ID: C1265 | Common name: Curcumin |
IUPAC: (1E,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one | CAS: CAS:458-37-7 |
Chembl ID: CHEMBL116438 | Pubchem ID: CID:5281767 |
Formula: C21H20O6 | TCM-ID: TCMC962 |
Smiles: COc1cc(/C=C/C(=C/C(=O)/C=C/c2ccc(c(c2)OC)O)/O)ccc1O | |
Alias:
1,6-Heptadiene-3,5-dione, 1,7-bis(4-hydroxy-3-methoxyphenyl)-, (E,E)-;
Curcumin; (1E,6E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione; (E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione; (E,E)-1,7-Bis(4-hydroxy-3-methoxyphenyl)-1,6-heptadiene-3,5-dione; BR 213; Biocurcumax; C Yellow 15; C.I. 75300; C.I. Natural Yellow 3; Colorant E 100; Curcuma; Curcumax; Curcumin I; Curcumin W; Curcumine; Cureit; Diferuloylmethane; E 100; E 100 (dye); Haidr; Halad; Haldar; Halud; INS 100i; Indian Saffron; Jianghuangsu; Kacha Haldi; Kiriyasu Oil Yellow U; Lipocurc; Longvida; Merita Earth; NSC 32982; NanoCurc; Natural Yellow 3; Natxtra; San-Ei Curcumine AL; San-Ei Gen Curcumine AL; Souchet; Terra Merita; Theracurmin; Theracurmin CR 011L; Turmeric; Turmeric (dye); Turmeric yellow; Ukon; Ukon (dye); Vacurin; Yellow Ginger; Yellow Root; Yo-Kin; trans,trans-Curcumin |
Structure:
![]() |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T47HTN | Prostaglandin E synthase | PTGES |
O14684 |
A | 1 Reference(s) |
T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
A | 3 Reference(s) |
T26KIE | Transcription factor AP-1 | JUN |
P05412 |
A | 5 Reference(s) |
T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 12 Reference(s) |
T39M81 | DNA-(apurinic or apyrimidinic site) endonuclease | APEX1 |
P27695 |
A | 1 Reference(s) |
T47VCA | Glutathione S-transferase Mu 5 | GSTM5 |
P46439 |
A | 1 Reference(s) |
T83BVT | Mitochondrial 2-oxodicarboxylate carrier | SLC25A21 |
Q9BQT8 |
A | 3 Reference(s) |
T75HEW | DNA polymerase lambda | POLL |
Q9UGP5 |
A | 1 Reference(s) |
T27IAF | Lactoylglutathione lyase | GLO1 |
Q04760 |
A | 2 Reference(s) |
T69HP8 | P2X purinoceptor 3 | P2RX3 |
P56373 |
A | 1 Reference(s) |
T01E8J | Amyloid-beta precursor protein | APP |
P05067 |
A | 1 Reference(s) |
T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
A | 3 Reference(s) |
T20RA0 | Adenosine deaminase | ADA |
P00813 |
A | 2 Reference(s) |
T01JSX | Carbonyl reductase [NADPH] 1 | CBR1 |
P16152 |
A | 2 Reference(s) |
T23VMI | Tumor necrosis factor | TNF |
P01375 |
A | 6 Reference(s) |
T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
A | 3 Reference(s) |
T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
A | 4 Reference(s) |
T40DIM | Corticosteroid 11-beta-dehydrogenase isozyme 1 | HSD11B1 |
P28845 |
A | 2 Reference(s) |
T96JGO | Solute carrier organic anion transporter family member 1B1 | SLCO1B1 |
Q9Y6L6 |
A | 1 Reference(s) |
T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
A | 1 Reference(s) |
T16MRU | NACHT, LRR and PYD domains-containing protein 3 | NLRP3 |
Q96P20 |
A | 1 Reference(s) |
T79QBE | Multidrug resistance-associated protein 5 | ABCC5 |
O15440 |
A | 1 Reference(s) |
T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
A | 3 Reference(s) |
T66GX9 | Proline-rich transmembrane protein 2 | PRRT2 |
Q7Z6L0 |
A | 2 Reference(s) |
T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
A | 2 Reference(s) |
T62JK9 | NA | UGT1A |
NA |
A | 1 Reference(s) |
T60IL5 | Flap endonuclease 1 | FEN1 |
P39748 |
A | 1 Reference(s) |
