ID: C0226 | Common name: Morphine |
IUPAC: (4R,4aR,7S,7aR,12bS)-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,9-diol | CAS: CAS:57-27-2 |
Chembl ID: CHEMBL70 | Pubchem ID: CID:5288826 |
Formula: C17H19NO3 | TCM-ID: TCMC1600 |
Smiles: CN1CCC23C4C1CC5=C2C(=C(C=C5)O)OC3C(C=C4)O | |
Alias:
Morphinan-3,6α-diol, 7,8-didehydro-4,5α-epoxy-17-methyl-;
(5α,6α)-7,8-Didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol; (-)-Morphine; 10-Hydroxymorphine; Aguettant; DepoDur; Dimorf; Dinamorf; Dulcontin; Duromorph; M-Eslon; MS Contin; Meconium; Morphia; Morphin; Morphina; Morphine; Morphinism; Morphinum; Morphium; Nepenthe; Ospalivina; Sevredol; Statex SR; l-Morphine |
Structure: |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
A | 1 Reference(s) |
T66YJ0 | Mu-type opioid receptor | OPRM1 |
P35372 |
A | 3 Reference(s) |
T30VNV | Myeloperoxidase | MPO |
P05164 |
A | 1 Reference(s) |
T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 2 Reference(s) |
T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
A | 1 Reference(s) |
T44C7S | Gastrin/cholecystokinin type B receptor | CCKBR |
P32239 |
A | 1 Reference(s) |
T73WJH | Calcium/calmodulin-dependent protein kinase kinase 2 | CAMKK2 |
Q96RR4 |
B | 1 Reference(s) |
T16A2X | Catalase | CAT |
P04040 |
B | 1 Reference(s) |
T85Y6T | Adenylate cyclase type 8 | ADCY8 |
P40145 |
B | 1 Reference(s) |
T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 2 Reference(s) |
T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 1 Reference(s) |
T51WML | Glutamate receptor 1 | GRIA1 |
P42261 |
B | 1 Reference(s) |
T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 2 Reference(s) |
T34DZ7 | Interleukin-2 | IL2 |
P60568 |
B | 3 Reference(s) |
T00EP2 | Tissue-type plasminogen activator | PLAT |
P00750 |
B | 1 Reference(s) |
T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 2 Reference(s) |
T37VLU | Interferon gamma | IFNG |
P01579 |
B | 2 Reference(s) |
T23TJV | Tyrosine 3-monooxygenase | TH |
P07101 |
B | 1 Reference(s) |
T08OEP | Monocyte differentiation antigen CD14 | CD14 |
P08571 |
B | 1 Reference(s) |
T86CQC | Glutamate receptor ionotropic, NMDA 1 | GRIN1 |
Q05586 |
B | 3 Reference(s) |
T74SS7 | Glutamate receptor ionotropic, NMDA 2A | GRIN2A |
Q12879 |
B | 1 Reference(s) |
T27ZM7 | Disks large homolog 4 | DLG4 |
P78352 |
B | 1 Reference(s) |
T54IMC | Vesicular glutamate transporter 1 | SLC17A7 |
Q9P2U7 |
B | 1 Reference(s) |
T50V79 | Interleukin-4 | IL4 |
P05112 |
B | 2 Reference(s) |
T66A7X | Activity-regulated cytoskeleton-associated protein | ARC |
Q7LC44 |
B | 1 Reference(s) |
T96N1K | Calcium/calmodulin-dependent protein kinase type IV | CAMK4 |
Q16566 |
B | 1 Reference(s) |
T75B9S | Cyclic AMP-responsive element-binding protein 1 | CREB1 |
P16220 |
B | 2 Reference(s) |
T19EKF | Cholecystokinin | CCK |
P06307 |
B | 1 Reference(s) |
T12WTT | Interleukin-5 | IL5 |
P05113 |
B | 1 Reference(s) |
T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 2 Reference(s) |
T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
B | 2 Reference(s) |
T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 1 Reference(s) |
T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 2 Reference(s) |
T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
B | 1 Reference(s) |
T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
B | 1 Reference(s) |
T02OOS | C-C chemokine receptor type 5 | CCR5 |
P51681 |
B | 2 Reference(s) |
T88ENR | Beta-arrestin-1 | ARRB1 |
P49407 |
B | 1 Reference(s) |
T45FPZ | Antizyme inhibitor 2 | AZIN2 |
Q96A70 |
B | 1 Reference(s) |
