| ID: C0363 | Common name: Resveratrol |
| IUPAC: 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol | CAS: CAS:501-36-0 |
| Chembl ID: CHEMBL165 | Pubchem ID: CID:445154 |
| Formula: C14H12O3 | TCM-ID: TCMC2003 |
| Smiles: C1=CC(=CC=C1C=CC2=CC(=CC(=C2)O)O)O | |
| Alias:
1,3-Benzenediol, 5-[2-(4-hydroxyphenyl)ethenyl]-, (E)-;
3,4',5-Stilbenetriol; Resveratrol; 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1,3-benzenediol; (E)-2-(3,5-Dihydroxyphenyl)-1-(4-hydroxyphenyl)ethene; (E)-3,4',5-Trihydroxystilbene; (E)-5-(p-Hydroxystyryl)resorcinol; (E)-Resveratrol; 3,4',5-Trihydroxy-trans-stilbene; 3,4',5-Trihydroxystilbene; Biofort; CA 1201; Cuspidatin; Melinjo Resveratrol 20; Polygonin; Regu-Fade; Resveratrol P 5; Resvida; SRT 501; SRT 501M; Vineatrol 20M; trans-3,5,4'-Trihydroxystilbene; trans-Resveratrol |
Structure:
|
| Target id | Protein Name | Gene Symbol | Uniprot ID | Target Level | No.of Literature Evidence |
|---|---|---|---|---|---|
| T28WZ9 | Ribosyldihydronicotinamide dehydrogenase [quinone] | NQO2 |
P16083 |
A | 1 Reference(s) |
| T93SFQ | NAD-dependent protein deacetylase sirtuin-1 | SIRT1 |
Q96EB6 |
A | 6 Reference(s) |
| T30VNV | Myeloperoxidase | MPO |
P05164 |
A | 1 Reference(s) |
| T01QLH | Estrogen receptor | ESR1 |
P03372 |
A | 2 Reference(s) |
| T05O6O | Estrogen receptor beta | ESR2 |
Q92731 |
A | 1 Reference(s) |
| T84W8G | Aryl hydrocarbon receptor | AHR |
P35869 |
A | 2 Reference(s) |
| T69XVX | Cytochrome P450 1B1 | CYP1B1 |
Q16678 |
A | 2 Reference(s) |
| T63BQU | Cytochrome P450 1A1 | CYP1A1 |
P04798 |
A | 2 Reference(s) |
| T65S3S | Tyrosine-protein kinase JAK2 | JAK2 |
O60674 |
A | 1 Reference(s) |
| T74JJN | Fatty acid synthase | FASN |
P49327 |
A | 1 Reference(s) |
| T13KGH | Tyrosinase | TYR |
P14679 |
A | 1 Reference(s) |
| T81I4T | 5'-AMP-activated protein kinase catalytic subunit alpha-1 | PRKAA1 |
Q13131 |
A | 7 Reference(s) |
| T70HTD | Cytochrome P450 2E1 | CYP2E1 |
P05181 |
A | 2 Reference(s) |
| T05PKX | Steroid 17-alpha-hydroxylase/17,20 lyase | CYP17A1 |
P05093 |
A | 2 Reference(s) |
| T53MV1 | cGMP-dependent protein kinase 1 | PRKG1 |
Q13976 |
A | 1 Reference(s) |
| T41BXR | NAD-dependent protein deacetylase sirtuin-3, mitochondrial | SIRT3 |
Q9NTG7 |
A | 3 Reference(s) |
| T06RMZ | Nuclear factor NF-kappa-B p105 subunit | NFKB1 |
P19838 |
A | 3 Reference(s) |
| T95Y0K | Sphingosine kinase 1 | SPHK1 |
Q9NYA1 |
A | 2 Reference(s) |
| T09KPZ | Vimentin | VIM |
P08670 |
A | 1 Reference(s) |
| T54X6V | Intermediate conductance calcium-activated potassium channel protein 4 | KCNN4 |
O15554 |
A | 1 Reference(s) |