T41SFE | Histone acetyltransferase p300 | EP300 |
Q09472 |
A | 1 Reference(s) |
T54SB3 | Retrotransposon-derived protein PEG10 | PEG10 |
Q86TG7 |
A | 1 Reference(s) |
T57HGP | Tumor necrosis factor receptor superfamily member 6 | FAS |
P25445 |
A | 1 Reference(s) |
T06Q1R | Amine oxidase [flavin-containing] B | MAOB |
P27338 |
A | 1 Reference(s) |
T65S3S | Tyrosine-protein kinase JAK2 | JAK2 |
O60674 |
A | 1 Reference(s) |
T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
A | 2 Reference(s) |
T78T4E | Hematopoietic prostaglandin D synthase | HPGDS |
O60760 |
A | 1 Reference(s) |
T40JZG | GPI-anchor transamidase | PIGK |
Q92643 |
A | 1 Reference(s) |
T27LA6 | DNA | DNMT1 |
P26358 |
A | 2 Reference(s) |
T38OH4 | Caspase-1 | CASP1 |
P29466 |
A | 1 Reference(s) |
T30VNV | Myeloperoxidase | MPO |
P05164 |
A | 1 Reference(s) |
T26CFB | DNA damage-inducible transcript 3 protein | DDIT3 |
P35638;P0DPQ6 |
A | 1 Reference(s) |
T75IW3 | Matrix metalloproteinase-14 | MMP14 |
P50281 |
A | 1 Reference(s) |
T17YBS | Transmembrane protease serine 11D | TMPRSS11D |
O60235 |
A | 1 Reference(s) |
T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
A | 1 Reference(s) |
T44LWL | Transcription factor p65 | RELA |
Q04206 |
A | 1 Reference(s) |
T20C6X | Kinesin-like protein KIF11 | KIF11 |
P52732 |
B | 2 Reference(s) |
T68OIU | CREB-regulated transcription coactivator 1 | CRTC1 |
Q6UUV9 |
B | 2 Reference(s) |
T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 5 Reference(s) |
T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
B | 5 Reference(s) |
T38EQ6 | NAD(P)H dehydrogenase [quinone] 1 | NQO1 |
P15559 |
B | 2 Reference(s) |
T33JGV | Tumor suppressor ARF;Cyclin-dependent kinase inhibitor 2A | CDKN2A |
Q8N726;P42771 |
B | 1 Reference(s) |
T10KMJ | Insulin-like growth factor II | IGF2 |
P01344 |
B | 1 Reference(s) |
T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
B | 1 Reference(s) |
T18YXD | Albumin | ALB |
P02768 |
B | 1 Reference(s) |
T05SMP | Folate receptor beta | FOLR2 |
P14207 |
B | 1 Reference(s) |
T34WFL | Proto-oncogene tyrosine-protein kinase receptor Ret | RET |
P07949 |
B | 1 Reference(s) |
T42PUG | Solute carrier family 2, facilitated glucose transporter member 1 | SLC2A1 |
P11166 |
B | 1 Reference(s) |
T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
B | 3 Reference(s) |
T84FV7 | Zinc finger protein SNAI2 | SNAI2 |
O43623 |
B | 1 Reference(s) |
T84OOM | Transcription factor EB | TFEB |
P19484 |
B | 1 Reference(s) |
T04PM9 | Transthyretin | TTR |
P02766 |
B | 1 Reference(s) |
T92HNO | High mobility group protein B1 | HMGB1 |
P09429 |
C | 2 Reference(s) |
T58XLK | Tyrosine-protein phosphatase non-receptor type 1 | PTPN1 |
P18031 |
C | 2 Reference(s) |
T75WT1 | Transcription factor 21 | TCF21 |
O43680 |
C | 1 Reference(s) |
T34N64 | NA | MIR29B1 |
NA |
C | 1 Reference(s) |
T33JS5 | CCN family member 2 | CCN2 |
P29279 |
C | 4 Reference(s) |
T88WHQ | B-lymphocyte antigen CD19 | CD19 |
P15391 |
C | 1 Reference(s) |
T13YN2 | Bcl-2-like protein 1 | Bcl2l1 |
Q64373 |
C | 2 Reference(s) |
T77QE6 | Thrombospondin-4 | THBS4 |
P35443 |
C | 2 Reference(s) |
T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 1 Reference(s) |
T06SWE | Hematopoietic progenitor cell antigen CD34 | CD34 |
P28906 |
C | 1 Reference(s) |
T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 2 Reference(s) |
