| ID: C1265 | Common name: Curcumin | 
| IUPAC: (1E,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one | CAS: CAS:458-37-7 | 
| Chembl ID: CHEMBL116438 | Pubchem ID: CID:5281767 | 
| Formula: C21H20O6 | TCM-ID: TCMC962 | 
| Smiles: COc1cc(/C=C/C(=C/C(=O)/C=C/c2ccc(c(c2)OC)O)/O)ccc1O | |
| Alias: 
                        
                        1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (E,E)-; Curcumin; (1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione; (E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione; (E,E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione; BR 213; Biocurcumax; C Yellow 15; C.I. 75300; C.I. Natural Yellow 3; Colorant E 100; Curcuma; Curcumax; Curcumin I; Curcumin W; Curcumine; Cureit; Diferuloylmethane; E 100; E 100 (dye); Haidr; Halad; Haldar; Halud; INS 100i; Indian Saffron; Jianghuangsu; Kacha Haldi; Kiriyasu Oil Yellow U; Lipocurc; Longvida; Merita Earth; NSC 32982; NanoCurc; Natural Yellow 3; Natxtra; San-Ei Curcumine AL; San-Ei Gen Curcumine AL; Souchet; Terra Merita; Theracurmin; Theracurmin CR 011L; Turmeric; Turmeric (dye); Turmeric yellow; Ukon; Ukon (dye); Vacurin; Yellow Ginger; Yellow Root; Yo-Kin; trans,trans-Curcumin | Structure:   | 
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence | 
|---|---|---|---|---|---|
| T47HTN | Prostaglandin E synthase | PTGES | O14684 | A | 1 Reference(s) | 
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 | P40763 | A | 3 Reference(s) | 
| T26KIE | Transcription factor AP-1 | JUN | P05412 | A | 5 Reference(s) | 
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 | P19838 | A | 12 Reference(s) | 
| T39M81 | DNA-(apurinic or apyrimidinic site) endonuclease | APEX1 | P27695 | A | 1 Reference(s) | 
| T47VCA | Glutathione S-transferase Mu 5 | GSTM5 | P46439 | A | 1 Reference(s) | 
| T83BVT | Mitochondrial 2-oxodicarboxylate carrier | SLC25A21 | Q9BQT8 | A | 3 Reference(s) | 
| T75HEW | DNA polymerase lambda | POLL | Q9UGP5 | A | 1 Reference(s) | 
| T27IAF | Lactoylglutathione lyase | GLO1 | Q04760 | A | 2 Reference(s) | 
| T69HP8 | P2X purinoceptor 3 | P2RX3 | P56373 | A | 1 Reference(s) | 
| T01E8J | Amyloid-beta precursor protein | APP | P05067 | A | 1 Reference(s) | 
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG | P37231 | A | 3 Reference(s) | 
| T20RA0 | Adenosine deaminase | ADA | P00813 | A | 2 Reference(s) | 
| T01JSX | Carbonyl reductase [NADPH] 1 | CBR1 | P16152 | A | 2 Reference(s) | 
| T23VMI | Tumor necrosis factor | TNF | P01375 | A | 6 Reference(s) | 
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR | P42345 | A | 3 Reference(s) | 
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 | Q16236 | A | 4 Reference(s) | 
| T40DIM | Corticosteroid 11-beta-dehydrogenase isozyme 1 | HSD11B1 | P28845 | A | 2 Reference(s) | 
