Compound Description
| ID: C1113 | Common name: heparin |
| IUPAC: (2S,3R,4S,5S,6R)-6-[(2R,3R,4R,5S,6R)-4,6-dihydroxy-5-(sulfoamino)-2-(sulfooxymethyl)oxan-3-yl]oxy-3,4-dihydroxy-5-sulfooxyoxane-2-carboxylic acid | CAS: CAS:9005-49-6 |
| Chembl ID: NA | Pubchem ID: CID:25200909 |
| Formula: C12H21NO20S3 | TCM-ID: TCMC7549 |
| Smiles: C(C1C(C(C(C(O1)O)NS(=O)(=O)O)O)OC2C(C(C(C(O2)C(=O)O)O)O)OS(=O)(=O)O)OS(=O)(=O)O | |
| Alias:
Ardeparin;
Arteven; Bemiparin; CY 216; CY 222; Centaxarin; Certoparin; Clevarin; Clivarin; Clivarine; Dalteparin; Deligoparin; F 202; FR 860; Fluxum; Fragmin A; Fragmin B; Fraxiparin; Gammaparin; H 5284; H 9399; Hapacarin; Heparin subcutan; Heparin sulfate; Heparinic acid; KB 101; Leparan; Livaracine; M 118REH; Mono-embolex; Multiparin; Nadroparin; Nadroparine; Novoheparin; OP 386; OP 622; Octaparin; Pabyrn; Parnaparin; Parvoparin; Reviparin; Sandoparin; Subeparin; Sublingula; Tinzaparin; Triofiban; Vetren; Vitrum AB; alpha-Heparin |
Structure:
|
Related Targets (Total: 53)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T74RBE | Inositol 1,4,5-trisphosphate receptor type 1 | ITPR1 |
Q14643 |
A | 1 Reference(s) |
| T05WEX | E3 ubiquitin-protein ligase RNF19A | RNF19A |
Q9NV58 |
A | 1 Reference(s) |
| T98QOA | DNA-dependent protein kinase catalytic subunit | PRKDC |
P78527 |
A | 1 Reference(s) |
| T20P3F | Tartrate-resistant acid phosphatase type 5 | ACP5 |
P13686 |
A | 1 Reference(s) |
| T55WN8 | Proteinase-activated receptor 2 | F2RL1 |
P55085 |
A | 1 Reference(s) |
| T93YV8 | Tumor necrosis factor receptor superfamily member 11B | TNFRSF11B |
O00300 |
A | 1 Reference(s) |
| T37VLU | Interferon gamma | IFNG |
P01579 |
A | 1 Reference(s) |
| T14Q85 | Heparanase | HPSE |
Q9Y251 |
A | 2 Reference(s) |
| T19CUN | Prothrombin | F2 |
P00734 |
A | 2 Reference(s) |
| T26SKO | Antithrombin-III | SERPINC1 |
P01008 |
A | 1 Reference(s) |
| T10IWJ | Bone morphogenetic protein receptor type-2 | BMPR2 |
Q13873 |
B | 1 Reference(s) |
| T45X9Z | Hepatocyte growth factor | HGF |
P14210 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 1 Reference(s) |
| T47OCS | Fibroblast growth factor 10 | FGF10 |
O15520 |
B | 1 Reference(s) |
| T41DXP | Pleiotrophin | PTN |
P21246 |
B | 1 Reference(s) |
| T06KGA | Integrin alpha-4 | ITGA4 |
P13612 |
B | 1 Reference(s) |
| T98XNZ | Chitinase-3-like protein 1 | CHI3L1 |
P36222 |
B | 1 Reference(s) |
| T68OE2 | Pro-neuregulin-1, membrane-bound isoform | NRG1 |
Q02297 |
B | 1 Reference(s) |
| T56NC7 | Beta-defensin 4A | DEFB4A; DEFB4B |
O15263 |
B | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
B | 2 Reference(s) |
| T31P1D | Metalloproteinase inhibitor 1 | TIMP1 |
P01033 |
B | 1 Reference(s) |
| T01S8U | Metalloproteinase inhibitor 2 | TIMP2 |
P16035 |
B | 1 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
B | 2 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 2 Reference(s) |
| T75H3W | Cyclin-dependent kinase 2 | CDK2 |
P24941 |
B | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 1 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 1 Reference(s) |
| T56TFE | 5'-nucleotidase | NT5E |
P21589 |
B | 1 Reference(s) |
| T57GP2 | ETS domain-containing protein Elk-1 | ELK1 |
P19419 |
B | 1 Reference(s) |
| T04WT7 | Fibronectin | FN1 |
P02751 |
B | 1 Reference(s) |
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
B | 1 Reference(s) |
| T36SOV | Plasminogen activator inhibitor 1 | SERPINE1 |
P05121 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 1 Reference(s) |
| T17CZC | Tissue factor | F3 |
P13726 |
B | 1 Reference(s) |
| T88QQE | Fibroblast growth factor 2 | FGF2 |
P09038 |
B | 3 Reference(s) |
| T95XHB | Integrin alpha-IIb | ITGA2B |
P08514 |
B | 1 Reference(s) |
| T06DT8 | Roundabout homolog 1 | ROBO1 |
Q9Y6N7 |
B | 1 Reference(s) |
| T32G5A | Vitronectin | VTN |
P04004 |
B | 1 Reference(s) |
| T72BCC | Growth/differentiation factor 9 | GDF9 |
O60383 |
B | 1 Reference(s) |
| T18ZHL | Platelet factor 4 | PF4 |
P02776 |
B | 1 Reference(s) |
| T98RPB | Heparin cofactor 2 | SERPIND1 |
P05546 |
B | 1 Reference(s) |
| T21X2S | EMILIN-3 | EMILIN3 |
Q9NT22 |
B | 1 Reference(s) |
| T84XW5 | Placenta growth factor | PGF |
P49763 |
B | 1 Reference(s) |
| T55EQJ | Chondroadherin | CHAD |
O15335 |
B | 1 Reference(s) |
| T84WE9 | Vascular endothelial growth factor receptor 1 | FLT1 |
P17948 |
B | 1 Reference(s) |
| T65CWO | Eosinophil cationic protein | RNASE3 |
P12724 |
B | 1 Reference(s) |
| T87QUW | Actin, aortic smooth muscle | ACTA2 |
P62736 |
C | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
C | 1 Reference(s) |
| T75IW3 | Matrix metalloproteinase-14 | MMP14 |
P50281 |
C | 1 Reference(s) |
| T94L9Z | Procollagen C-endopeptidase enhancer 1 | PCOLCE |
Q15113 |
C | 1 Reference(s) |
| T45TMC | 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 | PLCG1 |
P19174 |
C | 1 Reference(s) |
| T99EYH | Lipoprotein lipase | LPL |
P06858 |
C | 1 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target