ID: C0325 | Common name: Progesterone |
IUPAC: (8S,9S,10R,13S,14S,17S)-17-acetyl-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one | CAS: CAS:57-83-0 |
Chembl ID: CHEMBL103 | Pubchem ID: CID:5994 |
Formula: C21H30O2 | TCM-ID: TCMC1940 |
Smiles: CC(=O)C1CCC2C1(CCC3C2CCC4=CC(=O)CCC34C)C | |
Alias:
Progesterone;
4-Pregnene-3,20-dione; Agolutin; Bio-luton; CIDR; Corlutin; Corlutina; Corluvite; Corporin; Corpus luteum hormone; Crinone; Cue-Mate; Cyclogest; Duraprogen; EAZI-BREED CIDR; Endometrin; Estima; Flavolutan; Fologenon; Gesterol; Gestiron; Gestone; Gestormone; Gestron; Glanducorpin; Gynlutin; Gynolutone; Hormoflaveine; Hormoluton; Lipo-Lutin; Lucorteum Sol; Lugesteron; Lugesterone; Luteal Hormone; Luteinique; Luteocrin normale; Luteodyn; Luteogan; Luteohormone; Luteol; Luteopur; Luteosan; Luteostab; Luteosterone; Luteovis; Luteum; Lutex; Lutidon; Lutin; Lutinus; Lutociclina; Lutocuclin M; Lutocyclin; Lutocyclin M; Lutocylin; Lutoform; Lutogyl; Lutren; Lutromone; Microgest; Minagest; NSC 64377; NSC 9704; Nalutron; Percutacrine Luteinique; Piaponon; Primolut; Prochieve; Progeffik; Progeffik 200; Progekan; Progestan; Progestasert; Progesterol; Progestin; Progestogel; Progestol; Progeston; Progestone; Progestron; Prolets; Prolidon; Proluton; Prometrium; Prontogest; Protormone; Sincrogest; Syngesterone; Syngestrets; Syntolutan; U 3672; Utrogest; Utrogestan; Vitarrine; Δ4-Pregnene-3,20-dione |
Structure:
![]() |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T92E71 | Corticosteroid 11-beta-dehydrogenase isozyme 2 | HSD11B2 |
P80365 |
A | 1 Reference(s) |
T82W6S | Toll-like receptor 3 | TLR3 |
O15455 |
A | 1 Reference(s) |
T74LFK | Neurogenic locus notch homolog protein 1 | NOTCH1 |
P46531 |
A | 1 Reference(s) |
T26KIE | Transcription factor AP-1 | JUN |
P05412 |
A | 2 Reference(s) |
T06UTD | Transcription factor Sp6 | SP6 |
Q3SY56 |
A | 1 Reference(s) |
T15UBS | Suppressor of cytokine signaling 1 | SOCS1 |
O15524 |
A | 1 Reference(s) |
T32YAJ | G-protein coupled estrogen receptor 1 | GPER1 |
Q99527 |
A | 1 Reference(s) |
T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
A | 2 Reference(s) |
T61NZN | Progonadoliberin-1 | GNRH1 |
P01148 |
A | 1 Reference(s) |
T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
A | 2 Reference(s) |
T18B9T | Tubulinyl-Tyr carboxypeptidase 1 | VASH1 |
Q7L8A9 |
A | 1 Reference(s) |
T77RFX | Alpha-2A adrenergic receptor | ADRA2A |
P08913 |
A | 1 Reference(s) |
T70U24 | Sigma non-opioid intracellular receptor 1 | SIGMAR1 |
Q99720 |
A | 1 Reference(s) |
T79STG | Cation channel sperm-associated protein 1 | CATSPER1 |
Q8NEC5 |
A | 1 Reference(s) |
T89VFL | Alpha-crystallin B chain | CRYAB |
P02511 |
A | 1 Reference(s) |
T68XO1 | Indoleamine 2,3-dioxygenase 1 | IDO1 |
P14902 |
A | 2 Reference(s) |
T11RHZ | Reticulon-4 | RTN4 |
Q9NQC3 |
A | 1 Reference(s) |
T89L4V | Insulin | INS |
P01308 |
A | 1 Reference(s) |
T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
A | 1 Reference(s) |
T60A9R | NA | CYP3A |
NA |
A | 1 Reference(s) |
T73A8T | High mobility group nucleosome-binding domain-containing protein 3 | HMGN3 |
Q15651 |
A | 1 Reference(s) |
T24C0P | Bile acid receptor | NR1H4 |
Q96RI1 |
A | 1 Reference(s) |
T25M2J | Anoctamin-1 | ANO1 |
Q5XXA6 |
A | 1 Reference(s) |
T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
A | 3 Reference(s) |
T52VL6 | Signal transducer and activator of transcription 5A | STAT5A |