| T38K2W | Receptor tyrosine-protein kinase erbB-2 | ERBB2 |
P04626 |
A | 1 Reference(s) |
| T96L4T | Krueppel-like factor 4 | KLF4 |
O43474 |
A | 1 Reference(s) |
| T95GWW | cAMP-specific 3',5'-cyclic phosphodiesterase 4A | PDE4A |
P27815 |
A | 1 Reference(s) |
| T11BI7 | Toll-like receptor 4 | TLR4 |
O00206 |
A | 1 Reference(s) |
| T86ROZ | Heme oxygenase 1 | HMOX1 |
P09601 |
A | 4 Reference(s) |
| T99V1T | Dynein heavy chain 8, axonemal | DNAH8 |
Q96JB1 |
A | 1 Reference(s) |
| T68DAN | Histone deacetylase 9 | HDAC9 |
Q9UKV0 |
A | 1 Reference(s) |
| T74LFK | Neurogenic locus notch homolog protein 1 | NOTCH1 |
P46531 |
A | 1 Reference(s) |
| T73LPO | Poly [ADP-ribose] polymerase 1 | PARP1 |
P09874 |
A | 1 Reference(s) |
| T39M81 | DNA-(apurinic or apyrimidinic site) endonuclease | APEX1 |
P27695 |
A | 1 Reference(s) |
| T47YVM | Serine/threonine-protein kinase Sgk1 | SGK1 |
O00141 |
A | 1 Reference(s) |
| T45LZI | Calcium release-activated calcium channel protein 1 | ORAI1 |
Q96D31 |
A | 1 Reference(s) |
| T75A0Y | Citrate synthase, mitochondrial | CS |
O75390 |
A | 1 Reference(s) |
| T39FBA | Thioredoxin-interacting protein | TXNIP |
Q9H3M7 |
A | 2 Reference(s) |
| T50SX0 | Nuclear receptor subfamily 1 group I member 2 | NR1I2 |
O75469 |
A | 1 Reference(s) |
| T70LAB | UDP-glucuronosyltransferase 1A9 | UGT1A9 |
O60656 |
A | 1 Reference(s) |
| T67JR8 | Heat shock factor protein 1 | HSF1 |
Q00613 |
A | 1 Reference(s) |
| T58K62 | Frataxin, mitochondrial | FXN |
Q16595 |
A | 2 Reference(s) |
| T68XO1 | Indoleamine 2,3-dioxygenase 1 | IDO1 |
P14902 |
A | 1 Reference(s) |
| T43SM9 | Peroxisome proliferator-activated receptor gamma coactivator 1-alpha | PPARGC1A |
Q9UBK2 |
A | 2 Reference(s) |
| T21CMG | Hepcidin | HAMP |
P81172 |
A | 1 Reference(s) |
| T21DZX | Amine oxidase [flavin-containing] A | MAOA |
P21397 |
A | 1 Reference(s) |
| T24D36 | Transcription factor A, mitochondrial | TFAM |
Q00059 |
A | 1 Reference(s) |
| T74ETU | Steroid 21-hydroxylase | CYP21A2 |
P08686 |
A | 1 Reference(s) |
| T40DIM | Corticosteroid 11-beta-dehydrogenase isozyme 1 | HSD11B1 |
P28845 |
A | 1 Reference(s) |
| T92UWJ | Beta-2 adrenergic receptor | ADRB2 |
P07550 |
A | 1 Reference(s) |
| T88AJI | Hypoxia-inducible factor 1-alpha | HIF1A |
Q16665 |
A | 4 Reference(s) |
| T01QZQ | Lengsin | LGSN |
Q5TDP6 |
B | 1 Reference(s) |
| T02WMA | Ornithine decarboxylase | ODC1 |
P11926 |
B | 1 Reference(s) |
| T51MC7 | Interleukin-17B | IL17B |
Q9UHF5 |
B | 1 Reference(s) |
| T87DEX | Xanthine dehydrogenase/oxidase [Includes: Xanthine dehydrogenase | XDH |
P47989 |
B | 1 Reference(s) |
| T82JWE | Cellular tumor antigen p53 | TP53 |
