ID: C0055 | Common name: Estradiol |
IUPAC: (8R,9S,13S,14S,17S)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol | CAS: CAS:50-28-2 |
Chembl ID: CHEMBL135 | Pubchem ID: CID:5757 |
Formula: C18H24O2 | TCM-ID: TCMC1133 |
Smiles: CC12CCC3C(C1CCC2O)CCC4=C3C=CC(=C4)O | |
Alias:
Estradiol;
(17β)-Estra-1,3,5(10)-triene-3,17-diol; (+)-3,17β-Estradiol; 13β-Methyl-1,3,5(10)-gonatriene-3,17β-ol; 17β-Estradiol; 17β-Estradiol E2; 17β-Oestradiol; 3,17-Epidihydroxyestratriene; 3,17β-Dihydroxyestra-1,3,5(10)-triene; 3,17β-Estradiol; Absorlent Matrix; Aerodiol; Alora; Altrad; Aquadiol; Bardiol; Benzogynestry; Beta-estradiol; Bio-E Gel; Climaderm; Climara; Compudose; Compudose 100; Compudose 200; Compudose 365; Compudose 400; Corpagen; Dermestril; Destradiol; Dihydrofollicular hormone; Dihydrofolliculin; Dihydromenformon; Dihydrotheelin; Dihydroxyestrin; Dimenformon; Diogyn; Diogynets; Divigel; E 2; Elestrim; Encore; Epiestriol 50; Estasorb; Estra-1,3,5(10)-triene-3,17-diol, (17β)-; Estra-1,3,5(10)-triene-3,17β-diol; Estrace; Estraderm; Estraderm MX; Estraderm TTS; Estraderm TTS 100; Estraderm TTS 50; Estradiol-17β; Estradot; Estraldine; Estrapatch; Estredox; Estreva; Estring; Estring Vaginal Ring; Estroclim; Estroclim 50; Estrogel; Estrogel HBF; Estropause; Estrovite; Evamist; Evorel; FemSeven; Femanest; Femestral; Femogen; Fempatch; Follicyclin; Gelestra; Ginosedol; Gynergon; Gynodiol; Gynoestryl; IMVEXXY; Innofem; Lamdiol; Macrodiol; Menorest; Menostar; NSC 9895; Nordicol; Oesclim; Oestergon; Oestra-1,3,5(10)-triene-3,17β-diol; Oestradiol; Oestrogel; Oestroglandol; Ovahormon; Ovasterol; Ovastevol; Ovocyclin; Ovocylin; Perlatanol; Primofol; Profoliol; Profoliol B; Progynon; Progynon DH; Sandrena 1; Sprediol; Syndiol; Systen; TX 004HR; Theelin, dihydro-; Vagifem; Vivelle; Vivelle-Dot; Zesteem; Zumenon; β-Estradiol |
Structure: |
Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
---|---|---|---|---|---|
T80PUR | Caspase-7 | CASP7 |
P55210 |
A | 1 Reference(s) |
T25NS3 | Caspase-6 | CASP6 |
P55212 |
A | 1 Reference(s) |
T85U8U | Caspase-3 | CASP3 |
P42574 |
A | 3 Reference(s) |
T38T1U | Caspase-8 | CASP8 |
Q14790 |
A | 1 Reference(s) |
T01QLH | Estrogen receptor | ESR1 |
P03372 |
A | 6 Reference(s) |
T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 2 Reference(s) |
T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
A | 1 Reference(s) |
T86CQC | Glutamate receptor ionotropic, NMDA 1 | GRIN1 |
Q05586 |
A | 1 Reference(s) |
T57MP0 | Chymase | CMA1 |
P23946 |
A | 1 Reference(s) |
T86YQL | Prolactin | PRL |
P01236 |
A | 1 Reference(s) |
T61NZN | Progonadoliberin-1 | GNRH1 |
P01148 |
A | 1 Reference(s) |
T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
A | 1 Reference(s) |
T91MKC | Runt-related transcription factor 2 | RUNX2 |
Q13950 |
A | 1 Reference(s) |
T70HTD | Cytochrome P450 2E1 | CYP2E1 |
P05181 |
A | 1 Reference(s) |
T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