P42229 |
A | 1 Reference(s) |
T19K8W | Signal transducer and activator of transcription 5B | STAT5B |
P51692 |
A | 1 Reference(s) |
T36H6L | UTP--glucose-1-phosphate uridylyltransferase | UGP2 |
Q16851 |
A | 1 Reference(s) |
T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
A | 1 Reference(s) |
T01S8U | Metalloproteinase inhibitor 2 | TIMP2 |
P16035 |
A | 1 Reference(s) |
T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 1 Reference(s) |
T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
A | 3 Reference(s) |
T31SR7 | Integrin alpha-3 | ITGA3 |
P26006 |
B | 1 Reference(s) |
T52CKD | Pro-epidermal growth factor | EGF |
P01133 |
B | 1 Reference(s) |
T50VJF | Osteopontin | SPP1 |
P10451 |
B | 1 Reference(s) |
T95F6I | Cerebellar degeneration-related antigen 1 | CDR1 |
P51861 |
B | 1 Reference(s) |
T58C7Q | Myelin protein P0 | MPZ |
P25189 |
B | 1 Reference(s) |
T01FNJ | Cadherin-6 | CDH6 |
P55285 |
B | 1 Reference(s) |
T15VAS | Integrin beta-1 | ITGB1 |
P05556 |
B | 1 Reference(s) |
T50BY8 | Interleukin-13 receptor subunit alpha-2 | IL13RA2 |
Q14627 |
B | 1 Reference(s) |
T82G3R | Integrin beta-3 | ITGB3 |
P05106 |
B | 1 Reference(s) |
T83VW4 | Myelin basic protein | MBP |
P02686 |
B | 1 Reference(s) |
T54CIF | Interleukin-8 | CXCL8 |
P10145 |
B | 2 Reference(s) |
T75H3W | Cyclin-dependent kinase 2 | CDK2 |
P24941 |
B | 1 Reference(s) |
T13KGH | Tyrosinase | TYR |
P14679 |
B | 1 Reference(s) |
T55TEP | Steroidogenic acute regulatory protein, mitochondrial | STAR |
P49675 |
B | 1 Reference(s) |
T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
B | 1 Reference(s) |
T02GD4 | Tumor necrosis factor ligand superfamily member 6 | FASLG |
P48023 |
B | 2 Reference(s) |
T24LXT | G2/mitotic-specific cyclin-B1 | CCNB1 |
P14635 |
B | 2 Reference(s) |
T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
B | 1 Reference(s) |
T82SSI | Glycodelin | PAEP |
P09466 |
B | 1 Reference(s) |
T08BOH | CCN family member 5 | CCN5 |
O76076 |
B | 1 Reference(s) |
T64F54 | Mineralocorticoid receptor | NR3C2 |
P08235 |
B | 1 Reference(s) |
T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 1 Reference(s) |
T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 2 Reference(s) |
T23TJV | Tyrosine 3-monooxygenase | TH |
P07101 |
B | 1 Reference(s) |
T11OU8 | Progesterone receptor | PGR |
P06401 |
B | 1 Reference(s) |
T04WT7 | Fibronectin | FN1 |
P02751 |
B | 1 Reference(s) |
T24GGY | Glutamyl aminopeptidase | ENPEP |
Q07075 |
B | 1 Reference(s) |
T75B9S | Cyclic AMP-responsive element-binding protein 1 | CREB1 |
P16220 |
B | 1 Reference(s) |
T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 4 Reference(s) |
T75IW3 | Matrix metalloproteinase-14 | MMP14 |
P50281 |
B | 2 Reference(s) |
T66NVP | Fatty-acid amide hydrolase 1 | FAAH |
O00519 |
B | 2 Reference(s) |
T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
B | 1 Reference(s) |
T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 2 Reference(s) |
T42XY2 | Insulin-like growth factor 1 receptor | IGF1R |
P08069 |
B | 1 Reference(s) |
T06LRM | Insulin-like growth factor-binding protein 2 | IGFBP2 |
P18065 |
B | 1 Reference(s) |
T93WPH | Insulin-like growth factor-binding protein 5 | IGFBP5 |
P24593 |
B | 2 Reference(s) |
T34HYH | Interleukin-1 alpha | IL1A |
P01583 |
B | 2 Reference(s) |
T17UP9 | C-C motif chemokine 2 | CCL2 |
P13500 |