T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 2 Reference(s) |
T57HGP | Tumor necrosis factor receptor superfamily member 6 | FAS |
P25445 |
B | 1 Reference(s) |
T32JN2 | Beta-glucuronidase | GUSB |
P08236 |
B | 1 Reference(s) |
T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
B | 1 Reference(s) |
T96U07 | Myristoylated alanine-rich C-kinase substrate | MARCKS |
P29966 |
B | 1 Reference(s) |
T04LY5 | Creatine kinase B-type | CKB |
P12277 |
B | 2 Reference(s) |
T17TKM | Melanocortin receptor 4 | MC4R |
P32245 |
C | 1 Reference(s) |
T05WWN | Corticoliberin | CRH |
P06850 |
C | 1 Reference(s) |
T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 1 Reference(s) |
T74JJN | Fatty acid synthase | FASN |
P49327 |
C | 2 Reference(s) |
T02GD4 | Tumor necrosis factor ligand superfamily member 6 | FASLG |
P48023 |
C | 2 Reference(s) |
T18R9N | Neuroendocrine convertase 1 | PCSK1 |
P29120 |
C | 1 Reference(s) |
T47UGF | Neuroendocrine convertase 2 | PCSK2 |
P16519 |
C | 1 Reference(s) |
T00CXT | Prostaglandin G/H synthase 1 | PTGS1 |
P23219 |
C | 1 Reference(s) |
T55KUF | Guanine nucleotide-binding protein subunit alpha-12 | GNA12 |
Q03113 |
C | 1 Reference(s) |
T56G7O | Acyl-CoA-binding protein | DBI |
P07108 |
C | 2 Reference(s) |
T45TMC | 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 | PLCG1 |
P19174 |
C | 1 Reference(s) |
T02HVB | Midkine | MDK |
P21741 |
C | 1 Reference(s) |
T51UV4 | Trans-acting T-cell-specific transcription factor GATA-3 | GATA3 |
P23771 |
C | 1 Reference(s) |
T92LK2 | Tumor necrosis factor ligand superfamily member 10 | TNFSF10 |
P50591 |
C | 1 Reference(s) |
T35KD8 | C-C chemokine receptor type 3 | CCR3 |
P51677 |
C | 1 Reference(s) |
T54YW8 | C-C motif chemokine 4 | CCL4 |
P13236 |
C | 1 Reference(s) |
T04WTG | Mitogen-activated protein kinase 10 | MAPK10 |
P53779 |
C | 1 Reference(s) |
T43DMF | Kappa-type opioid receptor | OPRK1 |
P41145 |
C | 1 Reference(s) |
T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 2 Reference(s) |
T46K2X | Heat shock 70 kDa protein 4 | HSPA4 |
P34932 |
C | 1 Reference(s) |
T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
C | 1 Reference(s) |
T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 1 Reference(s) |
T79UQC | C-X-C motif chemokine 10 | CXCL10 |
P02778 |
C | 1 Reference(s) |
T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 1 Reference(s) |
T46PRA | Excitatory amino acid transporter 3 | SLC1A1 |
P43005 |
C | 1 Reference(s) |
T31VDH | Myeloid differentiation primary response protein MyD88 | MYD88 |
Q99836 |
C | 1 Reference(s) |
T60UPF | Parvalbumin alpha | PVALB |
P20472 |
C | 1 Reference(s) |
T17E49 | Cannabinoid receptor 1 | CNR1 |
P21554 |
C | 1 Reference(s) |
T67KTV | Transient receptor potential cation channel subfamily V member 1 | TRPV1 |
Q8NER1 |
C | 1 Reference(s) |
T17CNB | Thioredoxin | TXN |
P10599 |
C | 1 Reference(s) |
T19HN8 | UDP-glucuronosyltransferase 2B7 | UGT2B7 |
P16662 |
C | 1 Reference(s) |
T22V6A | Eukaryotic translation initiation factor 2-alpha kinase 3 | EIF2AK3 |
Q9NZJ5 |
C | 1 Reference(s) |
T47YVM | Serine/threonine-protein kinase Sgk1 | SGK1 |
O00141 |
C | 1 Reference(s) |
T90LA2 | Sphingomyelin phosphodiesterase | SMPD1 |
P17405 |
C | 1 Reference(s) |
T23VMI | Tumor necrosis factor | TNF |
P01375 |
C | 2 Reference(s) |
T16KVU | Tumor necrosis factor receptor superfamily member 1A | TNFRSF1A |
P19438 |
C | 1 Reference(s) |
T42D4V | Histone deacetylase 1 | HDAC1 |
Q13547 |
C | 1 Reference(s) |
T00T9M | Thrombospondin-1 | THBS1 |
P07996 |
C | 1 Reference(s) |