A | 2 Reference(s) |
T73LXA | Heat shock 70 kDa protein 1A;Heat shock 70 kDa protein 1B | HSPA1A;HSPA1B |
P0DMV8;P0DMV9 |
A | 1 Reference(s) |
T23K1O | Calmodulin | CALM3;CALML2;CAM3;CAMC;CAMIII |
P62158 |
B | 1 Reference(s) |
T32P8F | Serine/threonine-protein phosphatase 5 | PPP5C |
P53041 |
B | 1 Reference(s) |
T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
B | 1 Reference(s) |
T47HTN | Prostaglandin E synthase | PTGES |
O14684 |
B | 1 Reference(s) |
T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 2 Reference(s) |
T32YAJ | G-protein coupled estrogen receptor 1 | GPER1 |
Q99527 |
B | 1 Reference(s) |
T11OU8 | Progesterone receptor | PGR |
P06401 |
B | 1 Reference(s) |
T94FQR | Fibroblast growth factor 7 | FGF7 |
P21781 |
B | 1 Reference(s) |
T47OCS | Fibroblast growth factor 10 | FGF10 |
O15520 |
B | 1 Reference(s) |
T22JG3 | Fibroblast growth factor receptor 2 | FGFR2 |
P21802 |
B | 2 Reference(s) |
T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 4 Reference(s) |
T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
B | 2 Reference(s) |
T32IXS | Integrin alpha-M | ITGAM |
P11215 |
B | 1 Reference(s) |
T04OY0 | Granulocyte colony-stimulating factor receptor | CSF3R |
Q99062 |
B | 1 Reference(s) |
T16A2X | Catalase | CAT |
P04040 |
B | 1 Reference(s) |
T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 3 Reference(s) |
T64X48 | C-X-C chemokine receptor type 4 | CXCR4 |
P61073 |
B | 1 Reference(s) |
T45KYV | Stromal cell-derived factor 1 | CXCL12 |
P48061 |
B | 1 Reference(s) |
T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
B | 1 Reference(s) |
T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 1 Reference(s) |
T46AQJ | Glutathione S-transferase P | GSTP1 |
P09211 |
B | 1 Reference(s) |
T64BTV | Interleukin-1 beta | IL1B |
P01584 |
B | 1 Reference(s) |
T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
B | 1 Reference(s) |
T04WT7 | Fibronectin | FN1 |
P02751 |
B | 2 Reference(s) |
T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 1 Reference(s) |
T50FHQ | TGF-beta receptor type-2 | TGFBR2 |
P37173 |
B | 1 Reference(s) |
T62P0D | Collagenase 3 | MMP13 |
P45452 |
B | 1 Reference(s) |
T83QHM | Beta-nerve growth factor | NGF |
P01138 |
B | 1 Reference(s) |
T74LFK | Neurogenic locus notch homolog protein 1 | NOTCH1 |
P46531 |
B | 1 Reference(s) |
T16K98 | Protein jagged-1 | JAG1 |
P78504 |
B | 1 Reference(s) |
T63YAO | Caveolin-1 | CAV1 |
Q03135 |
B | 1 Reference(s) |
T13KGH | Tyrosinase | TYR |
P14679 |
B | 1 Reference(s) |
T67JR8 | Heat shock factor protein 1 | HSF1 |
Q00613 |
B | 1 Reference(s) |
T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 2 Reference(s) |
T05O6O | Estrogen receptor beta | ESR2 |
Q92731 |
B | 2 Reference(s) |
T44S1A | Apolipoprotein A-I | APOA1 |
P02647 |
B | 1 Reference(s) |
T58D39 | Osteocalcin | BGLAP |
P02818 |
B | 1 Reference(s) |
T29PSX | Receptor of activated protein C kinase 1 | RACK1 |
P63244 |