B | 1 Reference(s) |
T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
B | 1 Reference(s) |
T62P0D | Collagenase 3 | MMP13 |
P45452 |
B | 1 Reference(s) |
T53ZQH | Growth/differentiation factor 8 | MSTN |
O14793 |
B | 1 Reference(s) |
T71V6E | Serine/threonine-protein kinase PAK 1 | PAK1 |
Q13153 |
B | 1 Reference(s) |
T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
B | 1 Reference(s) |
T22CPR | Cyclin-G1 | CCNG1 |
P51959 |
B | 1 Reference(s) |
T92HNO | High mobility group protein B1 | HMGB1 |
P09429 |
B | 1 Reference(s) |
T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
B | 2 Reference(s) |
T30VOZ | Epithelial membrane protein 2 | EMP2 |
P54851 |
B | 1 Reference(s) |
T04MBA | Vascular endothelial growth factor receptor 2 | KDR |
P35968 |
B | 1 Reference(s) |
T57B8N | Homeobox protein MSX-2 | MSX2 |
P35548 |
B | 1 Reference(s) |
T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 2 Reference(s) |
T95Y0K | Sphingosine kinase 1 | SPHK1 |
Q9NYA1 |
B | 1 Reference(s) |
T93LMN | Microtubule-associated protein tau | MAPT |
P10636 |
B | 1 Reference(s) |
T82ALJ | Glycogen synthase kinase-3 beta | GSK3B |
P49841 |
B | 2 Reference(s) |
T64BTV | Interleukin-1 beta | IL1B |
P01584 |
B | 1 Reference(s) |
T18SKL | C-C motif chemokine 5 | CCL5 |
P13501 |
B | 1 Reference(s) |
T68OE2 | Pro-neuregulin-1, membrane-bound isoform | NRG1 |
Q02297 |
B | 1 Reference(s) |
T05ZAI | Agrin [Cleaved into: Agrin N-terminal 110 kDa subunit; Agrin C-terminal 110 kDa subunit; Agrin C-terminal 90 kDa fragment | AGRN |
O00468 |
B | 1 Reference(s) |
T56OMG | Fibulin-1 | FBLN1 |
P23142 |
B | 2 Reference(s) |
T17CZC | Tissue factor | F3 |
P13726 |
B | 1 Reference(s) |
T20H9F | Stromelysin-1 | MMP3 |
P08254 |
B | 1 Reference(s) |
T63GUB | Proto-oncogene c-Fos | FOS |
P01100 |
B | 1 Reference(s) |
T58D39 | Osteocalcin | BGLAP |
P02818 |
B | 1 Reference(s) |
T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
B | 1 Reference(s) |
T28V82 | Wilms tumor protein | WT1 |
P19544 |
B | 1 Reference(s) |
T88QEV | Transient receptor potential cation channel subfamily M member 3 | TRPM3 |
Q9HCF6 |
B | 1 Reference(s) |
T88CW3 | Membrane-associated progesterone receptor component 1 | PGRMC1 |
O00264 |
B | 3 Reference(s) |
T85K8L | Forkhead box protein O1 | FOXO1 |
Q12778 |
B | 2 Reference(s) |
T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
B | 1 Reference(s) |
T37ADS | Early growth response protein 1 | EGR1 |
P18146 |
B | 1 Reference(s) |
T93VFT | Endothelin-1 | EDN1 |
P05305 |
B | 1 Reference(s) |
T34ON0 | Endothelin-2 | EDN2 |
P20800 |
B | 1 Reference(s) |
T91CUJ | Endothelin-3 | EDN3 |
P14138 |
B | 1 Reference(s) |
T09YEF | Keratin, type II cytoskeletal 5 | KRT5 |
P13647 |
B | 1 Reference(s) |
T05P7L | Signal transducer and activator of transcription 4 | STAT4 |
Q14765 |
B | 1 Reference(s) |
T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
B | 1 Reference(s) |
T45KYV | Stromal cell-derived factor 1 | CXCL12 |
P48061 |
B | 1 Reference(s) |
T06U3P | Claudin-3 | CLDN3 |
O15551 |
B | 1 Reference(s) |
T72BXP | Platelet endothelial cell adhesion molecule | PECAM1 |
P16284 |
B | 1 Reference(s) |
T97FEH | Homeobox protein Hox-A11 | HOXA11 |
P31270 |
C | 1 Reference(s) |
T33KEM | Kallikrein-4 | KLK4 |
Q9Y5K2 |
C | 1 Reference(s) |
T63EMC | Interleukin-18 | IL18 |
Q14116 |
C | 1 Reference(s) |
T03CZ8 | Catechol O-methyltransferase | COMT |
P21964 |