T53Z7Y | Transcriptional coactivator YAP1 | YAP1 |
P46937 |
C | 1 Reference(s) |
T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
C | 5 Reference(s) |
T46K2X | Heat shock 70 kDa protein 4 | HSPA4 |
P34932 |
C | 2 Reference(s) |
T40FOE | NA | MIR7-1 |
NA |
C | 2 Reference(s) |
T84RJ0 | NA | MIR7-2 |
NA |
C | 2 Reference(s) |
T31NKI | NA | MIR7-3 |
NA |
C | 2 Reference(s) |
T27M4K | Rho GTPase-activating protein 7 | DLC1 |
Q96QB1 |
C | 1 Reference(s) |
T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
C | 3 Reference(s) |
T81X6W | Endoplasmin | HSP90B1 |
P14625 |
C | 1 Reference(s) |
T10ICM | Oxidized low-density lipoprotein receptor 1 | OLR1 |
P78380 |
C | 1 Reference(s) |
T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
C | 2 Reference(s) |
T89GNB | Fascin | FSCN1 |
Q16658 |
C | 1 Reference(s) |
T28HOM | Leptin | LEP |
P41159 |
C | 1 Reference(s) |
T57L0X | Oxysterols receptor LXR-alpha | NR1H3 |
Q13133 |
C | 1 Reference(s) |
T17A6S | VIP peptides [Cleaved into: Intestinal peptide PHV-42 | VIP |
P01282 |
C | 1 Reference(s) |
T04UTZ | G1/S-specific cyclin-E1 | CCNE1 |
P24864 |
C | 1 Reference(s) |
T38JCD | DNA-binding protein inhibitor ID-1 | ID1 |
P41134 |
C | 2 Reference(s) |
T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
T77W6N | Thioredoxin reductase 1, cytoplasmic | TXNRD1 |
Q16881 |
C | 1 Reference(s) |
T16T9T | Krueppel-like factor 15 | KLF15 |
Q9UIH9 |
C | 1 Reference(s) |
T28K6X | Insulin receptor substrate 1 | IRS1 |
P35568 |
C | 1 Reference(s) |
T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
C | 3 Reference(s) |
T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
C | 3 Reference(s) |
T36Q35 | Tumor-associated calcium signal transducer 2 | TACSTD2 |
P09758 |
C | 3 Reference(s) |
T02QZI | NADPH oxidase 5 | NOX5 |
Q96PH1 |
C | 1 Reference(s) |
T85K8L | Forkhead box protein O1 | FOXO1 |
Q12778 |
C | 1 Reference(s) |
T28HCY | Presenilin-1 | PSEN1 |
P49768 |
C | 2 Reference(s) |
T44JTS | Zinc finger and BTB domain-containing protein 7A | ZBTB7A |
O95365 |
C | 2 Reference(s) |
T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
C | 2 Reference(s) |
T54CIF | Interleukin-8 | CXCL8 |
P10145 |
C | 2 Reference(s) |
T02DKV | Gastrin [Cleaved into: Gastrin-71 | GAST |
P01350 |
C | 1 Reference(s) |
T15JRW | Interferon alpha-inducible protein 27, mitochondrial | IFI27 |
P40305 |
C | 1 Reference(s) |
T95DSF | Tuberin | TSC2 |
P49815 |
C | 1 Reference(s) |
T19AGJ | Tumor necrosis factor ligand superfamily member 13B | TNFSF13B |
Q9Y275 |
C | 1 Reference(s) |
T71BDH | Mitogen-activated protein kinase 14 | MAPK14 |
Q16539 |
C | 1 Reference(s) |
T85U8U | Caspase-3 | CASP3 |
P42574 |
C | 4 Reference(s) |
T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
C | 1 Reference(s) |
T84FSA | Forkhead box protein O3 | FOXO3 |
O43524 |
C | 1 Reference(s) |
T23RWU | Type-1 angiotensin II receptor | AGTR1 |
P30556 |
C | 1 Reference(s) |
T82ALJ | Glycogen synthase kinase-3 beta | GSK3B |
P49841 |
C | 2 Reference(s) |
T20JZ2 | Androgen receptor | AR |
P10275 |
C | 2 Reference(s) |
T17UP9 | C-C motif chemokine 2 | CCL2 |
P13500 |
C | 1 Reference(s) |
T70VMI | Nitric oxide synthase, brain | NOS1 |
P29475 |
C | 1 Reference(s) |
T20MBF | Serotransferrin | TF |
P02787 |
C | 1 Reference(s) |
T52ARL | Suppressor of cytokine signaling 3 | SOCS3 |
O14543 |
C | 1 Reference(s) |
T24UPH | NA | MIR206 |
NA |