B | 1 Reference(s) |
T24U57 | E-selectin | SELE |
P16581 |
B | 2 Reference(s) |
T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
B | 2 Reference(s) |
T54G8J | Protein kinase C delta type | PRKCD |
Q05655 |
B | 1 Reference(s) |
T78ZF2 | Protein kinase C alpha type | PRKCA |
P17252 |
B | 1 Reference(s) |
T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
B | 1 Reference(s) |
T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 1 Reference(s) |
T37VLU | Interferon gamma | IFNG |
P01579 |
B | 1 Reference(s) |
T11AJ4 | WW domain-containing oxidoreductase | WWOX |
Q9NZC7 |
B | 1 Reference(s) |
T77TY2 | Protein disulfide-isomerase | P4HB |
P07237 |
B | 1 Reference(s) |
T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
B | 2 Reference(s) |
T89L4V | Insulin | INS |
P01308 |
B | 1 Reference(s) |
T35R2F | PR domain zinc finger protein 2 | PRDM2 |
Q13029 |
B | 1 Reference(s) |
T61OY3 | UDP-glucuronosyltransferase 1A1 | UGT1A1 |
P22309 |
B | 1 Reference(s) |
T57YL7 | Sex hormone-binding globulin | SHBG |
P04278 |
B | 1 Reference(s) |
T80OJF | Interstitial collagenase | MMP1 |
P03956 |
C | 1 Reference(s) |
T78O6C | Mothers against decapentaplegic homolog 3 | SMAD3 |
P84022 |
C | 1 Reference(s) |
T61J7T | Mothers against decapentaplegic homolog 2 | SMAD2 |
Q15796 |
C | 1 Reference(s) |
T85AXP | Cytochrome P450 3A4 | CYP3A4 |
P08684 |
C | 1 Reference(s) |
T61HH0 | Prostate-specific antigen | KLK3 |
P07288 |
C | 1 Reference(s) |
T68NCI | Aldo-keto reductase family 1 member B1 | AKR1B1 |
P15121 |
C | 1 Reference(s) |
T29NEF | Resistin | RETN |
Q9HD89 |
C | 1 Reference(s) |
T45WII | Transforming growth factor beta-3 proprotein [Cleaved into: Latency-associated peptide | TGFB3 |
P10600 |
C | 1 Reference(s) |
T47X6Y | Thyrotropin subunit beta | TSHB |
P01222 |
C | 1 Reference(s) |
T21TC9 | Kallikrein-10 | KLK10 |
O43240 |
C | 1 Reference(s) |
T28HOM | Leptin | LEP |
P41159 |
C | 1 Reference(s) |
T68SE0 | Solute carrier family 2, facilitated glucose transporter member 4 | SLC2A4 |
P14672 |
C | 1 Reference(s) |
T52FC6 | Protein NDRG2 | NDRG2 |
Q9UN36 |
C | 1 Reference(s) |
T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
C | 2 Reference(s) |
T76EHP | Glutathione S-transferase A1 | GSTA1 |
P08263 |
C | 2 Reference(s) |
T58N83 | Serine/threonine-protein kinase STK11 | STK11 |
Q15831 |
C | 1 Reference(s) |
T69NNS | PRKC apoptosis WT1 regulator protein | PAWR |
Q96IZ0 |
C | 2 Reference(s) |
T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
C | 1 Reference(s) |
T12T4H | Brain-derived neurotrophic factor | BDNF |
P23560 |
C | 2 Reference(s) |
T63VZZ | Metastasis-suppressor KiSS-1 | KISS1 |
Q15726 |
C | 2 Reference(s) |
T84P70 | Urokinase-type plasminogen activator | PLAU |
P00749 |
C | 1 Reference(s) |
T00EP2 | Tissue-type plasminogen activator | PLAT |
P00750 |
C | 1 Reference(s) |
T42XY2 | Insulin-like growth factor 1 receptor | IGF1R |
P08069 |
C | 1 Reference(s) |