C | 1 Reference(s) |
T13I7C | Transforming growth factor beta-2 proprotein | TGFB2 |
P61812 |
C | 1 Reference(s) |
T45WII | Transforming growth factor beta-3 proprotein [Cleaved into: Latency-associated peptide | TGFB3 |
P10600 |
C | 1 Reference(s) |
T50TQS | Fibulin-2 | FBLN2 |
P98095 |
C | 1 Reference(s) |
T97KL5 | Microsomal glutathione S-transferase 1 | MGST1 |
P10620 |
C | 1 Reference(s) |
T95V8S | Fumarylacetoacetase | FAH |
P16930 |
C | 1 Reference(s) |
T00T9M | Thrombospondin-1 | THBS1 |
P07996 |
C | 1 Reference(s) |
T41XLQ | E3 SUMO-protein ligase EGR2 | EGR2 |
P11161 |
C | 2 Reference(s) |
T22JG3 | Fibroblast growth factor receptor 2 | FGFR2 |
P21802 |
C | 1 Reference(s) |
T76AZQ | Histidine decarboxylase | HDC |
P19113 |
C | 1 Reference(s) |
T94HUW | Pituitary adenylate cyclase-activating polypeptide | ADCYAP1 |
P18509 |
C | 1 Reference(s) |
T94WHJ | Retinol-binding protein 4 | RBP4 |
P02753 |
C | 1 Reference(s) |
T87TVN | Toll-like receptor 5 | TLR5 |
O60602 |
C | 1 Reference(s) |
T48J2C | Transient receptor potential cation channel subfamily M member 7 | TRPM7 |
Q96QT4 |
C | 1 Reference(s) |
T48J1U | Aldo-keto reductase family 1 member C1 | AKR1C1 |
Q04828 |
C | 1 Reference(s) |
T70P4F | Cysteine-rich secretory protein LCCL domain-containing 2 | CRISPLD2 |
Q9H0B8 |
C | 1 Reference(s) |
T15JRW | Interferon alpha-inducible protein 27, mitochondrial | IFI27 |
P40305 |
C | 1 Reference(s) |
T02IOG | Cyclin-dependent kinase inhibitor 1B | CDKN1B |
P46527 |
C | 1 Reference(s) |
T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
T92FAW | Dual specificity protein phosphatase 1 | DUSP1 |
P28562 |
C | 1 Reference(s) |
T47OQP | Serine palmitoyltransferase 2 | SPTLC2 |
O15270 |
C | 1 Reference(s) |
T66T67 | Gamma-aminobutyric acid receptor subunit alpha-4 | GABRA4 |
P48169 |
C | 1 Reference(s) |
T97FJG | High mobility group nucleosome-binding domain-containing protein 5 | HMGN5 |
P82970 |
C | 1 Reference(s) |
T85JI5 | Vitamin D3 receptor | VDR |
P11473 |
C | 1 Reference(s) |
T40VB1 | Non-histone chromosomal protein HMG-14 | HMGN1 |
P05114 |
C | 1 Reference(s) |
T73AR5 | Complement decay-accelerating factor | CD55 |
P08174 |
C | 1 Reference(s) |
T07TRP | Short transient receptor potential channel 5 | TRPC5 |
Q9UL62 |
C | 1 Reference(s) |
T05WU9 | Serine/threonine-protein phosphatase 2A activator | PTPA |
Q15257 |
C | 1 Reference(s) |
T63VZZ | Metastasis-suppressor KiSS-1 | KISS1 |
Q15726 |
C | 1 Reference(s) |
T85S9Z | Cholesterol side-chain cleavage enzyme, mitochondrial | CYP11A1 |
P05108 |
C | 1 Reference(s) |
T21XA6 | Leukemia inhibitory factor | LIF |
P15018 |
C | 1 Reference(s) |
T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 1 Reference(s) |
T86YQL | Prolactin | PRL |
P01236 |
C | 1 Reference(s) |
Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
---|---|---|---|---|
H0035 | Bai Su Zi | 白苏子 | Common perilla fruit | Perilla frutescens |
H0354 | Ren Dong Teng | 忍冬藤 | Japanese honeysuckle vine | Lonicera japonica |
H0847 | Zi He Che | 紫河车 | Human placenta | Homo sapiens |
H0064 | Jin Yin Hua | 金银花 | Japanese honeysuckle | Lonicera japonica |
H0065 | Jin Yin Hua Ti Qu Ye | 金银花提取液 | Japanese honeysuckle | Lonicera japonica |
H0370 | Ru Xiang | 乳香 | Olibanum | Boswellia carterii |
H0360 | Ren Zhong Bai | 人中白 | Human urine sediment | Homo sapiens |
H0697 | Ya Ma Zi | 亚麻子 | Common flax seed | Linum usitatissimum |