C | 1 Reference(s) |
T33OSQ | Sterol regulatory element-binding protein 1 | SREBF1 |
P36956 |
C | 1 Reference(s) |
T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
T69NG6 | Interleukin-10 | IL10 |
P22301 |
C | 1 Reference(s) |
T20E5P | Cytochrome b-245 heavy chain | CYBB |
P04839 |
C | 1 Reference(s) |
T50VJF | Osteopontin | SPP1 |
P10451 |
C | 1 Reference(s) |
T78MPR | Synaptophysin | SYP |
P08247 |
C | 1 Reference(s) |
T33VZN | Retinoic acid receptor beta | RARB |
P10826 |
C | 1 Reference(s) |
T30C8X | Peripheral myelin protein 22 | PMP22 |
Q01453 |
C | 1 Reference(s) |
T00CXT | Prostaglandin G/H synthase 1 | PTGS1 |
P23219 |
C | 1 Reference(s) |
T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
C | 1 Reference(s) |
T95IYZ | Adiponectin | ADIPOQ |
Q15848 |
C | 1 Reference(s) |
T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
T41BJ0 | NA | MIR130A |
NA |
C | 1 Reference(s) |
T98PLL | Reversion-inducing cysteine-rich protein with Kazal motifs | RECK |
O95980 |
C | 1 Reference(s) |
T37PX5 | Zinc finger protein GLI1 | GLI1 |
P08151 |
C | 1 Reference(s) |
T44Z3T | Metastasis-associated protein MTA1 | MTA1 |
Q13330 |
C | 1 Reference(s) |
T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
C | 1 Reference(s) |
T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
C | 1 Reference(s) |
T60I6V | E3 SUMO-protein ligase PIAS3 | PIAS3 |
Q9Y6X2 |
C | 1 Reference(s) |
T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
C | 1 Reference(s) |
T38ILG | Zinc finger protein PLAGL1 | PLAGL1 |
Q9UM63 |
C | 1 Reference(s) |
T49UAP | Ras-specific guanine nucleotide-releasing factor 1 | RASGRF1 |
Q13972 |
C | 1 Reference(s) |
T43BVC | Basigin | BSG |
P35613 |
C | 1 Reference(s) |
T75CHS | NA | MIR15A |
NA |
C | 1 Reference(s) |
T49PL1 | Low-density lipoprotein receptor | LDLR |
P01130 |
C | 1 Reference(s) |
T33OPP | Interleukin-6 | IL6 |
P05231 |
C | 2 Reference(s) |
T15URL | Cathelicidin antimicrobial peptide | CAMP |
P49913 |
C | 1 Reference(s) |
T68XO1 | Indoleamine 2,3-dioxygenase 1 | IDO1 |
P14902 |
C | 1 Reference(s) |
T18UDY | Synapsin-1 | SYN1 |
P17600 |
C | 1 Reference(s) |
T95Z7B | Polycomb complex protein BMI-1 | BMI1 |
P35226 |
C | 1 Reference(s) |
T74D4Y | CASP8 and FADD-like apoptosis regulator | CFLAR |
O15519 |
C | 1 Reference(s) |
T09KPZ | Vimentin | VIM |
P08670 |
C | 1 Reference(s) |
T06URY | Transcription factor Sp1 | SP1 |
P08047 |
C | 1 Reference(s) |
T11N8F | NA | MIR7641-1 |
NA |
C | 1 Reference(s) |
T91MKC | Runt-related transcription factor 2 | RUNX2 |
Q13950 |
C | 1 Reference(s) |
T32IXS | Integrin alpha-M | ITGAM |
P11215 |
C | 1 Reference(s) |
T83YZD | Acetylcholinesterase | ACHE |
P22303 |
C | 1 Reference(s) |
T05WYT | CDGSH iron-sulfur domain-containing protein 2 | CISD2 |
Q8N5K1 |
C | 1 Reference(s) |
T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
C | 1 Reference(s) |
Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
---|---|---|---|---|
H0761 | Yu Jin | 郁金 | AromaticTurmeric | Curcuma aromatica |
H1093 | Gao Liang Jiang You | 高良姜油 | Lesser galangal | Alpinia officinarum |
H0895 | Chuan Yu Jin | 川郁金 | Turmeric | Curcuma longa |
H0028 | Jiang Huang | 姜黄 | Common turmeric | Curcuma longa |
H1092 | Gao Liang Jiang | 高良姜 | Lesser galangal | Alpinia officinarum |
H0142 | Liang Jiang | 良姜 | NA | Alpinia officinarum |
H0556 | Tie Xian Cao | 铁线草 | NA | Adiantum capillus-veneris |