| T96JGO | Solute carrier organic anion transporter family member 1B1 | SLCO1B1 | Q9Y6L6 | A | 1 Reference(s) | 
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 | P04179 | A | 1 Reference(s) | 
| T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 | Q96P20 | A | 1 Reference(s) | 
| T79QBE | Multidrug resistance-associated protein 5 | ABCC5 | O15440 | A | 1 Reference(s) | 
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 | P08183 | A | 3 Reference(s) | 
| T66GX9 | Proline-rich transmembrane protein 2 | PRRT2 | Q7Z6L0 | A | 2 Reference(s) | 
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 | P45983 | A | 2 Reference(s) | 
| T62JK9 | NA | UGT1A | NA | A | 1 Reference(s) | 
| T60IL5 | Flap endonuclease 1 | FEN1 | P39748 | A | 1 Reference(s) | 
| T41SFE | Histone acetyltransferase p300 | EP300 | Q09472 | A | 1 Reference(s) | 
| T54SB3 | Retrotransposon-derived protein PEG10 | PEG10 | Q86TG7 | A | 1 Reference(s) | 
| T57HGP | Tumor necrosis factor receptor superfamily member 6 | FAS | P25445 | A | 1 Reference(s) | 
| T06Q1R | Amine oxidase [flavin-containing] B | MAOB | P27338 | A | 1 Reference(s) | 
| T65S3S | Tyrosine-protein kinase JAK2 | JAK2 | O60674 | A | 1 Reference(s) | 
| T92BZ2 | Catenin beta-1 | CTNNB1 | P35222 | A | 2 Reference(s) | 
| T78T4E | Hematopoietic prostaglandin D synthase | HPGDS | O60760 | A | 1 Reference(s) | 
| T40JZG | GPI-anchor transamidase | PIGK | Q92643 | A | 1 Reference(s) | 
| T27LA6 | DNA | DNMT1 | P26358 | A | 2 Reference(s) | 
| T38OH4 | Caspase-1 | CASP1 | P29466 | A | 1 Reference(s) | 
| T30VNV | Myeloperoxidase | MPO | P05164 | A | 1 Reference(s) | 
| T26CFB | DNA damage-inducible transcript 3 protein | DDIT3 | P35638;P0DPQ6 | A | 1 Reference(s) | 
| T75IW3 | Matrix metalloproteinase-14 | MMP14 | P50281 | A | 1 Reference(s) | 
| T17YBS | Transmembrane protease serine 11D | TMPRSS11D | O60235 | A | 1 Reference(s) | 
| T80GUN | 72 kDa type IV collagenase | MMP2 | P08253 | A | 1 Reference(s) | 
| T44LWL | Transcription factor p65 | RELA | Q04206 | A | 1 Reference(s) | 
| T20C6X | Kinesin-like protein KIF11 | KIF11 | P52732 | B | 2 Reference(s) | 
| T68OIU | CREB-regulated transcription coactivator 1 | CRTC1 | Q6UUV9 | B | 2 Reference(s) | 
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 | P31749 | B | 5 Reference(s) | 
| T93WZG | G1/S-specific cyclin-D1 | CCND1 | P24385 | B | 5 Reference(s) | 
| T38EQ6 | NAD(P)H dehydrogenase [quinone] 1 | NQO1 | P15559 | B | 2 Reference(s) | 
| T33JGV | Tumor suppressor ARF;Cyclin-dependent kinase inhibitor 2A | CDKN2A | Q8N726;P42771 | B | 1 Reference(s) | 
| T10KMJ | Insulin-like growth factor II | IGF2 | P01344 | B | 1 Reference(s) | 
| T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 | P07900 | B | 1 Reference(s) | 
| T18YXD | Albumin | ALB | P02768 | B | 1 Reference(s) | 
| T05SMP | Folate receptor beta | FOLR2 | P14207 | B | 1 Reference(s) | 