P04637 |
B | 11 Reference(s) |
| T93WZG | G1/S-specific cyclin-D1 | CCND1 |
P24385 |
B | 8 Reference(s) |
| T10S5F | Cyclin-dependent kinase 4 | CDK4 |
P11802 |
B | 6 Reference(s) |
| T85U8U | Caspase-3 | CASP3 |
P42574 |
B | 9 Reference(s) |
| T86UXL | Cyclin-A2 | CCNA2 |
P20248 |
B | 3 Reference(s) |
| T71K92 | Apoptosis regulator Bcl-2 | BCL2 |
P10415 |
B | 9 Reference(s) |
| T74I49 | Bcl-2-like protein 1 | BCL2L1 |
Q07817 |
B | 4 Reference(s) |
| T64W2K | Cyclin-dependent kinase inhibitor 1 | CDKN1A |
P38936 |
B | 8 Reference(s) |
| T23P74 | Caspase-9 | CASP9 |
P55211 |
B | 4 Reference(s) |
| T80TUC | Apoptosis regulator BAX | BAX |
Q07812 |
B | 8 Reference(s) |
| T07TMB | Cyclin-dependent kinase 1 | CDK1 |
P06493 |
B | 3 Reference(s) |
| T38BR0 | G1/S-specific cyclin-D2 | CCND2 |
P30279 |
B | 1 Reference(s) |
| T75H3W | Cyclin-dependent kinase 2 | CDK2 |
P24941 |
B | 2 Reference(s) |
| T22IMH | Cyclin-dependent kinase 6 | CDK6 |
Q00534 |
B | 2 Reference(s) |
| T08Q7W | Prostaglandin G/H synthase 2 | PTGS2 |
P35354 |
B | 8 Reference(s) |
| T26KIE | Transcription factor AP-1 | JUN |
P05412 |
B | 7 Reference(s) |
| T79WXA | Mitogen-activated protein kinase 1 | MAPK1 |
P28482 |
B | 3 Reference(s) |
| T29MD1 | Mitogen-activated protein kinase 8 | MAPK8 |
P45983 |
B | 2 Reference(s) |
| T45G32 | Proto-oncogene tyrosine-protein kinase Src | SRC |
P12931 |
B | 2 Reference(s) |
| T44LWL | Transcription factor p65 | RELA |
Q04206 |
B | 12 Reference(s) |
| T49TDM | Matrix metalloproteinase-9 | MMP9 |
P14780 |
B | 8 Reference(s) |
| T54G8J | Protein kinase C delta type | PRKCD |
Q05655 |
B | 2 Reference(s) |
| T78ZF2 | Protein kinase C alpha type | PRKCA |
P17252 |
B | 1 Reference(s) |
| T59IKQ | Vascular cell adhesion protein 1 | VCAM1 |
P19320 |
B | 1 Reference(s) |
| T97FEF | Broad substrate specificity ATP-binding cassette transporter ABCG2 | ABCG2 |
Q9UNQ0 |
B | 1 Reference(s) |
| T67ZT3 | Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN | PTEN |
P60484 |
B | 1 Reference(s) |
| T79KQO | NF-kappa-B inhibitor alpha | NFKBIA |
P25963 |
B | 1 Reference(s) |
| T09H2Z | Nitric oxide synthase, inducible | NOS2 |
P35228 |
B | 6 Reference(s) |
| T49ORJ | Peroxisome proliferator-activated receptor alpha | PPARA |
Q07869 |
B | 1 Reference(s) |
| T58J2Y | Peroxisome proliferator-activated receptor gamma | PPARG |
P37231 |
B | 4 Reference(s) |
| T38WWN | Serum paraoxonase/arylesterase 1 | PON1 |
P27169 |
B | 3 Reference(s) |
| T34HYH | Interleukin-1 alpha | IL1A |
P01583 |
B | 2 Reference(s) |
| T33OPP | Interleukin-6 | IL6 |
P05231 |
B | 3 Reference(s) |