T80MG0 | Growth hormone secretagogue receptor type 1 | GHSR |
Q92847 |
C | 2 Reference(s) |
T98Z62 | NA | MIR144 |
NA |
C | 1 Reference(s) |
T15N66 | Myosin regulatory light polypeptide 9 | MYL9 |
P24844 |
C | 1 Reference(s) |
T74JJN | Fatty acid synthase | FASN |
P49327 |
C | 1 Reference(s) |
T82LND | Myoblast determination protein 1 | MYOD1 |
P15172 |
C | 1 Reference(s) |
T95K0K | Interferon alpha-1/13 | IFNA1; IFNA13 |
P01562 |
C | 1 Reference(s) |
T06JXV | CD44 antigen | CD44 |
P16070 |
C | 1 Reference(s) |
T93SFQ | NAD-dependent protein deacetylase sirtuin-1 | SIRT1 |
Q96EB6 |
C | 1 Reference(s) |
T51EKP | Apolipoprotein M | APOM |
O95445 |
C | 1 Reference(s) |
T47WWK | C-C chemokine receptor type 1 | CCR1 |
P32246 |
C | 1 Reference(s) |
T46PRA | Excitatory amino acid transporter 3 | SLC1A1 |
P43005 |
C | 1 Reference(s) |
T11GHO | Transforming protein RhoA | RHOA |
P61586 |
C | 1 Reference(s) |
T62G0S | Cofilin-1 | CFL1 |
P23528 |
C | 1 Reference(s) |
T82N70 | Interleukin-21 | IL21 |
Q9HBE4 |
C | 1 Reference(s) |
T43QZ3 | Sclerostin | SOST |
Q9BQB4 |
C | 1 Reference(s) |
T77YFO | Voltage-dependent L-type calcium channel subunit alpha-1C | CACNA1C |
Q13936 |
C | 1 Reference(s) |
T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
C | 1 Reference(s) |
T80R6A | Insulin-like growth factor I | IGF1 |
P05019 |
C | 2 Reference(s) |
T87TVN | Toll-like receptor 5 | TLR5 |
O60602 |
C | 1 Reference(s) |
T38IRL | Interferon-stimulated gene 20 kDa protein | ISG20 |
Q96AZ6 |
C | 1 Reference(s) |
T10RBK | Atrial natriuretic peptide receptor 2 | NPR2 |
P20594 |
C | 1 Reference(s) |
T28K6X | Insulin receptor substrate 1 | IRS1 |
P35568 |
C | 1 Reference(s) |
T23RWU | Type-1 angiotensin II receptor | AGTR1 |
P30556 |
C | 1 Reference(s) |
T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
C | 1 Reference(s) |
T76B0A | Gap junction alpha-1 protein | GJA1 |
P17302 |
C | 1 Reference(s) |
T23TJV | Tyrosine 3-monooxygenase | TH |
P07101 |
C | 1 Reference(s) |
T42LAP | NA | MIR190B |
NA |
C | 1 Reference(s) |
T50HUJ | Merlin | NF2 |
P35240 |
C | 1 Reference(s) |
T71HD9 | NA | MIR148A |
NA |
C | 1 Reference(s) |
T52HO1 | HLA class I histocompatibility antigen, alpha chain G | HLA-G |
P17693 |
C | 1 Reference(s) |
T47T27 | C-C motif chemokine 24 | CCL24 |
O00175 |
C | 1 Reference(s) |
T31SX8 | Bone morphogenetic protein 2 | BMP2 |
P12643 |
C | 1 Reference(s) |
T62L0I | Pro-FMRFamide-related neuropeptide VF [Cleaved into: Neuropeptide NPSF; Neuropeptide RFRP-1; Neuropeptide RFRP-2; Neuropeptide NPVF | NPVF |
Q9HCQ7 |
C | 1 Reference(s) |
T51NKF | Alpha-2-antiplasmin | SERPINF2 |
P08697 |
C | 1 Reference(s) |
T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
C | 1 Reference(s) |
T06MXL | Neprilysin | MME |
P08473 |
C | 1 Reference(s) |
T94FK3 | Progonadoliberin-2 | GNRH2 |
O43555 |
C | 1 Reference(s) |
T67KTV | Transient receptor potential cation channel subfamily V member 1 | TRPV1 |
Q8NER1 |
