1 |
B | 1 Reference(s) |
| T28PHS | Angiotensin-converting enzyme | ACE |
P12821 |
B | 2 Reference(s) |
| T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
B | 1 Reference(s) |
| T78VUO | RAF proto-oncogene serine/threonine-protein kinase | RAF1 |
P04049 |
B | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
B | 1 Reference(s) |
| T75H3W | Cyclin-dependent kinase 2 | CDK2 |
P24941 |
B | 1 Reference(s) |
| T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
B | 1 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 3 Reference(s) |
| T18DZZ | Amiloride-sensitive sodium channel subunit beta | SCNN1B |
P51168 |
B | 3 Reference(s) |
| T02YDU | Amiloride-sensitive sodium channel subunit gamma | SCNN1G |
P51170 |
B | 2 Reference(s) |
| T17FIA | Angiotensinogen | AGT |
P01019 |
B | 2 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 2 Reference(s) |
| T21TC9 | Kallikrein-10 | KLK10 |
O43240 |
B | 1 Reference(s) |
| T44MAF | Aquaporin-2 | AQP2 |
P41181 |
B | 2 Reference(s) |
| T21S10 | Heterogeneous nuclear ribonucleoproteins A2/B1 | HNRNPA2B1 |
P22626 |
B | 1 Reference(s) |
| T18LPB | Cytochrome P450 11B2, mitochondrial | CYP11B2 |
P19099 |
B | 1 Reference(s) |
| T63W0D | DNA damage-inducible transcript 3 protein | DDIT3 |
P35638 |
C | 1 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
C | 1 Reference(s) |
| T28TAQ | Large neutral amino acids transporter small subunit 1 | SLC7A5 |
Q01650 |
C | 1 Reference(s) |
| T87O4D | Mitogen-activated protein kinase 7 | MAPK7 |
Q13164 |
C | 1 Reference(s) |
| T78KL2 | Collagen alpha-1(III) chain | COL3A1 |
P02461 |
C | 1 Reference(s) |
| T24VFB | Somatotropin | GH1 |
P01241 |
C | 1 Reference(s) |
| T86UXL | Cyclin-A2 | CCNA2 |
P20248 |
C | 1 Reference(s) |
| T90D6I | Kallikrein-1 | KLK1 |
P06870 |
C | 1 Reference(s) |
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
C | 1 Reference(s) |
| T94S85 | Collagen alpha-1(I) chain | COL1A1 |
P02452 |
C | 1 Reference(s) |
| T19HZC | Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 2 | HCN2 |
Q9UL51 |
C | 1 Reference(s) |
| T77ISA | Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 | HCN4 |
Q9Y3Q4 |
C | 1 Reference(s) |
| T93VFT | Endothelin-1 | EDN1 |
P05305 |
C | 1 Reference(s) |
| T04MBA | Vascular endothelial growth factor receptor 2 | KDR |
P35968 |
C | 1 Reference(s) |
| T08Q1T | Amiloride-sensitive sodium channel subunit alpha | SCNN1A |
P37088 |
C | 2 Reference(s) |
| T94L9Z | Procollagen C-endopeptidase enhancer 1 | PCOLCE |
Q15113 |
C | 1 Reference(s) |
| T50VJF | Osteopontin | SPP1 |
P10451 |
C | 2 Reference(s) |
| T04TXM | Regucalcin | RGN |
Q15493 |
C | 1 Reference(s) |
| T49ORJ | Peroxisome proliferator-activated receptor alpha | PPARA |
Q07869 |
C | 1 Reference(s) |
| T85R1F | Transcriptional activator protein Pur-alpha | PURA |
Q00577 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target