| T54CIF | Interleukin-8 | CXCL8 |
P10145 |
B | 1 Reference(s) |
| T24U57 | E-selectin | SELE |
P16581 |
B | 1 Reference(s) |
| T36B1Q | Baculoviral IAP repeat-containing protein 5 | BIRC5 |
O15392 |
B | 4 Reference(s) |
| T31EJG | Apoptotic protease-activating factor 1 | APAF1 |
O14727 |
B | 1 Reference(s) |
| T88TDZ | RAC-alpha serine/threonine-protein kinase | AKT1 |
P31749 |
B | 9 Reference(s) |
| T67HAF | Signal transducer and activator of transcription 1-alpha/beta | STAT1 |
P42224 |
B | 1 Reference(s) |
| T81KAJ | X-ray repair cross-complementing protein 6 | XRCC6 |
P12956 |
B | 1 Reference(s) |
| T96OOK | Signal transducer and activator of transcription 3 | STAT3 |
P40763 |
B | 3 Reference(s) |
| T50WOV | ATP-dependent translocase ABCB1 | ABCB1 |
P08183 |
B | 1 Reference(s) |
| T86UJG | ATP-binding cassette sub-family C member 3 | ABCC3 |
O15438 |
B | 1 Reference(s) |
| T58XLK | Tyrosine-protein phosphatase non-receptor type 1 | PTPN1 |
P18031 |
B | 1 Reference(s) |
| T93VFT | Endothelin-1 | EDN1 |
P05305 |
B | 1 Reference(s) |
| T30D9G | Superoxide dismutase [Cu-Zn] | SOD1 |
P00441 |
B | 2 Reference(s) |
| T16A2X | Catalase | CAT |
P04040 |
B | 1 Reference(s) |
| T22J9V | Tyrosine-protein kinase JAK1 | JAK1 |
P23458 |
B | 1 Reference(s) |
| T70SFS | Superoxide dismutase [Mn], mitochondrial | SOD2 |
P04179 |
B | 1 Reference(s) |
| T23RWU | Type-1 angiotensin II receptor | AGTR1 |
P30556 |
B | 1 Reference(s) |
| T28K6X | Insulin receptor substrate 1 | IRS1 |
P35568 |
B | 1 Reference(s) |
| T68SE0 | Solute carrier family 2, facilitated glucose transporter member 4 | SLC2A4 |
P14672 |
B | 2 Reference(s) |
| T74D4Y | CASP8 and FADD-like apoptosis regulator | CFLAR |
O15519 |
B | 1 Reference(s) |
| T92BZ2 | Catenin beta-1 | CTNNB1 |
P35222 |
B | 1 Reference(s) |
| T80GUN | 72 kDa type IV collagenase | MMP2 |
P08253 |
B | 3 Reference(s) |
| T22OPB | Nuclear factor erythroid 2-related factor 2 | NFE2L2 |
Q16236 |
B | 1 Reference(s) |
| T53AOE | Transforming growth factor beta-1 proprotein [Cleaved into: Latency-associated peptide | TGFB1 |
P01137 |
B | 2 Reference(s) |
| T74QXI | Serine/threonine-protein kinase mTOR | MTOR |
P42345 |
B | 1 Reference(s) |
| T20JZ2 | Androgen receptor | AR |
P10275 |
B | 1 Reference(s) |
| T17UP9 | C-C motif chemokine 2 | CCL2 |
P13500 |
B | 2 Reference(s) |
| T20W1O | C-C chemokine receptor type 2 | CCR2 |
P41597 |
B | 1 Reference(s) |
| T67X1L | Eukaryotic translation initiation factor 2 subunit 1 | EIF2S1 |
P05198 |
B | 1 Reference(s) |
| T47HTN | Prostaglandin E synthase | PTGES |
O14684 |
B | 1 Reference(s) |
