Compound Description
| ID: C0554 | Common name: Cholesterol |
| IUPAC: 10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol | CAS: CAS:57-88-5 |
| Chembl ID: CHEMBL3184306 | Pubchem ID: CID:304 |
| Formula: C27H46O | TCM-ID: TCMC2837 |
| Smiles: CC(CCCC(C1CCC2C1(C)CCC1C2CC=C2C1(C)CCC(C2)O)C)C | |
| Alias:
Cholesterol;
(3β)-Cholest-5-en-3-ol; (-)-Cholesterol; 3β-Hydroxycholest-5-ene |
Structure:
|
Related Targets (Total: 54)
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T61DYZ | Phospholipid-transporting ATPase ABCA1 | ABCA1 |
O95477 |
A | 3 Reference(s) |
| T28PHS | Angiotensin-converting enzyme | ACE |
P12821 |
A | 2 Reference(s) |
| T69CTT | Acetyl-CoA acetyltransferase, mitochondrial | ACAT1 |
P24752 |
A | 1 Reference(s) |
| T50V79 | Interleukin-4 | IL4 |
P05112 |
A | 1 Reference(s) |
| T74LFK | Neurogenic locus notch homolog protein 1 | NOTCH1 |
P46531 |
A | 1 Reference(s) |
| T77VME | ATP-binding cassette sub-family F member 3 | ABCF3 |
Q9NUQ8 |
A | 1 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 1 Reference(s) |
| T44BA7 | Tripeptidyl-peptidase 2 | TPP2 |
P29144 |
A | 1 Reference(s) |
| T84AR4 | Smoothened homolog | SMO |
Q99835 |
A | 1 Reference(s) |
| T17JU3 | Keratin, type I cytoskeletal 20 | KRT20 |
P35900 |
A | 1 Reference(s) |
| T99EYH | Lipoprotein lipase | LPL |
P06858 |
A | 1 Reference(s) |
| T68OIU | CREB-regulated transcription coactivator 1 | CRTC1 |
Q6UUV9 |
A | 1 Reference(s) |
| T67U3B | Translocator protein | TSPO |
P30536 |
B | 1 Reference(s) |
| T44S1A | Apolipoprotein A-I | APOA1 |
P02647 |
B | 1 Reference(s) |
| T49PL1 | Low-density lipoprotein receptor | LDLR |
P01130 |
B | 1 Reference(s) |
| T21Q0D | 3-hydroxy-3-methylglutaryl-coenzyme A reductase | HMGCR |
P04035 |
B | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T80SD7 | Sterol regulatory element-binding protein 2 | SREBF2 |
Q12772 |
C | 1 Reference(s) |
| T79TJS | Caveolin-3 | CAV3 |
P56539 |
C | 1 Reference(s) |
| T50MQN | NPC1-like intracellular cholesterol transporter 1 | NPC1L1 |
Q9UHC9 |
C | 3 Reference(s) |
| T25H22 | Protein kinase C beta type | PRKCB |
P05771 |
C | 2 Reference(s) |
| T90K33 | ATP-binding cassette sub-family G member 5 | ABCG5 |
Q9H222 |
C | 1 Reference(s) |
| T61M4P | Nuclear receptor ROR-alpha | RORA |
P35398 |
C | 1 Reference(s) |
| T79UHV | Prolow-density lipoprotein receptor-related protein 1 | LRP1 |
Q07954 |
C | 1 Reference(s) |
| T63YAO | Caveolin-1 | CAV1 |
Q03135 |
C | 1 Reference(s) |
| T56FPY | CD81 antigen | CD81 |
P60033 |
C | 1 Reference(s) |
| T89EW0 | Aquaporin-8 | AQP8 |
O94778 |
C | 1 Reference(s) |
| T21K0F | Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 | ATP2A3 |
Q93084 |
C | 1 Reference(s) |
| T20JZ2 | Androgen receptor | AR |
P10275 |
C | 1 Reference(s) |
| T07S6X | Sulfotransferase 1C2 | SULT1C2 |
O00338 |
C | 1 Reference(s) |
| T92MGC | Phosphatidylcholine:ceramide cholinephosphotransferase 2 | SGMS2 |
Q8NHU3 |
C | 1 Reference(s) |
| T89GCM | Inward rectifier potassium channel 2 | KCNJ2 |
P63252 |
C | 1 Reference(s) |
| T47HOW | NA | MIR185 |
NA |
C | 1 Reference(s) |
| T90IQF | NA | HULC |
NA |
C | 1 Reference(s) |
| T75NEV | Aquaporin-1 | AQP1 |
P29972 |
C | 1 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
C | 1 Reference(s) |
| T34HYH | Interleukin-1 alpha | IL1A |
P01583 |
C | 1 Reference(s) |
| T86TYE | Dehydrodolichyl diphosphate synthase complex subunit NUS1 | NUS1 |
Q96E22 |
C | 1 Reference(s) |
| T93AZS | NA | ECB2 |
NA |
C | 1 Reference(s) |
| T01E8J | Amyloid-beta precursor protein | APP |
P05067 |
C | 1 Reference(s) |
| T38OH4 | Caspase-1 | CASP1 |
P29466 |
C | 1 Reference(s) |
| T30C1L | Sorting nexin-8 | SNX8 |
Q9Y5X2 |
C | 1 Reference(s) |
| T02Z3O | Low-density lipoprotein receptor-related protein 6 | LRP6 |
O75581 |
C | 1 Reference(s) |
| T97ESI | Apolipoprotein E | APOE |
P02649 |
C | 1 Reference(s) |
| T91DA5 | StAR-related lipid transfer protein 5 | STARD5 |
Q9NSY2 |
C | 1 Reference(s) |
| T17T4P | NA | MIR122 |
NA |
C | 1 Reference(s) |
| T08VQQ | Proprotein convertase subtilisin/kexin type 9 | PCSK9 |
Q8NBP7 |
C | 1 Reference(s) |
| T80XW6 | Scavenger receptor class B member 1 | SCARB1 |
Q8WTV0 |
C | 1 Reference(s) |
| T04H8Y | Beta-secretase 1 | BACE1 |
P56817 |
C | 1 Reference(s) |
| T75SPS | Fibroblast growth factor 1 | FGF1 |
P05230 |
C | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 1 Reference(s) |
| T94K7H | Cytochrome P450 7A1 | CYP7A1 |
P22680 |
C | 1 Reference(s) |
| T66IUC | Homeobox protein Nkx-2.5 | NKX2-5 |
P52952 |
C | 1 Reference(s) |
| T95EU5 | ATP-binding cassette sub-family G member 8 | ABCG8 |
Q9H221 |
C | 1 Reference(s) |
*In this table, target level represents the quality confidence indicators of targets.
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Level 'A' represents "Directly inhibit/activate".
Level 'B' represents "Indirectly inhibit/ activate", "Enzyme substate" and "Enzyme product".
Level 'C' represents "Up/Down regulation" and "Others".
Related Herbs (Total: 1)
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0838 | Zhu Zi Shen | 珠子参 | Largeleaf japanese ginseng rhizome | Rhizoma panacis majoris |
Ckey description of the interaction between compound and target