Compound Description
| ID: C1115 | Common name: cocaine |
| IUPAC: methyl (1R,2R,3S,5S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate | CAS: CAS:50-36-2 |
| Chembl ID: CHEMBL370805 | Pubchem ID: CID:446220 |
| Formula: C17H21NO4 | TCM-ID: TCMC7550 |
| Smiles: CN1C2CCC1C(C(C2)OC(=O)C3=CC=CC=C3)C(=O)OC | |
| Alias:
methyl (2R,3S)-3-benzoyloxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate
|
Structure:
|
Related Targets (Total: 64)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T45O3H | Phospholipase A1 member A | PLA1A |
Q53H76 |
A | 1 Reference(s) |
| T73WJH | Calcium/calmodulin-dependent protein kinase kinase 2 | CAMKK2 |
Q96RR4 |
B | 1 Reference(s) |
| T43DMF | Kappa-type opioid receptor | OPRK1 |
P41145 |
B | 1 Reference(s) |
| T91QL8 | N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D | NAPEPLD |
Q6IQ20 |
B | 1 Reference(s) |
| T23TJV | Tyrosine 3-monooxygenase | TH |
P07101 |
B | 1 Reference(s) |
| T07S0E | BDNF/NT-3 growth factors receptor | NTRK2 |
Q16620 |
B | 1 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 2 Reference(s) |
| T38T1U | Caspase-8 | CASP8 |
Q14790 |
B | 1 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 2 Reference(s) |
| T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 4 Reference(s) |
| T02DYS | Protein fosB | FOSB |
P53539 |
B | 2 Reference(s) |
| T93VFT | Endothelin-1 | EDN1 |
P05305 |
B | 1 Reference(s) |
| T70U24 | Sigma non-opioid intracellular receptor 1 | SIGMAR1 |
Q99720 |
B | 1 Reference(s) |
| T75B9S | Cyclic AMP-responsive element-binding protein 1 | CREB1 |
P16220 |
B | 2 Reference(s) |
| T18BSV | Proenkephalin-B | PDYN |
P01213 |
B | 1 Reference(s) |
| T84P70 | Urokinase-type plasminogen activator | PLAU |
P00749 |
B | 1 Reference(s) |
| T00EP2 | Tissue-type plasminogen activator | PLAT |
P00750 |
B | 1 Reference(s) |
| T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
B | 1 Reference(s) |
| T49UAP | Ras-specific guanine nucleotide-releasing factor 1 | RASGRF1 |
Q13972 |
B | 1 Reference(s) |
| T47G3X | Glucocorticoid receptor | NR3C1 |
P04150 |
B | 1 Reference(s) |
| T24LWC | Sodium-dependent dopamine transporter | SLC6A3 |
Q01959 |
B | 3 Reference(s) |
| T06MQM | Heat shock protein beta-1 | HSPB1 |
P04792 |
B | 1 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
| T76TED | Pro-opiomelanocortin | POMC |
P01189 |
B | 2 Reference(s) |
| T90SGJ | Caspase-2 | CASP2 |
P42575 |
B | 1 Reference(s) |
| T57GP2 | ETS domain-containing protein Elk-1 | ELK1 |
P19419 |
B | 1 Reference(s) |
| T43G0N | Cytochrome P450 2C8 | CYP2C8 |
P10632 |
B | 1 Reference(s) |
| T69RXK | Cytochrome P450 2C9 | CYP2C9 |
P11712 |
B | 1 Reference(s) |
| T10GDC | Gap junction delta-2 protein | GJD2 |
Q9UKL4 |
B | 1 Reference(s) |
| T77FOL | Neuromodulin | GAP43 |
P17677 |
B | 1 Reference(s) |
| T51WML | Glutamate receptor 1 | GRIA1 |
P42261 |
B | 1 Reference(s) |
| T05WWN | Corticoliberin | CRH |
P06850 |
B | 1 Reference(s) |
| T66NVP | Fatty-acid amide hydrolase 1 | FAAH |
O00519 |
B | 1 Reference(s) |
| T20VPX | Cyclin-dependent-like kinase 5 | CDK5 |
Q00535 |
B | 2 Reference(s) |
| T36RGT | Protein phosphatase 1 regulatory subunit 1B | PPP1R1B |
Q9UD71 |
B | 1 Reference(s) |
| T87WH7 | Fos-related antigen 2 | FOSL2 |
P15408 |
B | 2 Reference(s) |
| T86CQC | Glutamate receptor ionotropic, NMDA 1 | GRIN1 |
Q05586 |
B | 2 Reference(s) |
| T79MVU | Nucleus accumbens-associated protein 1 | NACC1 |
Q96RE7 |
B | 1 Reference(s) |
| T14JBS | Glutamate receptor 2 | GRIA2 |
P42262 |
B | 1 Reference(s) |
| T28IL8 | D(1A) dopamine receptor | DRD1 |
P21728 |
B | 2 Reference(s) |
| T78QVQ | Myosin-7 | MYH7 |
P12883 |
B | 1 Reference(s) |
| T67HXL | Glial cell line-derived neurotrophic factor | GDNF |
P39905 |
B | 1 Reference(s) |
| T48ZIG | D(2) dopamine receptor | DRD2 |
P14416 |
B | 2 Reference(s) |
| T43Y5O | D(3) dopamine receptor | DRD3 |
P35462 |
C | 1 Reference(s) |
| T02OOS | C-C chemokine receptor type 5 | CCR5 |
P51681 |
C | 1 Reference(s) |
| T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
C | 1 Reference(s) |
| T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
C | 1 Reference(s) |
| T77RFX | Alpha-2A adrenergic receptor | ADRA2A |
P08913 |
C | 1 Reference(s) |
| T52XO3 | Cytochrome P450 2J2 | CYP2J2 |
P51589 |
C | 1 Reference(s) |
| T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
C | 1 Reference(s) |
| T69NG6 | Interleukin-10 | IL10 |
P22301 |
C | 1 Reference(s) |
| T55K2O | Regulator of G-protein signaling 9 | RGS9 |
O75916 |
C | 1 Reference(s) |
| T70TT3 | Regulator of G-protein signaling 17 | RGS17 |
Q9UGC6 |
C | 1 Reference(s) |
| T62DHC | Uroplakin-3b | UPK3B |
Q9BT76 |
C | 1 Reference(s) |
| T37ADS | Early growth response protein 1 | EGR1 |
P18146 |
C | 1 Reference(s) |
| T40TU6 | Tissue factor pathway inhibitor 2 | TFPI2 |
P48307 |
C | 1 Reference(s) |
| T33S3M | Regulator of G-protein signaling 2 | RGS2 |
P41220 |
C | 1 Reference(s) |
| T66A7X | Activity-regulated cytoskeleton-associated protein | ARC |
Q7LC44 |
C | 1 Reference(s) |
| T03VS9 | Protein-tyrosine kinase 2-beta | PTK2B |
Q14289 |
C | 1 Reference(s) |
| T53GDC | Tyrosine-protein kinase Lck | LCK |
P06239 |
C | 1 Reference(s) |
| T09X0D | Neurexin-3-beta | NRXN3 |
Q9HDB5 |
C | 1 Reference(s) |
| T73EVE | Cyclic AMP-dependent transcription factor ATF-2 | ATF2 |
P15336 |
C | 1 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 1 Reference(s) |
| T45B9P | ATP-sensitive inward rectifier potassium channel 11 | KCNJ11 |
Q14654 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 0)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|
Ckey description of the interaction between compound and target