| T42EAZ | Vascular endothelial growth factor A | VEGFA |
P15692 |
B | 4 Reference(s) |
| T88QQE | Fibroblast growth factor 2 | FGF2 |
P09038 |
B | 1 Reference(s) |
| T75HMM | Induced myeloid leukemia cell differentiation protein Mcl-1 | MCL1 |
Q07820 |
B | 1 Reference(s) |
| T92LK2 | Tumor necrosis factor ligand superfamily member 10 | TNFSF10 |
P50591 |
B | 1 Reference(s) |
| T40JMU | Glutamine synthetase | GLUL |
P15104 |
B | 2 Reference(s) |
| T25NSJ | Mitogen-activated protein kinase 3 | MAPK3 |
P27361 |
B | 2 Reference(s) |
| T64UH1 | Nitric oxide synthase, endothelial | NOS3 |
P29474 |
B | 3 Reference(s) |
| T85K8L | Forkhead box protein O1 | FOXO1 |
Q12778 |
B | 3 Reference(s) |
| T13NLM | Cell division control protein 42 homolog | CDC42 |
P60953 |
B | 1 Reference(s) |
| T43BVC | Basigin | BSG |
P35613 |
B | 1 Reference(s) |
| T15VAS | Integrin beta-1 | ITGB1 |
P05556 |
B | 1 Reference(s) |
| T90QGN | T-cell-specific surface glycoprotein CD28 | CD28 |
P10747 |
B | 1 Reference(s) |
| T23OTN | T-lymphocyte activation antigen CD80 | CD80 |
P33681 |
B | 1 Reference(s) |
| T69NG6 | Interleukin-10 | IL10 |
P22301 |
B | 1 Reference(s) |
| T23VMI | Tumor necrosis factor | TNF |
P01375 |
B | 5 Reference(s) |
| T26EZU | Myc proto-oncogene protein | MYC |
P01106 |
B | 1 Reference(s) |
| T72BXP | Platelet endothelial cell adhesion molecule | PECAM1 |
P16284 |
B | 1 Reference(s) |
| T57L0X | Oxysterols receptor LXR-alpha | NR1H3 |
Q13133 |
B | 1 Reference(s) |
| T88LSZ | Aromatase | CYP19A1 |
P11511 |
B | 1 Reference(s) |
| T00CXT | Prostaglandin G/H synthase 1 | PTGS1 |
P23219 |
B | 1 Reference(s) |
| T46NT6 | Cyclin-dependent kinase 7 | CDK7 |
P50613 |
B | 1 Reference(s) |
| T62QDU | Alpha- and gamma-adaptin-binding protein p34 | AAGAB |
Q6PD74 |
B | 1 Reference(s) |
| T88ER9 | Serine/threonine-protein kinase D1 | PRKD1 |
Q15139 |
B | 1 Reference(s) |
| T29WP4 | Protransforming growth factor alpha [Cleaved into: Transforming growth factor alpha | TGFA |
P01135 |
B | 1 Reference(s) |
| T08DOL | Sulfotransferase 1E1 | SULT1E1 |
P49888 |
B | 1 Reference(s) |
| T01JSX | Carbonyl reductase [NADPH] 1 | CBR1 |
P16152 |
B | 1 Reference(s) |
| T01QB9 | Integrin alpha-V | ITGAV |
P06756 |
B | 2 Reference(s) |
| T27IR2 | Probable ATP-dependent RNA helicase DDX5 | DDX5 |
P17844 |
B | 2 Reference(s) |
| T96ZVQ | RAC-beta serine/threonine-protein kinase | AKT2 |
P31751 |
B | 1 Reference(s) |
| T53QS9 | Glutamate--cysteine ligase catalytic subunit | GCLC |
P48506 |
B | 1 Reference(s) |
| T01Z6D | Leukotriene A-4 hydrolase | LTA4H |
P09960 |
B | 1 Reference(s) |
| T32UXD | Leucine-rich repeats and immunoglobulin-like domains protein 1 | LRIG1 |