| T34WFL | Proto-oncogene tyrosine-protein kinase receptor Ret | RET | P07949 | B | 1 Reference(s) | 
| T42PUG | Solute carrier family 2, facilitated glucose transporter member 1 | SLC2A1 | P11166 | B | 1 Reference(s) | 
| T12T4H | Brain-derived neurotrophic factor | BDNF | P23560 | B | 3 Reference(s) | 
| T84FV7 | Zinc finger protein SNAI2 | SNAI2 | O43623 | B | 1 Reference(s) | 
| T84OOM | Transcription factor EB | TFEB | P19484 | B | 1 Reference(s) | 
| T04PM9 | Transthyretin | TTR | P02766 | B | 1 Reference(s) | 
| T92HNO | High mobility group protein B1 | HMGB1 | P09429 | C | 2 Reference(s) | 
| T58XLK | Tyrosine-protein phosphatase non-receptor type 1 | PTPN1 | P18031 | C | 2 Reference(s) | 
| T75WT1 | Transcription factor 21 | TCF21 | O43680 | C | 1 Reference(s) | 
| T34N64 | NA | MIR29B1 | NA | C | 1 Reference(s) | 
| T33JS5 | CCN family member 2 | CCN2 | P29279 | C | 4 Reference(s) | 
| T88WHQ | B-lymphocyte antigen CD19 | CD19 | P15391 | C | 1 Reference(s) | 
| T13YN2 | Bcl-2-like protein 1 | Bcl2l1 | Q64373 | C | 2 Reference(s) | 
| T77QE6 | Thrombospondin-4 | THBS4 | P35443 | C | 2 Reference(s) | 
| T94H37 | Cadherin-1 | CDH1 | P12830 | C | 1 Reference(s) | 
| T06SWE | Hematopoietic progenitor cell antigen CD34 | CD34 | P28906 | C | 1 Reference(s) | 
| T42EAZ | Vascular endothelial growth factor A | VEGFA | P15692 | C | 2 Reference(s) | 
| T53Z7Y | Transcriptional coactivator YAP1 | YAP1 | P46937 | C | 1 Reference(s) | 
| T82JWE | Cellular tumor antigen p53 | TP53 | P04637 | C | 5 Reference(s) | 
| T46K2X | Heat shock 70 kDa protein 4 | HSPA4 | P34932 | C | 2 Reference(s) | 
| T40FOE | NA | MIR7-1 | NA | C | 2 Reference(s) | 
| T84RJ0 | NA | MIR7-2 | NA | C | 2 Reference(s) | 
| T31NKI | NA | MIR7-3 | NA | C | 2 Reference(s) | 
| T27M4K | Rho GTPase-activating protein 7 | DLC1 | Q96QB1 | C | 1 Reference(s) | 
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 | P10415 | C | 3 Reference(s) | 
| T81X6W | Endoplasmin | HSP90B1 | P14625 | C | 1 Reference(s) | 
| T10ICM | Oxidized low-density lipoprotein receptor 1 | OLR1 | P78380 | C | 1 Reference(s) | 
| T86ROZ | Heme oxygenase 1 | HMOX1 | P09601 | C | 2 Reference(s) | 
| T89GNB | Fascin | FSCN1 | Q16658 | C | 1 Reference(s) | 
| T28HOM | Leptin | LEP | P41159 | C | 1 Reference(s) | 
| T57L0X | Oxysterols receptor LXR-alpha | NR1H3 | Q13133 | C | 1 Reference(s) | 
| T17A6S | VIP peptides [Cleaved into: Intestinal peptide PHV-42 | VIP | P01282 | C | 1 Reference(s) | 
| T04UTZ | G1/S-specific cyclin-E1 | CCNE1 | P24864 | C | 1 Reference(s) | 
| T38JCD | DNA-binding protein inhibitor ID-1 | ID1 | P41134 | C | 2 Reference(s) | 
| T49TDM | Matrix metalloproteinase-9 | MMP9 | P14780 | C | 1 Reference(s) | 
| T77W6N | Thioredoxin reductase 1, cytoplasmic | TXNRD1 | Q16881 | C | 1 Reference(s) | 