C | 1 Reference(s) |
T43BVC | Basigin | BSG |
P35613 |
C | 1 Reference(s) |
T87DEX | Xanthine dehydrogenase/oxidase [Includes: Xanthine dehydrogenase | XDH |
P47989 |
C | 1 Reference(s) |
T83YZD | Acetylcholinesterase | ACHE |
P22303 |
C | 1 Reference(s) |
T76ZOF | Apolipoprotein A-IV | APOA4 |
P06727 |
C | 1 Reference(s) |
T73PZA | Vesicular inhibitory amino acid transporter | SLC32A1 |
Q9H598 |
C | 1 Reference(s) |
T47G3X | Glucocorticoid receptor | NR3C1 |
P04150 |
C | 1 Reference(s) |
T73ND5 | Myocilin | MYOC |
Q99972 |
C | 1 Reference(s) |
T40MAR | Cadherin-11 | CDH11 |
P55287 |
C | 1 Reference(s) |
T47H3O | Heat shock protein HSP 90-alpha | HSP90AA1 |
P07900 |
C | 1 Reference(s) |
T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
C | 1 Reference(s) |
T04YQC | Homeobox protein SIX6 | SIX6 |
O95475 |
C | 1 Reference(s) |
T06PVX | E3 ubiquitin-protein ligase Mdm2 | MDM2 |
Q00987 |
C | 1 Reference(s) |
T56RMM | DNA | DNMT3A |
Q9Y6K1 |
C | 1 Reference(s) |
T60WNX | Vasopressin-neurophysin 2-copeptin | AVP |
P01185 |
C | 1 Reference(s) |
T02GD4 | Tumor necrosis factor ligand superfamily member 6 | FASLG |
P48023 |
C | 1 Reference(s) |
T53FD0 | Leptin receptor | LEPR |
P48357 |
C | 1 Reference(s) |
T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
C | 1 Reference(s) |
T40DIM | Corticosteroid 11-beta-dehydrogenase isozyme 1 | HSD11B1 |
P28845 |
C | 1 Reference(s) |
T91MLF | Alpha-1-antitrypsin | SERPINA1 |
P01009 |
C | 1 Reference(s) |
T46TBY | Prostaglandin E2 receptor EP2 subtype | PTGER2 |
P43116 |
C | 1 Reference(s) |
T68O49 | Prostaglandin E2 receptor EP4 subtype | PTGER4 |
P35408 |
C | 1 Reference(s) |
T35YGY | Prostaglandin F2-alpha receptor | PTGFR |
P43088 |
C | 1 Reference(s) |
T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
C | 1 Reference(s) |
Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
---|---|---|---|---|
H0521 | Tai Pan Zu Zhi Fen | 胎盘组织粉 | NA | Human placenta |
H0077 | Jiu | 酒 | Ethanol | Vinum |
H1102 | Gu Sui Bu | 骨碎补 | Fortune’s drynaria rhizome | Drynaria fortunei |
H0847 | Zi He Che | 紫河车 | Human placenta | Homo sapiens |
H0382 | San Qi Hua | 三七花 | Sanchi | Panax notoginseng |
H0236 | Mao She Xiang Jin Gao | 毛麝香浸膏 | Abelmusk | Moschus moschiferus |
H0661 | Xiao Hei Dou | 小黑豆 | Black turtle bean | Phaseolus vulgaris |
H0356 | Ren Gong She Xiang | 人工麝香 | Abelmusk | Moschus moschiferus |
H0520 | Tai Pan Fen | 胎盘粉 | Fetus powder | Human placenta |
H0381 | San Qi Gao Fen | 三七膏粉 | Sanchi | Panax notoginseng |
H0380 | San Qi Gan Jin Gao | 三七干浸膏 | Sanchi | Panax notoginseng |
H0385 | San Qi Ye Jing | 三七叶茎 | Sanchi | Panax notoginseng |
H0384 | San Qi Ye | 三七叶 | Folium panax notoginseng | Panax notoginseng |
H0383 | San Qi Jing Ye | 三七茎叶 | Sanchi | Panax notoginseng |
H0437 | She Xiang | 麝香 | Abelmusk | Moschus moschiferus |
H0235 | Mao She Xiang | 毛麝香 | Abelmusk | Moschus moschiferus |
H0360 | Ren Zhong Bai | 人中白 | Human urine sediment | Homo sapiens |