Q96JA1 |
B | 1 Reference(s) |
| T69VYP | ATP-binding cassette sub-family G member 1 | ABCG1 |
P45844 |
B | 1 Reference(s) |
| T04PM9 | Transthyretin | TTR |
P02766 |
B | 1 Reference(s) |
| T06QUL | Fractalkine | CX3CL1 |
P78423 |
B | 1 Reference(s) |
| T21YOI | Tyrosine--tRNA ligase, cytoplasmic | YARS1 |
P54577 |
B | 1 Reference(s) |
| T18YXD | Albumin | ALB |
P02768 |
B | 1 Reference(s) |
| T69ESY | Ras GTPase-activating protein-binding protein 1 | G3BP1 |
Q13283 |
B | 1 Reference(s) |
| T30SFG | NA | MIR196B |
NA |
B | 1 Reference(s) |
| T78MBM | Transcription factor 4 | TCF4 |
P15884 |
B | 1 Reference(s) |
| T37PX5 | Zinc finger protein GLI1 | GLI1 |
P08151 |
B | 3 Reference(s) |
| T54SZZ | Endoplasmic reticulum chaperone BiP | HSPA5 |
P11021 |
C | 1 Reference(s) |
| T38G9K | TNF receptor-associated factor 2 | TRAF2 |
Q12933 |
C | 1 Reference(s) |
| T44BWE | Adiponectin receptor protein 2 | ADIPOR2 |
Q86V24 |
C | 1 Reference(s) |
| T76B0A | Gap junction alpha-1 protein | GJA1 |
P17302 |
C | 1 Reference(s) |
| T00YMY | Bcl-2-related protein A1 | BCL2A1 |
Q16548 |
C | 1 Reference(s) |
| T42HTA | G1/S-specific cyclin-E2 | CCNE2 |
O96020 |
C | 1 Reference(s) |
| T17CZC | Tissue factor | F3 |
P13726 |
C | 1 Reference(s) |
| T90XYZ | C-reactive protein | CRP |
P02741 |
C | 1 Reference(s) |
| T97VB6 | Adiponectin receptor protein 1 | ADIPOR1 |
Q96A54 |
C | 1 Reference(s) |
| T64BTV | Interleukin-1 beta | IL1B |
P01584 |
C | 1 Reference(s) |
| T63W0D | DNA damage-inducible transcript 3 protein | DDIT3 |
P35638 |
C | 1 Reference(s) |
| T10HL8 | Intercellular adhesion molecule 1 | ICAM1 |
P05362 |
C | 1 Reference(s) |
| T02XPT | SPARC | SPARC |
P09486 |
C | 1 Reference(s) |
| T45X9Z | Hepatocyte growth factor | HGF |
P14210 |
C | 1 Reference(s) |
| T47WT6 | Breast cancer type 1 susceptibility protein | BRCA1 |
P38398 |
C | 1 Reference(s) |
| T59EBF | Breast cancer type 2 susceptibility protein | BRCA2 |
P51587 |
C | 1 Reference(s) |
| T13I7C | Transforming growth factor beta-2 proprotein | TGFB2 |
P61812 |
C | 1 Reference(s) |
| T94H37 | Cadherin-1 | CDH1 |
P12830 |
C | 2 Reference(s) |
| T95IYZ | Adiponectin | ADIPOQ |
Q15848 |
C | 2 Reference(s) |
| T28HOM | Leptin | LEP |
P41159 |
C | 1 Reference(s) |
| T92EME | Membrane-bound transcription factor site-1 protease | MBTPS1 |
Q14703 |
C | 1 Reference(s) |
| T55IBP | Zinc finger protein SNAI1 | SNAI1 |
O95863 |
C | 1 Reference(s) |
| T50VJF | Osteopontin | SPP1 |
P10451 |
C | 1 Reference(s) |
| T37G49 | Platelet-activating factor acetylhydrolase | PLA2G7 |
Q13093 |
C | 1 Reference(s) |