| T16T9T | Krueppel-like factor 15 | KLF15 | Q9UIH9 | C | 1 Reference(s) | 
| T28K6X | Insulin receptor substrate 1 | IRS1 | P35568 | C | 1 Reference(s) | 
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 | P27361 | C | 3 Reference(s) | 
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 | P28482 | C | 3 Reference(s) | 
| T36Q35 | Tumor-associated calcium signal transducer 2 | TACSTD2 | P09758 | C | 3 Reference(s) | 
| T02QZI | NADPH oxidase 5 | NOX5 | Q96PH1 | C | 1 Reference(s) | 
| T85K8L | Forkhead box protein O1 | FOXO1 | Q12778 | C | 1 Reference(s) | 
| T28HCY | Presenilin-1 | PSEN1 | P49768 | C | 2 Reference(s) | 
| T44JTS | Zinc finger and BTB domain-containing protein 7A | ZBTB7A | O95365 | C | 2 Reference(s) | 
| T80TUC | Apoptosis regulator BAX | BAX | Q07812 | C | 2 Reference(s) | 
| T54CIF | Interleukin-8 | CXCL8 | P10145 | C | 2 Reference(s) | 
| T02DKV | Gastrin [Cleaved into: Gastrin-71 | GAST | P01350 | C | 1 Reference(s) | 
| T15JRW | Interferon alpha-inducible protein 27, mitochondrial | IFI27 | P40305 | C | 1 Reference(s) | 
| T95DSF | Tuberin | TSC2 | P49815 | C | 1 Reference(s) | 
| T19AGJ | Tumor necrosis factor ligand superfamily member 13B | TNFSF13B | Q9Y275 | C | 1 Reference(s) | 
| T71BDH | Mitogen-activated protein kinase 14 | MAPK14 | Q16539 | C | 1 Reference(s) | 
| T85U8U | Caspase-3 | CASP3 | P42574 | C | 4 Reference(s) | 
| T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN | P60484 | C | 1 Reference(s) | 
| T84FSA | Forkhead box protein O3 | FOXO3 | O43524 | C | 1 Reference(s) | 
| T23RWU | Type-1 angiotensin II receptor | AGTR1 | P30556 | C | 1 Reference(s) | 
| T82ALJ | Glycogen synthase kinase-3 beta | GSK3B | P49841 | C | 2 Reference(s) | 
| T20JZ2 | Androgen receptor | AR | P10275 | C | 2 Reference(s) | 
| T17UP9 | C-C motif chemokine 2 | CCL2 | P13500 | C | 1 Reference(s) | 
| T70VMI | Nitric oxide synthase, brain | NOS1 | P29475 | C | 1 Reference(s) | 
| T20MBF | Serotransferrin | TF | P02787 | C | 1 Reference(s) | 
| T52ARL | Suppressor of cytokine signaling 3 | SOCS3 | O14543 | C | 1 Reference(s) | 
| T24UPH | NA | MIR206 | NA | C | 1 Reference(s) | 
| T33OSQ | Sterol regulatory element-binding protein 1 | SREBF1 | P36956 | C | 1 Reference(s) | 
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 | P05362 | C | 1 Reference(s) | 
| T69NG6 | Interleukin-10 | IL10 | P22301 | C | 1 Reference(s) | 
| T20E5P | Cytochrome b-245 heavy chain | CYBB | P04839 | C | 1 Reference(s) | 
| T50VJF | Osteopontin | SPP1 | P10451 | C | 1 Reference(s) | 
| T78MPR | Synaptophysin | SYP | P08247 | C | 1 Reference(s) | 
| T33VZN | Retinoic acid receptor beta | RARB | P10826 | C | 1 Reference(s) | 
| T30C8X | Peripheral myelin protein 22 | PMP22 | Q01453 | C | 1 Reference(s) | 
| T00CXT | Prostaglandin G/H synthase 1 | PTGS1 | P23219 | C | 1 Reference(s) | 