| T43N2D | Epidermal growth factor receptor | EGFR |
P00533 |
C | 2 Reference(s) |
| T28PHS | Angiotensin-converting enzyme | ACE |
P12821 |
C | 1 Reference(s) |
| T00HDE | Parkinson disease protein 7 | PARK7 |
Q99497 |
C | 1 Reference(s) |
| T53MUA | DNA-binding protein RFX5 | RFX5 |
P48382 |
C | 1 Reference(s) |
| T62P0D | Collagenase 3 | MMP13 |
P45452 |
C | 1 Reference(s) |
| T70B7U | Angiotensin-converting enzyme 2 | ACE2 |
Q9BYF1 |
C | 1 Reference(s) |
| T28HCY | Presenilin-1 | PSEN1 |
P49768 |
C | 1 Reference(s) |
| T89L4V | Insulin | INS |
P01308 |
C | 2 Reference(s) |
| T14JSQ | Baculoviral IAP repeat-containing protein 2 | BIRC2 |
Q13490 |
C | 1 Reference(s) |
| T85NQ0 | NA | MALAT1 |
NA |
C | 1 Reference(s) |
| T30UDV | Klotho | KL |
Q9UEF7 |
C | 1 Reference(s) |
| T42GML | NA | MIR183 |
NA |
C | 1 Reference(s) |
| T98JPP | Carnitine O-palmitoyltransferase 1, liver isoform | CPT1A |
P50416 |
C | 1 Reference(s) |
| T67RBZ | Mitochondrial uncoupling protein 2 | UCP2 |
P55851 |
C | 1 Reference(s) |
| T08U92 | Mitochondrial brown fat uncoupling protein 1 | UCP1 |
P25874 |
C | 1 Reference(s) |
| T16IWB | Growth arrest and DNA damage-inducible protein GADD45 alpha | GADD45A |
P24522 |
C | 1 Reference(s) |
| T07BRZ | E3 ubiquitin-protein ligase UHRF1 | UHRF1 |
Q96T88 |
C | 1 Reference(s) |
| T53YWQ | Pro-neuropeptide Y [Cleaved into: Neuropeptide Y | NPY |
P01303 |
C | 1 Reference(s) |
| T78EMM | Nuclear pore glycoprotein p62 | NUP62 |
P37198 |
C | 1 Reference(s) |
| T35OPL | Sonic hedgehog protein | SHH |
Q15465 |
C | 1 Reference(s) |
| T27LA6 | DNA | DNMT1 |
P26358 |
C | 1 Reference(s) |
| T71GRQ | Hexokinase-2 | HK2 |
P52789 |
C | 1 Reference(s) |
| T78PK3 | cAMP-dependent protein kinase catalytic subunit alpha | PRKACA |
P17612 |
C | 1 Reference(s) |
| T16KVU | Tumor necrosis factor receptor superfamily member 1A | TNFRSF1A |
P19438 |
C | 1 Reference(s) |
| T12IEI | Cadherin-2 | CDH2 |
P19022 |
C | 1 Reference(s) |
| T37ADS | Early growth response protein 1 | EGR1 |
P18146 |
C | 1 Reference(s) |
| T83YZD | Acetylcholinesterase | ACHE |
P22303 |
C | 1 Reference(s) |
| T80R6A | Insulin-like growth factor I | IGF1 |
P05019 |
C | 1 Reference(s) |
| T06MQM | Heat shock protein beta-1 | HSPB1 |
P04792 |
C | 1 Reference(s) |
| T83QKS | Regenerating islet-derived protein 3-alpha | REG3A |
Q06141 |
C | 1 Reference(s) |
| T70EB9 | Nephrin | NPHS1 |
O60500 |
C | 1 Reference(s) |
| T33FEZ | NA | MIR18A |
NA |
C | 1 Reference(s) |
| T75CHS | NA | MIR15A |
NA |
C | 1 Reference(s) |
| T08JAV | Phosphatidate phosphatase LPIN1 | LPIN1 |
Q14693 |
C | 1 Reference(s) |
| T38EXQ | Profilin-1 | PFN1 |
P07737 |
C | 1 Reference(s) |
| T16S8T | Baculoviral IAP repeat-containing protein 7 | BIRC7 |
Q96CA5 |
C | 1 Reference(s) |
| T31G6V | Ras association domain-containing protein 1 | RASSF1 |
Q9NS23 |
C | 1 Reference(s) |
| T27IAF | Lactoylglutathione lyase | GLO1 |
Q04760 |
C | 1 Reference(s) |
| T26RYP | CD83 antigen | CD83 |
Q01151 |
C | 1 Reference(s) |
| T84FSA | Forkhead box protein O3 | FOXO3 |
O43524 |
C | 1 Reference(s) |
| T28IEO | Podocin | NPHS2 |
Q9NP85 |
C | 1 Reference(s) |
| T43LYL | X-box-binding protein 1 | XBP1 |
P17861 |
C | 1 Reference(s) |
| T47MPW | T-lymphocyte activation antigen CD86 | CD86 |
P42081 |
C | 1 Reference(s) |
| T40NB1 | Ribosomal protein S6 kinase beta-1 | RPS6KB1 |
P23443 |
C | 1 Reference(s) |
| T72QH0 | Eukaryotic translation initiation factor 4E-binding protein 1 | EIF4EBP1 |
Q13541 |
C | 1 Reference(s) |
| Herb id | Chinese Pin Yin | Chinese Character | English Name | Latin Name |
|---|---|---|---|---|
| H0765 | Chi Dou | 赤豆 | Assuki bean | Vigna angularis |
| H0269 | Mu Gua | 木瓜 | Chinese floweringquince | Chaenomeles sinensis |
| H0358 | Ren Shen Ye | 人参叶 | Ginseng leaf | Panax ginseng |
| H0472 | Shu Da Huang | 熟大黄 | NA | Rheum palmatum |
| H0926 | Da Huang | 大黄 | Medicinal rhubarb | Rheum officinale |
| H0927 | Da Huang Jin Gao | 大黄浸膏 | Medicinal rhubarb | Rheum officinale |
| H1213 | Hu Zhang | 虎杖 | Japanese fleeceflower | Polygonum cuspidatum |
| H0226 | Man Yue Mei | 蔓越莓 | Cranberry | Vaccinium oxycoccos |
| H0396 | Sang Ye | 桑叶 | White mulberry leaf | Morus alba |
| H0357 | Ren Shen | 人参 | Ginseng | Panax ginseng |
| H0434 | She Pu Tao | 蛇葡萄 | Ampelopsis | Ampelopsis brevipedunculata |
| H0932 | Ba Qia | 菝葜 | Chinaroot greenbrier | Smilax china |
| H1117 | Guan Zhong | 贯众 | Male fern rhizome | Dryopteris crassirhizoma |
| H0617 | Qian Cao Teng | 茜草藤 | NA | Rubia cordifolia |
| H0270 | Mu Hu Die | 木蝴蝶 | Indian trumpetflower | Oroxylum indicum |
| H0883 | Chuan She Gan | 川射干 | Blackberrylily | Belamcanda chinensis |
| H0693 | Xue Xie | 血蝎 | Dragon's blood | Daemonorops draco |
| H0432 | She Gan | 射干 | Blackberrylily | Belamcanda chinensis |
| H0928 | Da Huang Liu Jin Gao | 大黄流浸膏 | Medicinal rhubarb | Rheum officinale |
| H1166 | He Shou Wu | 何首乌 | Tuber fleeceflower | Polygonum multiflorum |
| H0570 | Tu Fu Ling | 土茯苓 | Glabrous greenbrier | Smilax glabra |
| H0391 | Sang Pi | 桑皮 | Prepared root-bark white mulberry | Morus alba |
| H0397 | Sang Zhi | 桑枝 | White mulberry branch | Morus alba |
| H0416 | Shan Shen | 山参 | NA | Panax ginseng |
| H0626 | Xi Nan Huang Qin | 西南黄芩 | Yunnan skullcap | Scutellaria amoena |