| T79KQO | NF-kappa-B inhibitor alpha | NFKBIA | P25963 | C | 1 Reference(s) | 
| T95IYZ | Adiponectin | ADIPOQ | Q15848 | C | 1 Reference(s) | 
| T64BTV | Interleukin-1 beta | IL1B | P01584 | C | 1 Reference(s) | 
| T41BJ0 | NA | MIR130A | NA | C | 1 Reference(s) | 
| T98PLL | Reversion-inducing cysteine-rich protein with Kazal motifs | RECK | O95980 | C | 1 Reference(s) | 
| T37PX5 | Zinc finger protein GLI1 | GLI1 | P08151 | C | 1 Reference(s) | 
| T44Z3T | Metastasis-associated protein MTA1 | MTA1 | Q13330 | C | 1 Reference(s) | 
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 | P01137 | C | 1 Reference(s) | 
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A | Q16665 | C | 1 Reference(s) | 
| T60I6V | E3 SUMO-protein ligase PIAS3 | PIAS3 | Q9Y6X2 | C | 1 Reference(s) | 
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 | P35354 | C | 1 Reference(s) | 
| T38ILG | Zinc finger protein PLAGL1 | PLAGL1 | Q9UM63 | C | 1 Reference(s) | 
| T49UAP | Ras-specific guanine nucleotide-releasing factor 1 | RASGRF1 | Q13972 | C | 1 Reference(s) | 
| T43BVC | Basigin | BSG | P35613 | C | 1 Reference(s) | 
| T75CHS | NA | MIR15A | NA | C | 1 Reference(s) | 
| T49PL1 | Low-density lipoprotein receptor | LDLR | P01130 | C | 1 Reference(s) | 
| T33OPP | Interleukin-6 | IL6 | P05231 | C | 2 Reference(s) | 
| T15URL | Cathelicidin antimicrobial peptide | CAMP | P49913 | C | 1 Reference(s) | 
| T68XO1 | Indoleamine 2,3-dioxygenase 1 | IDO1 | P14902 | C | 1 Reference(s) | 
| T18UDY | Synapsin-1 | SYN1 | P17600 | C | 1 Reference(s) | 
| T95Z7B | Polycomb complex protein BMI-1 | BMI1 | P35226 | C | 1 Reference(s) | 
| T74D4Y | CASP8 and FADD-like apoptosis regulator | CFLAR | O15519 | C | 1 Reference(s) | 
| T09KPZ | Vimentin | VIM | P08670 | C | 1 Reference(s) | 
| T06URY | Transcription factor Sp1 | SP1 | P08047 | C | 1 Reference(s) | 
| T11N8F | NA | MIR7641-1 | NA | C | 1 Reference(s) | 
| T91MKC | Runt-related transcription factor 2 | RUNX2 | Q13950 | C | 1 Reference(s) | 
| T32IXS | Integrin alpha-M | ITGAM | P11215 | C | 1 Reference(s) | 
| T83YZD | Acetylcholinesterase | ACHE | P22303 | C | 1 Reference(s) | 
| T05WYT | CDGSH iron-sulfur domain-containing protein 2 | CISD2 | Q8N5K1 | C | 1 Reference(s) | 
| T09H2Z | Nitric oxide synthase, inducible | NOS2 | P35228 | C | 1 Reference(s) | 
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name | 
|---|---|---|---|---|
| H0556 | Tie Xian Cao | 铁线草 | NA | Adiantum capillus-veneris | 
| H1092 | Gao Liang Jiang | 高良姜 | Lesser galangal | Alpinia officinarum | 
| H1093 | Gao Liang Jiang You | 高良姜油 | Lesser galangal | Alpinia officinarum | 
| H0761 | Yu Jin | 郁金 | AromaticTurmeric | Curcuma aromatica | 
| H0895 | Chuan Yu Jin | 川郁金 | Turmeric | Curcuma longa | 
| H0142 | Liang Jiang | 良姜 | NA | Alpinia officinarum | 
| H0028 | Jiang Huang | 姜黄 | Common turmeric | Curcuma longa |